Questions LLC
Login
or
Sign Up
Ask a New Question
Chemistry
Stoichiometry
Mole Ratio
10 Fe(NH4)2(SO4)2·6H2O + 2 KMnO4 + 8 H2SO4 -> 5 Fe2(SO4)3 + 2 MnSO4 + K2SO4 + 10 NH4HSO4 + 16 H2O
mole ratio for MnO4^-
1 answer
From the balanced equation, the mole ratio for KMnO4 is 2.
You can
ask a new question
or
answer this question
.
Related Questions
Find the number of unpaired electrons on the central metal atom of following:
MgSO4 NiSO4.6H2O CoCl2.6H2O KCr(SO4)2.12H2O
Which one of the following is not a redox reaction?
A. H2O(l) + NH3(g) → NH4+(aq) + OH¯(aq) B. 2H2(g) + O2(g) → 2H2O(l) C.
What is the complete redox reaction of KMnO4 against (NH4)2Fe(SO4)2
Balance this chemical equation.
K4Fe(CN)6 + KMnO4 + H2SO4 ---> KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O
Write the dissociation equation for iron(II) ammonium sulfate hexahydrate in water .
Fe(NH4)2(SO4)2 * 6H2O --> __?________ I know
The molar mass of the reagent, Fe(NH4)2(SO4)2.6H2O is 392.14 g/mol. Now suppose the measured mass of Fe(NH4)2(SO4)2.6H2O during
When the equation
Fe2(SO4)3(aq) + 3Ba(OH)2(aq) ! is completed and balanced, a term in the balanced equation is 1. 2 Fe(OH)(s). 2.
Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
balance the following chemical equation
Fe2(So4)3 + KSCN = K3Fe(SCN)6 + K2So4 my answer: Fe2(So4)3 + 12 KSCN = 2 K3Fe(SCN)6 + 3
In order to standardize a KMnO4 solution, 0.2848 g Fe(NH4)2(SO4)2·6H2O was dissolved in 25 mL 0.18 M H2SO4. The KMnO4 solution
