Chemistry, reactions w/ water

Write the equation for the reaction of each of the following with water.

a) HCl
b) CH3COOH
c) NaOH
d) NH3

Are these correct?

a. HCl (aq) + H2O (l) --> H3O+ (aq) + Cl- (aq)

b. CH3COOH (aq) + H2O (l) --> CH3COO- (aq) + H3O+ (aq)

c. NaOH (aq) + H2O (l) --> Na+ + OH- + H2O
[I don't know how I would write it...]

d. NH3 (aq) + H2O (l) --> NH4+ (aq) + OH- (aq)

  1. 👍 0
  2. 👎 0
  3. 👁 508
  1. They are correct.

    1. 👍 0
    2. 👎 0
    👨‍🏫
    bobpursley

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    Consider the following reaction: Na2CO3 + NiCl2 ¨ NiCO3 + 2NaCl Using the solubility rules determine the solubility of all reactants and products. Explain your answer Please. Which product is the precipitate in this reaction?

  2. Grade 12 chemistry

    This is the second reaction: HCl(aq)+NaOH(aq)-->NaCl(aq)+H2O(l) (Heat of neutralization) This reaction involves mixing two solutions: 1.00 mol/L NaOH and 1.00 mol/L HCl. Trial 1: 48.0 mL of the NaOH solution is mixed with 47.5 mL

  3. chemistry

    50.0 mL of a solution of HCl is combined with 100.0 mL of 1.15 M NaOH in a calorimeter. The reaction mixture is initially at 22.4°C and the final temperature after reaction is 31.2°C. What is the molarity of the HCl solution?

  4. chemistry

    CH3NH2(aq)+H2O(l)=>CH3NH3+(aq)+OH-(aq) Kb=4.4 x 10^-4 Methylamine, CH3NH2, is a weak base that reacts with water according to the equation above. A student obtains a 50.0 mL sample of a methylamine solution and determines the pH

  1. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

  2. AP Chemistry

    CH3NH2(aq)+H2O(l)=>CH3NH3+(aq)+OH-(aq) Kb=4.4 x 10^-4 Methylamine, CH3NH2, is a weak base that reacts with water according to the equation above. A student obtains a 50.0 mL sample of a methylamine solution and determines the pH

  3. Chem Help!

    I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide

  4. chemistry

    In a reaction involving the iodination of acetone, the following volumes were used to make up the reaction mixture: 10 mL 5.0 M acetone + 10 mL 1.5 M HCl + 10 mL 0.005 M I2 + 20 mL H2O A student found that it took 400 seconds for

  1. chemistry

    Write and balance the equation for the reaction between nitric acid and potassium iodide. The products are potassium nitrate, iodine, nitrogen monoxide, and water. 2HNO3 + KI = KNO3 + I + 2NO + H2O (Did I write the equation

  2. AP Chemistry

    Write the balanced net ionic equation for the following chemical reaction: Concentrated hydrochloric acid, HCl, is poured into a solution of potassium dichromate, K2Cr2O7.

  3. chemistry

    The reaction of calcium bicarbonate, Ca(HCO3)2 with hydrochloric acid, HCl, produces a solution of CaCl2, gaseous carbon dioxide, CO2, and water, H2O. Write a balanced chemical equation for this reaction and determine the volume

  4. chemistry

    Sulfur and chlorine can react together to form S2Cl2. When 1.00g of this sulfur chloride reacted with water, 0.36g of a yellow ppt of sulfur was formed together with a solution contianing a mixture of sulfurous acid, H2SO3, and

You can view more similar questions or ask a new question.