CH3(C2H5)CHC(C2H5)UCH(CH3)CH((C2H5)2)
Looking for skeletal diagram and formula
This forum can't draw skeletal diagrams.
I don't know what the U stands for either.;
I think it is U or CL not very clear on the paper.
IS there anyway to explain the diagram.
Surely not U.
I'm not aware of one.
I could look for one on the web; however, I think your first C has five bonds which is a no-no.
CH3 is three bonds and the next C makes four, the C2H5(ethyl) group makes it five.
To determine the skeletal diagram and formula for the given compound CH3(C2H5)CHC(C2H5)UCH(CH3)CH((C2H5)2), we can break it down into its individual components and analyze them one by one.
Starting from the beginning, let's consider CH3(C2H5):
- CH3 represents a methyl group, which consists of a single carbon atom bonded to three hydrogen atoms.
- (C2H5) represents an ethyl group, which consists of a two-carbon chain bonded to five hydrogen atoms.
Next, we have CHC(C2H5)U:
- CH represents another methyl group.
- C represents a methylene group, which consists of a carbon atom bonded to two hydrogen atoms.
- (C2H5) represents an ethyl group.
Continuing, we have CH(CH3):
- CH represents a methyl group.
- CH represents another methylene group.
Finally, we have CH((C2H5)2):
- CH represents a methyl group.
- (C2H5)2 represents a diethyl group, which consists of a two-carbon chain bonded to six hydrogen atoms.
Now, let's combine all the components to form the complete skeletal diagram:
CH3 (C2H5) CH C (C2H5) U CH (C2H5)2
| | | | | |
CHC CHC CH CH(CH3) CH CH
The formula of the compound can be obtained by counting the number of atoms present:
- Carbon (C): 12
- Hydrogen (H): 26
Therefore, the formula for the given compound is C12H26.