I can't seem to figure out the name of this organic molecule. I know it's an amine, but that's it.
There are two methyls (CH3) attached to a CH, followed by (in order) NH, CH2, CH2, CH2, and CH3.
(ignore the ^^^, I had to use them so the atoms would line up)
^^^^^^^H
^^^^^^^|
CH3-CH-N-CH2-CH2-CH2-CH3
^^^^|
^^^CH3
CH(CH3)2-NH-CH2-CH2-CH2-CH3
I'm not an organic chemist but I would name this as isopropyl-1-butanamine. I clicked on Google and typed in naming amines and came up with an IUPAC page in pdf format. That's the name I came away with.
To determine the name of the organic molecule you described, you can use the IUPAC naming system, which is commonly used to systematically name organic compounds.
Here's how you can go about finding the name of the molecule:
1. Identify the longest continuous carbon chain: In this case, the longest continuous carbon chain is comprised of six carbon atoms, which is a hexane chain.
2. Number the carbon atoms in the chain: Start numbering from one end of the chain closer to the amine functional group. In this case, you would number from the carbon attached to the NH group.
3. Identify and name the substituents: The substituents are the groups attached to the main carbon chain. In this case, there are two methyl (CH3) groups attached to the second carbon atom (numbered as 2). So, it would be called 2,2-dimethyl.
4. Name the amine functional group: The NH group is known as an amine functional group. Since it is attached to the second carbon atom, it would be called N-2.
5. Combine the substituents' names with the main chain name: Now, put all the pieces together. The name of the molecule would be 2,2-dimethylhexanamine.
So, the name of the organic molecule you described is 2,2-dimethylhexanamine.