Naming Organic Compounds

Welcome to the "Naming Organic Compounds" category of Questions LLC! This is the perfect place for anyone seeking help or guidance on the intricate process of naming organic compounds. Organic chemistry plays a vital role in understanding the chemical components and structures that make up our world, and correctly naming these compounds is crucial for effective communication and scientific research. Whether you're a student struggling with complex nomenclature rules or a curious individual looking to expand your knowledge, our community of experts is here to assist you. Browse through the questions and answers within this category to discover solutions, explanations, and insights into the fascinating world of naming organic compounds.

Questions (21)

Name the compound(CH3)2CHCCCH3 1. 2-methyl-3-pentyne 2. 3-methyl-1-pentyne 3. 5-methyl-2-pentyne 4. 4-methyl-2-pentyne 5.
1. 1 answer
2. asked by Kondwani moyo
3. 116 views
Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier
1. 7 answers
2. asked by michelle
3. 3,188 views
The molecule 2-methyl-5-ethylbenzene is named incorrectly. correct this name.my answer is 1,3-dimethyl-5-ethylbenzene is my
1. 5 answers
2. asked by anonymous
3. 1,011 views
In an organic compound, two methyl groups are found at the third and sixth positions and two double bonds exist at the first and
1. 7 answers
2. asked anonymously
3. 37 views
I am confused between two different namings1) 4,6-dichloro-3-propylnonane-2,5-dione 2) 4,6-dichloro-3-propyl-2,5-nonanedione I
1. 1 answer
2. asked by Noel----------------------------------
3. 220 views
what is wrong with these names?provide the correct name for each.i.2-Dimethylpentane {4] ii.2-Ethylpentane {4}
1. 5 answers
2. asked by sophie
3. 686 views
To me they seem all 3 correct! Can someone explain this to me? Thanks. Which of the following is a correct IUPAC name?a.
1. 3 answers
2. asked by
3. 456 views
Is 4 ethyl-2,4 octadiene a correct name? How can i identify if it's incorrect or correct?
1. 1 answer
2. asked by Lesley
3. 376 views
Can you tell me what the systematic name for a compound which has a carbon attached to a phenyl, a double bonded oxygen, and a
1. 1 answer
2. asked by Max
3. 348 views
I was wondering what the name to a compound is.A phenyl attached to a carbon that is attached to both a double bonded oxygen and
1. 3 answers
2. asked by Max
3. 364 views
What is the IUPAC name FOR CH3COOC2H5
1. 3 answers
2. asked by Sha
3. 1,401 views
Select the correct name for the following compound.Image: img39.imageshack.us/img39/2299/44906767.jpg a.
1. 3 answers
2. asked by Toronto
3. 1,088 views
Please i tried to give this answer on a quiz but it was not accepted.To name this alkane: CH3CH2CH2CHCH3 with a substituent of
1. 2 answers
2. asked by Rashidat
3. 862 views
I am really stuck on these so will try and explain further and use dots.1. I have come up with normal heptane on this but not
1. 1 answer
2. asked by mary
3. 737 views
................CH3..................| CH3-CH2-N-CH2-CH2-CH3 Hoping this turns out okay, but it's an amine and branching off of
1. 5 answers
2. asked by a Canadian
3. 729 views
CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound
1. 1 answer
2. asked by Anonymous
3. 716 views
CH3-COOH-CH-COO-3-hydroxybutyrate or β-hydroxybutyrate I have no idea why this is named what it is named. I know that the COO
1. 3 answers
2. asked by Lena
3. 706 views
When you're naming organic compounds, is there more than one name that's acceptable for each compound? For exampleCh3-CH2-CH2
1. 2 answers
2. asked by Rori
3. 592 views
What's the name of the following compound? H3C-H2C-H2C-SO3H
1. 2 answers
2. asked by william
3. 578 views
1. name this compound..........CH2CH3 ........../ hydrocarbon hectagon shaped ring ..........| ..........CH3 CH2CH3 are to the
1. 2 answers
2. asked by mary
3. 563 views
Name this compound according to the IUPAC systemCH3 | CH=C-CH-CH-CH3 | CH3 Thank you.
1. 2 answers
2. asked by mary
3. 567 views