Chemistry- Acids and Buffers

Cyanic Acid is a weak acid

HOCN + H2O <--> H3O+ +OCN- ka= 3.5*10^-4

a) if 2.5ml of 0.01 M cyanic acid solution is added to 25.0 ml of a formis acid buffer with ph = 3.70, what is the ratio of [OCN-]/[HOCN] in the resulting solution?

b) determine the pH of a 0.500 M solution of cyanic acid

c) calculate the pH of a solution that results from titrating 0.0500 moles of cyanic acid to the equivalence point with an equal number of moles of OH-, if the final volume of the solution is 150.0 mL

  1. 👍 0
  2. 👎 0
  3. 👁 826
  1. HOCN ==> H^+ + OCN^-
    Ka = (H^+)(OCN^-)/(HOCN)
    For a.
    The formic acid buffer is pH 3.70 which is H^+ = 2E-4
    Ka = (H^+)(OCN^-)/(HOCN)
    Rearrange to
    (OCN^-)/(HOCN) = Ka/(H^+)
    Substitute Ka/(H^+) and you have it.

    ........HOCN ==> H^+ + OCN^-
    initial..0.5......0......0
    change.....-x.....x......x
    equil....0-.5-x.....x.....x

    Ka = (H^+)(OCN^-)/(HOCN)
    Substitute and solve for H^+ and convert to pH.

    c. The pH is determined by the hydrolysis of the salt at the equivalence point. The (salt) = 0.05mols/0.150L = ?
    ........OCN^- + HOH ==> HOCN + OH^-
    initial..?...............0......0
    change...-x..............x......x
    equil....?-x..............x.....x

    Kb for OCN^- = (Kw/Ka for HOCN) = (HOCN)(OH^-)/(OCN^-)
    Substitute from the ICE chart and solve for x = (OH^-) and convert to pH. It will be basic.

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    About 13% of the acid in a 0.10M solution of a weak acid dissociates to form ions. What is the H3O+ concentration? What is the OH- concentration? What is the pH of the solution?

  2. Chemistry

    net ionic equation to show that sulfurous acid, H2SO3, behaves as an acid in water. I got this answer but do not know if it is correct. H2SO3 + H2O --- H3O + SO I am Not sure if its is tri/mono/diprotic

  3. Chemistry Logic

    How can I tell a conjugate base from a regular base and a conjugate acid from a regular acid? For example, in: H2O + HONH3 (reversible arrows) HONH2 + H3O+ What is the acid, base, conjugate base, conjugate acid? Is there no base

  4. chemistry

    A. Strong Base 1.) What is the concentration of a solution of KOH for which the pH is 11.89? 2.) What is the pH of a 0.011M solution of Ca(OH)2? B. Weak Acid 1.) The pH of a 0.060M weak monoprotic acid HA is 3.44. Calculate the Ka

  1. CHEMISTRY

    IDENTIFY THE CONJUGATE ACID-BASE PAIR IN THE FOLLOWING REACTIONS. A) HSO4^- + SO3^2- HSO3^- + SO4^2- B) S^2- + H20 HS^- + OH^- C) CN^- + H3O^+ HCN + H2O D) H2SE + H2O HSE^- + H3O^+

  2. Chemistry

    Oxalic acid, found in the leaves of rhubarb and other plants, is a diprotic acid. H2C2O4 + H2O ↔ H3O+ + HC2O4- Ka1= ? HC2O4- + H2O ↔ H3O+ + C2O42- Ka2 = ? An aqueous solution that is 1.05 M H2C2O4 has pH = 0.67. The free

  3. chemistry

    Lactic acid is a weak acid with the formula , HCH3H5O3, the Ka for lactic acid is 1.38 x 10-4. In aqueous solution, lactic acid partially dissociates according to the following reaction: HCH3H5O3 ⇔ CH3H5O3- + H+ Use the Ka

  4. Chemistry 12

    9. According to Arrhenius, which of the following groups contain: i)only acids ii)only bases a. NaOH, H2CO3, KCl b. MgCl2, H2SO4, HCl c. HNO3, HCl, H3PO4 d. Mg(OH)2, AgBr, HF e. KOH, NH4OH, Ba(OH)2 10. Enough water is added to 100

  1. chemistry

    Consider the Ka values for the following acids: Cyanic acid, HOCN, 3.5 ´ 10-4 Formic acid, HCHO2, 1.7 ´ 10-4 Lactic acid, HC3H5O3, 1.3 ´ 10-4 Propionic acid, HC3H5O2, 1.3 ´ 10-5 Benzoic acid, HC7H5O2, 6.3 ´ 10-5 Which of the

  2. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.

  3. Chemistry-Dr Bob help!!

    0.100 M solution of a weak acid, HX, is known to be 15% ionized. The weak acid has a molar mass of 72 g/mol. 1. What is Ka for the weak acid? 2. What is the pH of the buffer prepared by adding 10.0 g of the sodium salt of the acid

  4. chemistry

    Weak Acid 1.) The pH of a 0.060M weak monoprotic acid HA is 3.44. Calculate the Ka of the acid. 2.) The pH of 0.100M solution of weak monoprotic acid HA is 2.85. What is the Ka of the acid?

You can view more similar questions or ask a new question.