Post a New Question

Homework Help: Science: Chemistry

Recent Homework Questions About Chemistry

chemistry need help so bad seriously help plz
Use Rydbuz equation to calculate the wavelength of the third line in the paschen series of the hydrogen spectrum.give ur answer in Nm. RH=2.18 * 10^-18j, H=6.63 * 10^-34J. Plz help m

Describe how you would determine the melting point of a salt of benzoic acid with melting point of 170°c

A solution is labeled 0.450m hcl. What is the h+ for the solution?

what is the balanced equation for Sodium Hydroxide and Water

Use the Henderson Hasselbalch equations to solve for the Ka of the acid. Solution [HX]=0.200M and [NaX]=0.200M. They both have a pH of 4.11.

An ionic compound dissolved in water, separated into its ions according to the following equation: MA2 (s)--> M^+2 (aq) + 2A^- (aq). If the ground state electron configuration of the two ions are similar to those of neon. Ne, and of Kr, the two elements in the ionic ...

How many grams of lithium are required to completely react with 61.9 mL of N2 gas at STP

chemistry help anyone
use Rydbuz equation to calculate the wavelength of the third line in the paschen series of the hydrogen spectrum.give ur answer in Nm. RH=2.18 * 10^-18j, H=6.63 * 10^-34J. Step plz

What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that is buffered at a pH of 4.75 and has a freezing point of -2.0 ∘C? (Assume complete dissociation of sodium benzoate and a density of 1.01 g/mL for the solution.)

chemistry plz help help
Use Rydbuz equation to calculate the wavelength of the third line in the paschen series of the hydrogen spectrum.give ur answer in Nm. RH=2.18 * 10^-18j, H=6.63 * 10^-34J.

0.25 mol dm-3 solution of hydrochloric acid?

Iron can be determined gravimetrically by precipitating as Fe(OH)3 and igniting to Fe2O3. The sample to be analyzed is weighed and transferred to a 400-mL beaker where it is dissolved in 50 mL of H2O and 10 mL of 6 M HCl. Any Fe2+ that is present is oxidized to Fe3+ with 1...

College Chemistry
Calculate the pH at the equivalence point in the titration of 55.0 mL of 0.180 M methylamine(Kb = 4.4 × 10−4) with 0.330 M HCl.

What is the symbol equation of iron nails with copper sulfate solution.

25.0 g of potassium acetate (CH 3 COOK) are dissolved in 1.00 L of water. Calculate the pH of this solution. (PKa = 4.76 for CH3COOH)

What is the ratio of rate constants at 305k and 300k if the activation energy of a reaction is 58.3kJ/mol

How do you rationalize an infrared spectrum of salicylic acid and aspirin? How do you know which is which?

What is the hydrogen ion concentration of a 0.22 M hypochlorous acid solution with Ka = 3.5E-8? The equation for the dissociation of hypochlorous acid is: HOCl(aq) = H+(aq) + OCl-(aq). I keep getting 3.60 as the concentration, but that is the wrong answer. Using ICE: Eq: HOCl...

metals with 8-hydroxyquinoline, C9H7NO. After weighing the mixed precipitate, the precipitate is dissolved and the amount of 8-hydroxyquinoline determined by another method. In a typical analysis, a 127.3 mg sample of an alloy containing iron, manganese, and other metals was ...

How do you rationalize an infrared spectrum of salicylic acid and aspirin? How do you know which is which?

How many grams of NaHCO3 should be added to one liter of 0.100 M H2CO3 (Ka = 4.2 x 10-7) to prepare a buffer with pH = 7.00? I got molefrom.100/1L equal .100mole. where do I go from here?

a group of grade three students, along with their science teacher, were outside the classroom observing plant species. upon observation, the students recognized that some plant leaves were very pale yellow and weak looking while some looked healthy. suggest an appropriate ...

What type of chemical reaction is this equation? CuO (s) + [2H+ + SO4 2-](aq) [Cu2+ + SO4 2-] (aq) + H2O (l)

A 152 g sample of ice at –37 degree C is heated until it turns into liquid water at 0 degree C. How do you find the change in heat content in the system? I've found H(I) [Change in heat of the ice] to be 11416.72 but im still stuck on the change of heat for the water.

