math

A trigonmetric polynomial of order n is t(x) =
c0 + c1 * cos x + c2 * cos 2x + ... + cn * cos nx
+ d1 * sin x + d2 * sin 2x + ... + dn * sin nx

The output vector space of such a function has the vector basis:
{ 1, cos x, cos 2x, ..., cos nx, sin x, sin 2x, ..., sin nx }

Use the Gram-Schmidt process to find an orthonormal basis using the inner-product:
<f,g> = definite integral over [0,2*pi] of: f(x) * g(x) dx

------------------------------------------------------

The book gives the following answer for the orthonormal basis.

g0 = 1/sqrt(2*pi)
g1 = 1/sqrt(pi) * cos x
gn = 1/sqrt(pi) * cos nx

I've done the first two vectors using Gram-Schmidt and my answers don't match:

Original basis vector u0 = 1
Orthogonal basis vector v0 = 1
Orthonormal basis vector g0 = v0/|v0| = sqrt(2/pi)

Original basis vector u1 = cos x
Orthogonal basis vector v1 = u1 - <u1, g0> * g0
= cos x - sqrt(2/pi) * sqrt(2/pi) = cos x - 2/pi
Orthonormal basis vector g1 = v1/|v1| = (cos x - 2/pi) / sqrt((pi^2 - 8)/(4*pi))
= (cos x - 2/pi) * sqrt((4*pi)/(pi^2 - 8))

What am I doing wrong?

  1. 👍
  2. 👎
  3. 👁
  1. Original basis vector u0 = 1
    Orthogonal basis vector v0 = 1
    Orthonormal basis vector g0 = v0/|v0|

    |V0|^2 = 2 pi --->

    g0 = 1/sqrt(2 pi)


    Original basis vector u1 = cos x
    Orthogonal basis vector v1 = u1 - <u1, g0> * g0 = cos x because
    <cos(x), 1> = 0

    1. 👍
    2. 👎
  2. Thanks Count Iblis!

    I was mistakenly integrating with pi/2 instead of 2*pi and every time I redid the problem, I just remade the same mistake without noticing it.

    Your help pointed out the issue. Thanks so much!

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. Algebra 1 polynomials

    Write the polynomial in descending order by the exponents of the x terms 8x^2+4-5ax^3+6a^2x

  2. Calculus

    The point A(-3, -5) is one the terminal arm of an angle feta. Determine the exact expressions for the primary trigonmetric ratios for the angle. Would that be 225 degrees. -2V2?

  3. math help pls pls pls

    Four polynomials are shown below: A. 2 − 2x5 + 2x2 B. 5x3 + 5 − 5x4 C. 3x + 2x5 D. 6x3 − 1 Which of the above polynomials is a 5th degree binomial? Polynomial A Polynomial B Polynomial C Polynomial D pls help me

  4. Studying for Pre Cal exam

    Find the fourth roots of − 1/2 + (square root)3/2 i Write the roots in trigonometric form. A - w 1=cos(35°)+isin(35°) w2 =cos(125°)+isin(125°) w3 =cos(215°)+isin(215°) w4 =cos(305°)+isin(305°) B - w1

  1. Pre-Cal (Trig) Help?

    The following relationship is known to be true for two angles A and B: cos(A)cos(B)-sin(A)sin(B)=0.957269 Express A in terms of the angle B. Work in degrees and report numeric values accurate to 2 decimal places. So I'm pretty

  2. math

    if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that cos(B-C)=cos(C-A)=cos(A-B)=-1/2

  3. Math

    What does the degree of a polynomial expression tell you about its related polynomial function? Explain your thinking. Give an example of a polynomial expression of degree three. Provide information regarding the graph and zeros

  4. Math

    Find the discriminant for the quadratic equation f(x) = 5x^2 - 2x + 7 and describe the nature of the roots. discriminant is 144, one real root discriminant is -136, two complex roots

  1. Math

    Find the exact value of cos 1 degree + cos 2 degrees + cos 3 degrees + ... + cos 357 + cos 358 degrees + cos 359 degrees.

  2. Trig

    Given: cos u = 3/5; 0 < u < pi/2 cos v = 5/13; 3pi/2 < v < 2pi Find: sin (v + u) cos (v - u) tan (v + u) First compute or list the cosine and sine of both u and v. Then use the combination rules sin (v + u) = sin u cos v + cos v

  3. Math

    Let f(x) be a polynomial such that f(cos theta) = cos(4 theta) for all theta. Find f(x). (This is essentially the same as finding cos(4 theta) in terms of cos theta; we structure the problem this way so that you can answer as a

  4. Please help me with Trig

    Given cos 67.5° = [√(2+√2)]/2, find tan 67.5° , simplify where needed, and show work. I'm starting to learn this stuff, and I'm so confused where to start. I know they gave me the coordinate X as in cos 67.5° =

You can view more similar questions or ask a new question.