Science

Recent Questions

Chemistry
home / study / science / chemistry / questions and answers / a subtilisin with an active site mutation of his ... Question: A subtilisin with an active site mutation of His t... EDIT QUESTION A subtilisin with an active site mutation of His to Ala had a substantially decreased...

Science
Estimate the velocity of the groundwater flowing from a point 500 feet from a creek. The point is 50 feet above the surface of the creek and the permeability of the subsurface is approximately 10.5. Approximately how long would it take the groundwater to reach the creek?

science
the drawing of three particle far away from any other particle located in a straight line .masses of these particles are Ma=363kg,Mb=517kg,Mc=154kg.find the magnitude and the direction of net gravitational force acting on them

Science
How resistivty of conductor vary if area is halved,length is double,area is double

Science
how does the initial procedure compare to your updated procedure? What changes did you have to make? Why? How can I answer this question? Please help me... ;(

science
the density of water approximately 1.00 g/mL. Would the piece of wood in the previous question (#1) float or sink

Science
If a ball is thrown upward on Mars with an initial velocity of 10.0 m/s and lands 1.50 m below its launch point 5.54 seconds after it is thrown , what is the local acceleration due to gravity one Mars .... Plzzzzzzzzz answer it's really important I have to submit it tomorrow...

Physical science
To pass a slow vehicle within the length of the passing lane roger got up well over the speed limit . He then spotted a police cruiser coming around the corner and hit the brakes . If he braked at 6 m/s^2 , and it took him 1.50 seconds to get back to 40 m/s , what speed had he...

science ap chemistry
What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

Science
How many moles of cacl2 would be used in making 0.5L of a 2M solution?

Science
The Strange Case of Beriberi In 1887 a strange nerve disease attacked the people in the Dutch East Indies. The disease was beriberi. Symptoms of the disease included weakness and loss of appetite, victims often died of heart failure. Scientists thought the disease might be ...

science
how Avogadros hypothesis applied to show molecular mass of volatile substances is twice of Vapour density?

Science
A convex mirror forms an image of half the size of the object. When it is moved 15cm away from the object the size of the image becomes 2/5times that of the object. Find the focal length of mirror

Science
water is flowing through a horizontal pipe of varying cross section at any two places the diameters of the tube are 4cm and 2cm if the pressure difference between these two places be equal to 4.5cm then determine the rate of flow of water in the tube

Science
Draw a circuit diagram of a containing two cells in series, a closed switch, three identical light bulbs in parallel.

Science
Draw a circuit diagram of a circuit containing two cells in series, a closed switch,three identical light bulbs in parallel

Science
1. A study was done to find if different tire treads affect the braking distance of an Army Jeep. The same road surface was used each time. Independent variable: Tire Treads Dependent Variable: Braking Distance 2. An experiment was performed to determine how the amount of ...

Science
How much mL of dilute nitric acid is needed to add in control solution in chloride limit test in sodium hydroxide sample???can u please give me Answer urgently??

Science
How much mL of dilute nitric acid is needed to add in control solution in chloride limit test in sodium hydroxide sample according to japanese pharmacopia??can u please give me Answer

science
What is , a quarter after four in digital form.

Science
One:the sI unit measure for length the meter-would be most appropriate when Two:The metric System Of measurement is based on the number Three: Scientists use SI because it allows them to compare data and communicate with each other about their results (true/False ~Mia

Science
A body is moving with uniform accelaration goes 65 meter 5th second and 105 meter in 9th second. How far will it go in 20th seco d

NAVL Science (help)
The USS Ronald Regan's (CVN 76) barometer reads 30.14 in-hg. A vacuum gage at the port main condenser reads 18.25 in-Hg. What is the pressure relationship for this gage? What is the absolute pressure, in Psia, for the port main condensor?

science
lighting is actually an enormous display of the concept of?

Science
in science, skepticism means coming up with inventive way to solve a problems or produce new things

science
1. a stream of water will bend toward a balloon that has been rubbed on a sweater to generate static charge. Which property of water is responsible for this behavior? A. THE polarity of the water molecule b. the ability of water to form hydrogen bonds with itself c. the heat ...

Science
When a person wearing a perfume enters a room it takes a minute to spread in the room..what causes that??

Science
A mixture of iron nail , salt ,oil and water is provided to you give step wise method to separate each component from this mixture

Science
Plz HELP me !!!!! I need to know a acrostic poem about safety plz help me it is due tomorrow

Science
A species with two colour variation one mostly green and one is brown.How might populations of species change if the environment becomes a patchwork of tiny green and brown splotches? tnx.

physical science
A pure gold bar is made up of 19.55mol of gold. What is the mass of the bar in grams?

Engineering science
A motorcycle accelerates from rest 5m/s until it reaches 72km/h.calculate the distance travelled by the motorcycle?

Science
I'm struggling to figure out velocity and understanding the formulas. My question I have to try and figure out is... If a block of wood dropped from a tall building has reached a velocity of 78.4 m/s, how long has it been falling? I just don't know how to figure it out? Can ...