Use the table of complex ion formation constants to calculate the molar concentration of free Fe^2+ in 0.510M aqueous solution of potassium hexacyanoferrate(II) K4(Fe(CN)6) at 25 degrees celsius. I know the answer is 1.96*10^-6 m, but I'm at a loss on how to get there. I've ...

the half time of a radioisotope is found to be 4.55 minutes. if the decay follow first order kinetics. what percentage of isotope will remain after 2.00 hours?

Give the IUPAC name of thish hydrocarbon ch3ch2c(ch3)2ch2ch2ch2ch3

Neutralization of water containing H2SO4 and HNO3 with CaSO3. What is the pH in water if the volume is 1000 liter and the concentration of H2SO4 is 0,0013 M and concentration of H2SO4 is 0,0010 M ? And how much of CaCO3 is needed for neutralization of the water?

What ratio of molar concentrations of sodium acetate to acetic acid can buffer a solution at a pH of 4.89?

Rank from longest to shortest bond length: Si-O, Si-H, Si-S

how many sigma and pi bonds in hooc-cooh

How many grams of iron(II) oxalate dihydrate, Fe(C2O4)·2H2O,mass can be produced when a student begins the synthesis with 3.238 g of ammonium iron(II) disulfate hexahydrate, (NH4)2Fe(SO4)2·6H2O?

Which of the following liquids should be most soluble in water? A) CH3OH b) CH3CH2CH2CH2OH C) CH3CH2CH2CH2CH2CH3 D) CH3OCH3

An aqueous solution of ethyl alcohol is made by transfering 1.32 mL of liquid ethyl alcohol to a 50.0 mL volumetric flask, and then adding enough water to fill the flask to the mark. What is the volume/volume percentage of ethyl alcohol in the solution?

Based on the ratio of mean moles of O2/mol KClO3 what is the chemical equation for the reaction that occurred? Why? Is this conclusion in accord with the mass of the solid product that you obtained? Explain Moles of O2/mol KClO3 = 1.95x10^-2

Calculate the pH of a 1 L buffer solution that contains 0.050 moles of acetic acid and 0.040 moles of sodium acetate to which 0.020 moles of NaOH has been added.

Ka for a weak acid HA = 3.46x10^-8, calculate K for the reaction of HA with OH- HA + OH- = A- + H2O This is an equilibrium question, but I do not understand how to find the equilibrium constant K, from the equilibrium constant of an acid, Ka

How much heat does your body lose when 3.05 g of sweat evaporates from your skin at 25 ∘C? (Assume that the sweat is only water.) The heat of vaporization of water at 25 ∘C is 44.0 kJ/mole. Answer: 3.05g H2O*1mol/18.015gH2O= 0.169mol H2O 0.169mol*44.0kJ/1mol= 7.45kJ

indicate whether the following would increase decrease or have no effect on the solubility of copper (ii) carbonate (ksp - 2.5 x 10^-10) when compared to the solubility of water 1. dissolve it in an acidic solution 2. dissolve it in ammonia, forming a complex 3. dissolve it in...

If you had a 100 mL of 2.00 M HCl and you added 100 mL to it what is the final volume and final concentration? The volume would be 200ml, but would the concentration just stay the same?

Given H2(g) + (1/2)O2(g) ---> H2O(l), dH = -286 kJ/mol, determine the standard enthalpy change for the reaction 2h2O(l) ---> 2H2(g) + O2(g) 2H2O(l) ---> 2H2(g) + O2(g) H2(g) + (1/2) O29g) ---> H2O (l) : dH = -286 kJ/mols 2H2O(l) ---> 2H2(g) + 2O2(g) : would dH ...

Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to and defined by the quantity dHformation [NH3(g)] N2(g) + 3H2(g) --> 2NH3(g) Is that all the question is asking for?

When .560 g of Na(s) reacts with excess F2(g) to form NaF(s), 13.8 kJ of heat is evolved at standard-state conditions. What is the standard enthalpy of formation of NaF(s)? Start off by balancing the equation: 2Na(s) + F2(s) ---> 2NaF(s) Then make it for one mole Na(s) + (1...

The enthalpy of formation for a substance corresponds to the enthalpy change for a reaction. Write the specific chemical reaction defining the enthalpy of formation of butane: Just checking to make sure this is correct: 4C + 5H2 ---> C4H10

The following ions contain three oxygen atoms: A) carbonate, sulfite, and nitrite B) sulfite, nitrate, and bromate C) sulfate, hypochlorite, and carbonate D) chlorate, iodate, and phosphite I know I can eliminate A and C.

