organic chemistry!

Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural formulas for the following as well..I don't think most of them are right...

1) CH3CH2CH2CH(CH3)CH3 (2-propylpentane)

2) CH3CH(C2H5)CH2CH3 (3-ethylbutane)

3)CH3CH2CHClCH2CH2CH2CH2Cl
(dichlorooctane)

4)CH3CH2CH2CH2OH (propylbutanol)

5) CH3CH2CH2CH2COOH
(propylpentanoic acid)

6) CH2=C(CH3)CH2CH(CH3)CH3
(2,4-dipropylpentene)

7) (CH3)2CHCl (chloropropane)

8) CH3C(CH3)2CH2C(CH3)2CH2CH2CH3
(4,6-tetramethylheptane)

9) CH3C(CH3)2CH=C(CH3)CH2CH3
(2,4-tripropylhexane)

10) CH3C(triple bond)CCH3 (methylbutyne)

Please let me know if I am doing this right..thanks..



1. 2-methylpentane
3. 1,4-dichloroheptane
6. 2,4-dimethylpentene
7. (not sure about this one) t-chlorobutyl
9. 2,4-trimethylhexene

-CH3 substituent is methyl not propyl.

number 9: it is an alkene, so it should have a "ene" on the end, not "ane"

Yes if it is an alkene it should have an "ene" at the end not an "ane".

  1. 👍
  2. 👎
  3. 👁
  1. here's what i got..

    1. 2-methylpentane
    2. 2-ethylbutane
    3. 1,5-dichloroheptane
    4. butanol
    5. pentanoic acid
    6. 2,4-dimethylpentene
    7. 2,2-chloropropane
    8. 2,2,4,4-tetramethylheptane
    9. 2,2,4-trimethyl-3-hexene
    10. 2-butyne

    hope this helps!! even though, i'm sure you're done with this worksheet by now.
    <3

    1. 👍
    2. 👎
  2. thanks a ton! You saved me.

    1. 👍
    2. 👎
  3. I LOVE U

    1. 👍
    2. 👎
  4. 1. 2-methylpentane
    2. 3-methylpentane
    3. 1,5-dichloroheptane
    4. 1-butanol
    5. Pentanoic Acid
    6. 2,4-dimethyl-1-pentene
    7. 2-chloropropane
    8. 2,2,4,4-tetramethylheptane
    9. 2,2,4-trimethyl-3-hexene
    10. 2-butyne

    1. 👍
    2. 👎
  5. i HAVE A QUESTION/
    WHAT IS THIS
    i-PrCl ????

    1. 👍
    2. 👎
  6. why is number8 2,2,4,4

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. Social Studies

    How did Americans disagree over the role of federal and state governments before and during the Civil War? The North wanted the federal government to govern the entire country. The South wanted the states to have much more power.

  2. social studies

    (55) All fines that have been given to us unjustly and against the law of the land . . . shall be entirely remitted [given back] or the matter decided by a majority judgment of the twenty-five barons . . . together with [the]

  3. Social Studies

    can someone plzz help me Why did nationalist movements gain strength in Asia and Africa after World War II? A. Asian and African nations wanted a return to colonial-style governments. B. People in the colonies wanted to choose

  4. American History

    What caused many people in the urban middle class to oppose Díaz’s dictatorship and support a political revolution? A. They wanted more land and better lives. B. They wanted a democratic government. C. They wanted better wages

  1. social studies

    PLEASE HELP!!!!! (55) All fines that have been given to us unjustly and against the law of the land . . . shall be entirely remitted [given back] or the matter decided by a majority judgment of the twenty-five barons . . .

  2. social studies

    what did president lyndon johnson hope to accomplish through the war of poverty A he wanted all poor people to vote B he wanted all poor people to afford food C he wanted all poor people to stay poor D he wanted all poor people to

  3. us history

    Which sentence best explains why delegates met at the First Continental Congress? They were worried after the Boston Tea Party and wanted to avoid going to war over taxes and protests. They were tired of being taxed on tea and

  4. Social Studies

    Match each section with its primary interests. 1. wanted high tariffs: 2. wanted low tariffs: 3. was against slavery: 4. was for slavery: 5. wanted government-built roads: 6. wanted western expansion of slavery: 7. wanted cheap

  1. social studies

    Why did European nations colonize Africa? A. They wanted to adopt African cultures. B. They wanted to convert to African religions. C. They wanted the natural resources in Africa. D. They were afraid African nations would invade

  2. History

    What can be inferred by the passage of black codes? Many Southerners were willing to allow African american equality Many white southerors wanted them to remain as servents Many white southernors wanted african americans to recive

  3. History check my work please

    President Reagan sought world peace through A) detente B) economic policies C) military strength (my choice) D) industrialized trade 2. Why did saddam hussein's troops invade kuwait? A) he wanted to end kuwait illegal drug trade

  4. Social Studies

    What was one reason Louis XIV spent lavishly on the arts? A. He wanted to show his power. B. He wanted to spread French culture to other lands. C. He wanted to control the content of French artwork. D. He wanted French artwork to

You can view more similar questions or ask a new question.