Chemistry

posted by .

Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions.

1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas.
Express your answer as a chemical equation. Identify all of the phases in your answer.

2)Aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide.
Express your answer as a chemical equation. Identify all of the phases in your answer.

3)In the Apollo lunar module, hydrazine gas, N2H4, reacts with dinitrogen tetroxide gas to produce gaseous nitrogen and water vapor.
Express your answer as a chemical equation. Identify all of the phases in your answer.

  • Chemistry -

    This is something you need to suffer through the mental processes. Do so, and I will critique it for you, repost.

  • Chemistry -

    I answered questions 2 and 3 on my own but still can not get number 1.

    This is what I got: CO(g)+ O(g)->CO2(g)??

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    how do you write a chemical equation with this reaction?
  2. Chemistry

    Please check to see if I got these right and specifically for #2, I am not sure if I have this balanced correctly. Write the complete balanced equations for the following: 1) Potassium metal reacts with oxygen gas to form solid potassium …
  3. Chemistry 11

    Carbon monoxide gas reacts with oxygen gas to form carbon dioxide gas acooridng to the following equation: 2CO(g)+O2(g)--> 2 CO2(g) IF 1 mole of CO2(g) is produves, how many kilojoules of heat energy are absorbed or released ?
  4. Science

    Balanced chemical equation for the carbon monoxide gas for motor car engines combines with the oxygen gas in the air to produce carbo dioxide
  5. Chemisry

    Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical …
  6. Chemistry Balancing Equations

    I really need help with balancing these equations: PLEASE HELP!! 1. Sodium Hydrogen Sulfite reacts with hydrochloric acid to produce sulfur dioxide gas, water and sodium chloride 2. Sodium nitrate reacts with hydrochloric acid to produce …
  7. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  8. Chemistry

    Just having some trouble with this chemistry problem.. Thanks for help! Toxic carbon monoxide (CO) gas is produced when fossil fuels such as petroleum burn without enough oxygen. The CO can eventually be converted to CO2 in the atmosphere. …
  9. Science (chemistry)

    Write a balanced chemical equation and state the reaction type for each of the following reactions: a.) nitrogen gas reacts with hydrogen gas forming ammonia (NH3) b.) carbonic acid breaks down to form carbon dioxide gas and water …
  10. Chemistry

    In the lab, 5.8 L of methane gas is burned with excess oxygen gas at SATP. How much carbon dioxide gas is produced?

More Similar Questions