Calculate the amount of heat necessary to raise the temperature of 12.0 g of water from 15.4ºC to 93ºC. The specific heat of water = 4.18 J/gºC. q = ms∆T q = (12.0g) (4.18) (93.0 - 15.4) q = 3892.416 J ??

Potassium is a reactive element. Bromine is a reactive element. Write the complete balanced chemical equation using appropriate chemical symbols for the reaction when potassium reacts with bromine to make a solid product showing correct symbols and states of reactants and ...

Consider 1.00 L of the buffer system that contains 0.200 M hydrocyanic acid(HCN) and 0.150 M sodium cyanide (NaCN). The pKa of hydrocyanic acid is 9.31. What is the [HCN] after 0.020 mol of HCl is added?

Write a comlete, balanced chemical equation for the reaction that occurs between aqueous iron(II) sulfate,FeSO4, and aqueous potassium hydroxide

A weather balloon is filled with helium that occupies a volume of 4.39 x 10^4 L at 0.995 atm and 32.0°C. After it is released, it rises to a location where the pressure is 0.720 atm and the temperature is -14.1°C. What is the volume of the balloon at that new location?

The enthalpy of combustion of benzoic acid (C6H5CO2H) is –3228 kJ/mol. The burning of 1.698 g of benzoic acid in a calorimeter causes the temperature to increase by 2.865 ºC. What is the heat capacity (in kJ/ºC) of the calorimeter?

A gas at 61°C occupies a volume of 0.67 L. At what Celsius temperature will the volume increase to 1.12 L? whats the answer didn't understand

Given H2(g) + (1/2)O2(g) --> H2O, ∆Hº = -286 kJ/mol, determine the standard enthalpy change for the reaction 2H2O(l) --> 2H2(g) + O2(g). Just checking... should end up with ∆Hº = 572 kJ/mol right??

Given ∆Hºrxn = -1670 kJ/mol for 2Al(s) + (3/2)O2(g) --> Al2O3(s), determine ∆Hº for the reaction 2Al2O3(s) --> 4Al(s) + 3O2(g). I flipped Al(s) + (3/2)O2(g) --> Al2O3(s) to Al2O3(s) --> A(g) + (3/2)O2(s) and multiplied the molar values by 2. I ended up with...

Air trapped in a cylinder fitted with a piston occupies 163.1 mL at 1.08 atm pressure. What is the new volume when the piston is depressed, increasing the pressure by 25%?

The pressure of a sample of helium in a 3.40 L container is 0.988 atm. What is the new pressure if the sample is placed in a 2.15 L container?

A fixed amount of oxygen gas is held in a .500 L tank at a pressure of 4.09 atm. The tank is connected to an empty 1.50 L tank by a tube with a valve. After this valve has been opened and the oxygen is allowed to flow freely between the two tanks at a constant temperature, ...

If the thermometer reads 22 c and this corresponds to 19.8mmhg of water pressure , what is the pressure of a pure gas collected over water if the total pressure is 760 mmhg?next calculate the pressure of the gas and lets assume its hydrogen gas in atm. pressure of pure gas=760...

Which of the following processes is endothermic? a) H2O (g) --> H2O (l) b) 3O2 (g) + 2CH3OH(g) --> 2CO2(g) + 2H2O(g) c) H2O (s) --> H2O (l) d) O2(g) + 2H2(g) --> 2H2O(g) I a guessing b, since energy has to go into the reaction for water to go from a solid to a ...

Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to ΔHf° [NH3(g)]

The enthalpy of combustion of benzoic acid (C6H5CO2H) is -3228 kJ/mol. The burning of 1.698 g of benzoic acid in a calorimeter causes the temperature to increase by 2.865°C. What is the heat capacity (in kJ/°C) of the calorimeter?

A gas sample occupies a container of 25.0 mL with a pressure of 125.1 kPa at room temperature (25.0 °C). The number of moles of this gas in the container is

Calculate the thiocyanate concentration at equilibrium if the irone (III) ion concentration is 0.23 M and the complex ion concentration is 0.625 M t equilibrium. Keq= 138M^-1

Calculate the thiocyanate concentration at equilibrium if the irone (III) ion concentration is 0.23 M and the complex ion concentration is 0.625 M t equilibrium. Keq= 138M^-1

Calculate the thiocyanate concentration at equilibrium if the irone (III) ion concentration is 0.23 M and the complex ion concentration is 0.625 M t equilibrium. Keq= 138M^-1

Could somebody tell me dose my answer for this question right or wrong for this question.My answer is reverse 2SO2(g) + O2(g) ↔ 2SO3(g) which has Kp = 3.45 x 106 at 600K. In an experiment, SO3 at pressure 125 atm is mixed with SO2 at pressure 0.13 atm and O2 at pressure 0....

