Chemistry

1)Which compound below would be expected to have the highest boiling point?

a) CH3-CH2-CH2-CH2-CH2-CH2-CH3

b) CH3-CH2-CH2-CH2-CH-CH3
|
CH3

c) CH3-CH-CH2-CH-CH3
| |
CH3 CH3

d) CH3
|
CH3-CH-C-CH3
| |
CH3 CH3

Do I use molar mass to determine which is the highest?

  1. 👍 0
  2. 👎 0
  3. 👁 838
  1. You can do the molar mass but won't the molar mass be the same for all of them. They look like 7 carbons to me and if they are saturated I expect all of the molar mass will be the same.
    The straight chain one will be the highest b.p. Branching the chain makes the b.p. lower. The more branched the lower the b.p.

    1. 👍 0
    2. 👎 0
  2. Why is it that the straight chain is higher?

    1. 👍 0
    2. 👎 0
  3. Branching decreases the surface area some but the explanation I've always heard is that the "long" chains get intertwined and interfere with "escaping" from the liquid.

    1. 👍 0
    2. 👎 0
  4. ok thank you!!

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    CH3−CH2−CH2−O−CH2−CH2−CH2−CH2−CH3 Spell out the full name of the compound

  2. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8.

  3. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  4. chem

    drawing Lewis structure 1. NH2 || CH3-CH2-CH2-CH-CH2-CH3 2. O || CH3-CH2_C-CH2-CH2-OCH2-CH circle around the hydrophilic regions in each structure that

  1. Chemistry

    Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?

  2. Chemistry

    Does anyone know the condensed structured formula in the following reaction: a.CH3--CH2--CH=CH2+HOH-->H+ Thank you.

  3. chem

    what is the balanced equation for ozone gas reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

  4. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2-dimethylpentane? Wouldn't it look like this: CH3-C-CH2-CH2-CH3 with a CH3 on the top and bottom of the C, which would be the 2nd carbon...

  1. organic chemistry

    is an α,β-Unsaturated ester CH2=CHCO2Et more or less reactive than an CH2=CHOEt in electrophilic addition and where do the two slot into the reactivity order of CH2=CH2 < CH2=CHMe < CH2=CHBr i think CH2=CHOEt is more reactive

  2. chemistry

    1. Would Ch3-OH or CH3-CH2-CH2-CH2-CH2-OH have a higher boiling point? Fully explain ypur answer. 2. Explain why a tertiary alcohol will not undergo an oxidation reaction. Give an example. 3. Compare and contyrast

  3. chemistry

    please name this compound CH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3

  4. Chemistry

    ................CH3 ..................| CH3-CH2-N-CH2-CH2-CH3 Hoping this turns out okay, but it's an amine and branching off of the N (on top) is a CH3. The name is N-ethyl-N-methylpropanamine but I don't get why. How do you know

You can view more similar questions or ask a new question.