Science
Describe at least one societal issue that scientists will be able to address using the sequence of the human genome.

Science
Sound travles at a speed of 340 m/s how long does it take to travel 850 m

science
summarize the process of sexual reproduction and explain how variations of inherited traits can increase or decrease an organism's chance of survival

Science
A current is of 1mA is flowing through a copper wire, how many eloctons will pass a given point in 1 second?

science
a carnot engine is designed to operate between 480K and 300K.if the engine actually produces 1.4j of mechanical energy per calorie of heat absorbed,then the ratio of actual efficiency to theoretical efficiency is

Science
Calculate The Volume Occupied By 10(superscript)22 Molecule Of Gas At 300 kalvin And 760mm Pressure

science
which of the following is an example of a model? a. The solar system b. a globe c. a planet d. a padlock Thanks!

Math science humanity kiswahili English art pshe
Kylie cit an Apple into 12 equal parts . if she aye 1/4 of the apple, how many parts would remain

Science
May somebody help and explain please with 2 question explain why science is a continuous progression of study and y is the use of the inquiry process a practical way to approach science

Scence
May somebody help and explain please with 2 question explain why science is a continuous progression of study and y is the use of the inquiry process a practical way to approach science

fire engineering science 300
Calculate the volume of one mole of gas at STP(Standard Temperature & Pressure). Given: P=101 325 Pa n=1mol R=8,31 J K-1 mol-1 T=273K Given: P1=785mm Hg P2=760mm Hg T1=293 K T2=273 K V1=60cm3

fire engineering science 300
A mass of a gas has a volume of 60cm3 at a temperature of 20°C and a pressure of 785mm mercury. Calculate the volume of a gas at STP(Standard Temperature & Pressure). Given: P1=785mm Hg.

Science
How Can Nitrogen Be Obtained From Ammonia Gas?

Science
Whatis the meaning of bulb rated 10w~220v?

Science
What is the meaning of bulb rated 10w~220v?

science
A thin non-conducting rod is bent to form the arc of a circle of radius a and subtends an angle at the center of the circle. A total charge q is spread uniformly along its length. Find the electric field at the center of the circle in term of, a, q, and angle.

physics
How do the laws of physics apply to others sciences such as biology chemistry and earth science? And give an example to show the connection.

Science
How do the colour of survivor animals relate to their habitat background? possible explanation tnx a lot

SCIENCE
1. Receives proteins and materials from the ER, packages them, and distributes them. 2. Has passageways that carry proteins and other materials from one part of the cell to another. Need help making these 2 sentences in a flattering discription

Science
Radius of the earth is 6400km and g is 9.8 m÷s find the value of g produced on a mass of 20 kg at a distance of 10000km from the earths surface ?

Science
An alumium rod when measured with a steel scale both being at 25 degree celcius appears to be 1 meter long. If the scale is correct at 0 degree celcius, what is the true length of the rod at 25 degree celcius? What wull be the length of rod at 0 degree celcius?

Science
What is the name for organisms that consume other organisms for energy

science
why is it advised not to store pickles in coppes or brass vessels?

science
write the equation for the manufacture of bleeching powder

Physical Science
You drop a water balloon off of a tree branch, and you time the drop time at Δt = 0.8 sec, from the instant you drop it to the instant it impacts the sidewalk. What is the height of the tree branch?

Science PLEASE HELP
what functions do individual cells perform that are similar to the functions of our bodies?

science
what functions do individual cells perform that are similar to the functions of our bodies?

Science
Calculate the energy release in 1 gram of Uranium 235

Science
An arrow is shot vertically upwards with an initial velocity of 14 m/s . Calculate the height reached

Science
500g of water at 100°c is mixed with 300g of water at 20°c.specific heat capacity of water is 4.2Jg°c.find the final temperature of mixture. (Physics)

Science Earth
Guard cells are closed during the night. This means that no gases can come in or out of the stomata. Why would the plant not need to take in gas during the night? How can I answer in this question?

English
How would you handle the following situations? In your answers, refer to specific skills that you might use, and include words that you might say. Remember that a chairperson is a polite and tactful communicator. a. Your social studies group is supposed to be discussing the ...

Computer science
What is the count for the instruction CountMe as a function of n for the fragment below? Line 1: j = 1 Line 2: while (j<= n/2) { Line 3: i = 1 Line 4: while (i<=j) { Line 5: CountMe Line 6: i++ Line 7: } Line 8: j++ Line 9: }

Computer science
What is the count for the instruction CountMe as a function of n for the fragment below? (Assume that 2k-1 ≤ n < 2k). Line 1: j = 1 Line 2: while (j<= n) { Line 3: CountMe Line 4: j = 2*j;

Computer science
What is the count for the instruction CountMe as a function of n for the fragment below? (Assume that n can be either even (2k) or odd (2k+1)) Line 1: j = 0 Line 2: while (j < n) { Line 3: CountMe Line 4: j = j+2; }

Computer science
What is the smallest value of n such that an algorithm whose running time is (2^15)n runs faster than an algorithm whose running time is 2^n on the same machine?