A sample of sand initially at 22.3°C absorbs 1.34 x 10^3 J of heat. The final temperature of sand is 67.8 °C. What is the (in g) of sand in the sample? Round to the nearest whole number.

The following information is given for ether, C2H5OC2H5, at 1atm: boiling point = 34.6 °C Hvap(34.6 °C) = 26.5 kJ/mol specific heat liquid = 2.32 J/g°C At a pressure of 1 atm,__kJ of heat are needed to vaporize a 25.1 g sample of liquid ether at its ...

A fixed amount of oxygen gas is held in a .500 L tank at a pressure of 4.68 atm. The tank is connected to an empty 1.50 L tank by a tube with a valve. After this valve has been opened and the oxygen is allowed to flow freely between the two tanks at a constant temperature, ...

When .1625 g of Magnesium is burned in a bomb container that has a heat capacity of 3.03 kJ/ºC, the temperature increases by 1.252 ºC. How much heat (kJ/mol) is liberated during the burning of magnesium? Just want to make sure I am doing this correctly: q = ms∆T q = (....

Calculate the enthalpy of formation if 78.5 g of carbon dioxide in the following reaction: C(s) + H2O(g) --> CO2(g) Use the following equations: a) H2O(l) --> H2(g) + (1/2)O2(g): Δ°f = +285.8 kJ/mol b) C2H6(g) --> 2C(s) + 3H2(g): Δ°f = +84.7 kJ/mol c) 2CO2(g) + ...

In which of the following reactions is work done by the system to the surroundings? A) 2CH3OH(l) + 3O2(g) --> 4H2O(l) + 2CO2(g) B) S(s, rhombic) + O2(g) --> SO2(g) C) 2AgNO3(s) --> 2AgNO2(s) + O2(g) D)4Fe(s) + 3O2(g) --> 2Fe2O3(s) My guess is B because according to...

8) ( 1 point) What is the maximum number of grams PH₃ that can be formed when 3.4 g of phosphorus reacts with 4 grams of hydrogen to form PH₃? P₄ (g) +6H₂ (g) → 4PH₃ (g) * 3.7 g 6.8 g 45 g 270 g 10. Lead nitrate can be decomposed by heating. What is the percent ...


A solution is prepared by pipetting 5.00 mL of 0.0983 molar HCl into a 100.0 mL graduated cylinder, and adding enough water to prepare 50.0 mL of solution. 1.The concentration of this solution is ____________M 2.The pH of this solution is ____________ Because HCl is a strong ...

A hot lump of 33.2 g of copper at an initial temperature of 70.5 °C is placed in 50.0 mL of H2O initially at 25.0 °C and allowed to reach thermal equilibrium. What is the final temperature of the copper and water given that the specific heat of copper is 0.385 J/(g·°C)? ...

A 32.3 g iron rod, initially at 22.4 ∘C, is submerged into an unknown mass of water at 62.9 ∘C, in an insulated container. The final temperature of the mixture upon reaching thermal equilibrium is 59.4 ∘C.

Chemistry help!!
Calculate the concentration of a solution prepared by adding 15.00 mL of 2.10 X 10^-3 M KMnO4 from a buret into a 50.00 mL volumetric flask, which is then filled to the 50.00 mL graduation mark with distilled water.

Chemistry (Ochem)
I know that there is such thing as inversion of stereochemistry,but is there such thing as inversion of stereocenter? Are stereocenter and stereochemistry the same thing or mean the same thing? Thank you, Vivian

Which elements have the greatest tendency to behave as oxidizing agents? A) metals B) nonmetals I think the answer is B.

Write an equation for the half-reaction in which a potassium atom, K, is oxidized. A) K + e- ----> K+ B) K ----> K+ + e- C) K- ----> K+ + 2 e- I think A

Calculate the enthalpy of formation of carbon dioxide in the following reaction: C(s) + O2(g) -> CO2(g) Use the following equations: a) H2O(l) --> H2(g) + 1/2 O2(g): ΔH° = +285.8 kJ/mol b) C2H6(g) --> 2C(s) + 3H2(g): ΔH° = +84.7 kJ/mol c) 2CO2(g) + 3O2(g) --> ...

calculate the heat of formation of methane given the heat of combustion of C,H2 and CH4 as-393,-285 and -887kj per mol respectively.

