1. Questions

Chem

For the autoionisation of water, it looks like

2H2O(l)-> H3O+(aq) + OH–(aq)

I thought that becuase it is going from liquid to ions, wouldnt the Entropy be greater than 0?

However, I have been told and I have calculated the opposite, that entropy is less than 0. Please Explain .

  1. 👍
  2. 👎
  3. 👁
Supaman

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    The weak acid HQ has pKa of 4.89. 1)Calculate the [H3O+] of .035 M HQ. 2)Calculate the (OH-) of 0.500 M HQ ....Am I correct? a) pKa = 4.89 => - log(Ka) = 4.89 => Ka = antilog(- 4.89) = 10-4.89 = 1.29x10-5 1. Given concentration of

  2. Chemistry

    Which of the following processes is endothermic? a) H2O (g) --> H2O (l) b) 3O2 (g) + 2CH3OH(g) --> 2CO2(g) + 2H2O(g) c) H2O (s) --> H2O (l) d) O2(g) + 2H2(g) --> 2H2O(g) I a guessing b, since energy has to go into the reaction for

  3. Chemistry

    Write a balanced equilibrium equation and kb expression for the reaction of the hydrogen phosphate ion (HPO4^2-) with water. Answer: HPO4^2-(aq) +H2O(l) PO4^3-(aq) +H3O+ (aq) kb= [PO4^3-][H3O+]/ [HPO4^2-] is that right?

  4. Chem (HELP ASAP)

    Phenol C6H5OH partially dissociates in water as shown C6H5OH + H2O --> H3O+ + C6H5O- If Ka is 1.6*10^-10 and the concentration of H3O and C6H5O are both 1.0*10^-5 M at equilibrium, what would be the concentration of phenol?

  1. chemistry

    HF hydrolyzes according to the following equation: HF(aq)+H2O(l) H3O+(aq)+F-(aq) When 0.0300 mol of HF dissolves in 1.0 L of water, the solution quickly ionizes to reach equilibrium. At equilibrium, the remaining [HF]=0.0270 M.

  2. science

    The decomposition of water into hydrogen gas H2 and oxygen gas O2 can be modeled by the balanced chemical equation A) H2 + O2 → H2O B) H2O → H2 + O2 C) 2H2 + O2 → 2H2O D) 2H2O → 2H2 + O2

  3. chemistry

    How many moles of H3O+ or OH- must you add per liter of HA solution to adjust its pH from 9.75 to 9.01? Assume a negligible volume change. ……….x 10………Moles of ……………………..h3O+ or OH- I got 4.6001 x 10-5 M

  4. chemistry

    "Write equations for the half-reactions that occur at the anode and cathode for the electrolysis of the following aqueous solution: CuBr2(aq)" Possible oxidation reactions: 1. 2Br- -> Br2 + 2e- = -1.09 2. 2H2O -> O2 + 4H+ + 4e- =

  1. chem

    I need help balancing this redox equation: H2O2 + Ni+2 --> H2O + Ni+3 in basic solution. Here's what I have so far: Ni+2 --> Ni+3 + 1e- H2O2 --> H2O I can't seem to make the second half-reaction balance. If you follow the rules

  2. Chemistry (redox reaction)

    Which reaction is a redox reaction? 1. HCI+H2O=H3O^+ +CI^- 2. H2SO4+2KOH=K2SO4+2H2O 3. CH4+2O2=CO2+2H2O 4. Fe^2+ +2OH^- =Fe(OH)2 I chose number 3, is this correct?

  3. Chemistry(Please respond, thank you)

    What is the [H3O+] for a neutral solution at 50 degrees celsius? I know that kw=[H3O+][OH-] but I am not sure what to do to get the H3O. The value I have for kw=5.76e-14 and I have the pH 6.62 but I do not know what the OH would

  4. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.

You can view more similar questions or ask a new question.