computer science
write a fortran program to read in the scores of 120 students using an array

science
For the reaction 2N2O(g) ⇌ O2(g) + 2N2(g), what happens to the equilibrium position if the volume decreases? A. does nothing B. shifts to the left C. doubles D. shifts to the right

Science
A 1.37molal of H2SO4 has a density of 1.22g/mL.Determine the Concentration in Normality

computer science
write a fortran program to read in the scores of 120 students in a class using an array

science
Prove that the maximum horizontal range is 4times the max height attaind by projectile when fired at an inclined so as to have max. Horizontal range

Science
MMR causes autism Help with the connection between MMR vaccine to autism pros and cons

science
Carbon+argon= + =

science ( physics )
Two cars A and B are seprated by a distance of 0.5 km and moving in the same direction with same speed. A car C moving with 10 km/h in opposite direction meets these cars at an interval of 1 minute. The speed of A and B is

Science
A snooker ball X of mass 0.3kg moving at 5m/s hit a stationary ball Y of mass 0.4kg and Y move at a velocity of 2m/s at angle to the initial direction of X. Find the velocity and direction of X after hitting

Science help immediately
You are exercising on a hot day. Your body temperature goes up. You begin to sweat. The sweat cools your body. Sweating is an example of: A. Input. B. Process. C. Output. This D. Feedback. or this?

integrated science
A planet is 2.45 x 10^9 km away. How long would it take in hours to travel to the planet at the speed of light? (speed of light is 2.998 x 10^8 m/s)

science help pls pls
The table below shows the average distances of Jupiter and Earth from the sun. Name of Planet Average distance from the sun (in AU) Jupiter 5.2 Earth 1.0 What is the difference between the orbital periods of Jupiter and Earth? 4.20 years 6.20 years 8.86 years 10.86 years 12.40...

biology
which of the following is consistent with the theory of vitalism ? A.all matter contains a vital force** b.the chemistry of life and nonlife are similar c. living things contain a vital force absent in nonliving things d. life must be sustsained through a series of chemical ...

science
A(n) ____________ is a legal document issued by a government that gives an inventor exclusive rights to make, use, or sell an invention for a limited time.

biochemistry
which of the following is consistent with the theory of vitalism ? A.all matter contains a vital force** b.the chemistry of life and nonlife are similar c. living things contain a vital force absent in nonliving things d. life must be sustsained through a series of chemical ...

science
25. Perform the following conversions. (Do your work on scratch paper and then type answer.) A. 105 m = cm B. 2000 mL = L C. 3400 g = kg D. 0.985 km = m E. 2345 mm = m F. 34 kg = g

science
A/MX-----AX/M and AX is green coloured solution.then A and MX RESPECTIVELY ARE

Science
Which of the following questions is outside the scope of science? a. how are religion and philosophy different b.what is the diet of an american alligator c. how do humans digest protein d. how does gravity affect an airplane's motion

science
how were you able to determine the branches of science that are connected to tha issues that the filipinos are facing right now?

Science
Q1: Why do scientist use models? A.) Scientist use models to learn about things that are too small, too late, or too complex to observe directly. B.) Scientist use models because doing so is always part of the scientific method. C.) Scientist use models because they always ...

8th Grade Science
Why do scientist use standered units of measurements? A.) Because their tools only measure in units B.) Because their units are either too small or too large to work with C.) So they can communicate findings without confusion D.) So that people who are not scientists can ...

science
what functions do individual cells perform that are similar to the functions of our bodies?

Science
what are some barriers to solve the zika virus problem? What are some possible solutions for zika virus problem? According to the off the podium article about zika virus. tnx a lot .

Science
Give an example of population.

science
Equations to show how the ff form complexes A. Fe^2+ and H2O B. Cr^3+ and NH3 C. Fe^3+ and CN^-

math
mr sato will give each pair of students 3 magnets. So far Mr sato has given 9 pairs of students their 3 magnets..How many more magnets does Mr Sato need so that each pair of students has exactly 3 magnets.There are 24 students in a science class.

Science
Can someone explain to me, what exactly scientific principles are?

Science
A student measures the mass of a paper clip. The student’s data table is shown below. The accepted value for the paper clip’s mass is 1.14 g. Trial 1 - 2.45 g Trial 2 - 2.40 g Trial 3 - 2.42 g Which of the following describes the student’s measurements? a. The student’...

Science
Is the inventory of time machine related to black hole

Science
A student measures a room to be 20.0m*17.16m. Which of the numbers below represents the room's area with the correct number of significant figures? A) 340 meters squared B) 343 meters squared*** C) 343.2 meters squared D) 343.20 meters squared Am I correct? Not sure if it's b ...

science
Using an example, explain how being able to understand scientific principles and think scientifically can help you solve problems and answer questions in your everyday life

  1. Pages:
  2. <<Prev
  3. 22
  4. 23
  5. 24
  6. 25
  7. 26
  8. 27
  9. 28
  10. 29
  11. 30
  12. 31
  13. 32
  14. 33
  15. 34
  16. 35
  17. 36
  18. Next>>