PbO2 + 2H2 = Pb + 2H2O If 478g of lead doixide is heated, what is: a. the number of moles of lead dioxide used? b. the number of moles of lead produced? c. the mass of lead produced? I am stuck.... please help!!

3. Suppose a bookcase shelf has 5 Mathematics texts, 3 Biology texts, 6 Chemistry texts and 4 Physics texts. Find the number n of ways a student can choose: a. one of the texts; b. one of each type of text.

A store receives a shipment of defective balloons. Each has a tiny pinhole of the same size. If one balloon is filled with helium and another is filled with air to the same volume and pressure, which balloon will deflate faster and how much faster? The density of helium at ...

The molar mass of a compound is 92 g/mol. What is the molecular formula for a sample containing 0.606g Nitrogen and 1.390g Oxygen?

What is the limiting reactant is if 0.5gAl is reacted with 3.5gCuCl2? 2Al(s)+3CuCl2(aq) --> 3Cu(s)+2AlCl3(aq)

what is the cell potential of the following cell: a platinum wire placed into a mixture of: KIO4 (0.02M), KIO3 (0.040M), H3PO4 (0.10M), KH2PO4 (0.40M) assuming it is put against a Ag/AgCl reference electrode?

Calculate the molar mass of a gas if 4.40g occupies at 3.50 L at 560mmHg and 41 degrees celsisus

Refer to the table given for the ionic radii in your lab manual and approximate the attractive portion of the lattice energy for 1 mole of the following salts. (Consider only one bond if more than one bond exists.) a) Ca3P2 ___J b) MoCl4 ___J c) Cs2O ___J

what is the Mr of CO2? Use this to calculate the mass of co2 produced when 1kg of CaCO3 is heated.... (what are the answers?) MT!!!

Use the ion-electron method to write and balance the net ionic equation for each of the following reactions. MnO41- + Sn(OH)31- MnO2 + Sn(OH)62- in basic solution MnO41- + (COOH)2(aq) Mn2+ + CO2(g) in acidic solution I2(aq) + S2O32- I1- + S4O62- Zn(s) + HgO(s) ZnO(s) + Hg(l) ...

60.0 g of iron that has an initial temperature of 250 degrees C and 60.0 g of gold that has an initial temperature of 45.0 degrees C are brought into contact with one another. Assuming no heat is lost to the surroundings, what will be the temperature when two metals reach ...

Determine the final temperature of water if 17.6 kJ of heat is added to 350 g of water initially at a temperature of 24.10 C. (specific heat of water is 4.184 Jg^-1K^-1)

Calculate how many cm3 of 1M HCl is necessary to dissolve 1g of magnesium ribbon

If you need to prepare 250.0 mL of a pH 5.00 buffer tha t has a total buffer concentration of acetic acid + sodium acetate of 0.050 M, how many moles of each will you need to prepare the solution? Given solutions of acetic acid and sodium acetate with concentrations of 0.10 M ...

carbon disulfide is prepared by heating sulfur and charcoal. the chemical equation is S2(g)+C(S)=CS2(g) and Kc = 9.4 at 900K. How many grams of CS2(g) can be prepared by heating 8.9moles of S2(g) with excess carbon in a 5.00L reaction vessel held at 900K until equilibrium is ...

I am having trouble getting the right answer for this question please help. Calculate Kc for the FeSCN2+ formation equilibrium [FeSCN2+] = 3.49x10^-5 M [Fe3+] = 4.39x10^-4 M [SCN-] = 1.93x10^-4 Kc = [FeSCN2+] / ([Fe3+]-[FeSCN2+]) * ([SCN-] - [FeSCN2+]) I keep getting 546.266 M...

Suppose a balloon is filled so that its volume is 2.00 L when the pressure is 1.10 atm and the temperature is 300k. What volume will it occupy if it rises to an elevation where the pressure is 418mm Hg and the temperature is 200k?

  1. Pages:
  2. <<Prev
  3. 1
  4. 2
  5. 3
  6. 4
  7. 5
  8. 6
  9. 7
  10. 8
  11. 9
  12. 10
  13. 11
  14. 12
  15. 13
  16. 14
  17. 15
  18. Next>>

Homework Help: Science

Post a New Question