Questions LLC
Login
or
Sign Up
Ask a New Question
Chemistry
Organic Chemistry
Alkanes
Condensed structural diagram for 3-ethyl-4,5-dipropyloctane
1 answer
CH3(CH2)3CH(CH3)CH2CH(CH3)CH2CH(CH2CH3)CH2CH3
You can
ask a new question
or
answer this question
.
Related Questions
condensed structural diagram for 4-ethyl-2-hexyne
What characteristics show passage 3 to be poetry?
Lines Sentences Stanzas Paragraphs Rhyme Meter Condensed language Non-condensed
Calculate the theoretical yield of ethyl acetate formed if 10 mL of ethyl alcohol (density = 0.79 ... (density = 0.79 G/mL; MW =
Hey Everyone I was wondering how I could write the condensed structural formula for the following organic chemicals:
1.
what is the condensed structural formula for.
5- ethyl-2-hexene
Draw the condensed structural formulas of ethyl alcohol
Write the condensed structural formulas for the following alcohols."" Correct the incorrect names.""
4-methyl-1-pentanol
In a condensed structural diagram what does the double line mean
Draw the diagram/structures of the following substances.
(1) structural formula; 2-ethyl -3-methyl heptane
How do I draw the condensed formula for:
1. 2,3-dimethyl-2-butene 2. 4-ethyl-2-hexyne 3. 3,3,6-trimathylnonane 4.
