1. Questions

Chemistry

Hey Everyone I was wondering how I could write the condensed structural formula for the following organic chemicals:
1. 2,3-dimethyl-2-butene

2. 4-ethyl-2-hexyne

3. 3,3,6-trimethylnonane

4. 3-ethyl-4-prophylheptane

5. 3-octanol

6. 2-methyl-2-pentene

7. 5-methyl-1-hexene

8. 2,2,4,5-tetramethylhexane

9. propanoic acid

10. 2-pentyne

Thank you so much.

  1. 👍
  2. 👎
  3. 👁
Matt

  1. A lot of questions for one post. What don't you understand about writing the formulas of these compounds? 3-octanol is CH3CH2CHOHCH2CH2CH2CH2CH3.
    2-pentyne is
    CH3C(triple bond)CCH2CH3.
    Check my thinking.

    1. 👍
    2. 👎
    DrBob222

  2. would 1. be CH3C(CH3) Double bond C(CH3)CH3

    1. 👍
    2. 👎
    Matt

  4. or CH2 double bond C(CH3)CH(CH3)CH3

    1. 👍
    2. 👎
    Matt

  5. The basic structure is 2-butene; therefore, the double bond must go AT the 2 carbon so it's between the 2 and 3 C. 1-butene would be CH2(double bond)C etc..
    So your first answer is correct.

    1. 👍
    2. 👎
    DrBob222

  6. Thank you

    1. 👍
    2. 👎
    Matt

  8. 1. CH3C(CH3)=C(CH3)CH3
    2. CH3C(triple bond)CCH(C2H5)CH2CH3
    3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3
    4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3
    5. CH3CH2CHOHCH2CH2CH2CH2CH3
    6. CH3C(CH3)=CHCH2CH3
    7. CH2=CHCH2CH2CH(CH3)CH3
    8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3
    9. CH3CH2COOH
    10. CH3C(triple bond)CCH2CH3

    1. 👍
    2. 👎
    anna

  9. 1. CH3C(CH3)=C(CH3)CH3
    2. CH3C(triple bond)CCH(C2H5)CH2CH3
    3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3
    4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3
    5. CH3CH2CHOHCH2CH2CH2CH2CH3
    6. CH3C(CH3)=CHCH2CH3
    7. CH2=CHCH2CH2CH(CH3)CH3
    8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3
    9. CH3CH2COOH
    10. CH3C(triple bond)CCH2CH3

    1. 👍
    2. 👎
    kemi

  10. 1. CH3C(CH3)=C(CH3)CH3
    2. CH3C(triple bond)CCH(C2H5)CH2CH3
    3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3
    4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3
    5. CH3CH2CHOHCH2CH2CH2CH2CH3
    6. CH3C(CH3)=CHCH2CH3
    7. CH2=CHCH2CH2CH(CH3)CH3
    8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3
    9. CH3CH2COOH
    10. CH3C(triple bond)CCH2CH3

    1. 👍
    2. 👎
    jon

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    A 1.24-g sample of a hydrocarbon, when completely burned in an excess of O2(g), yields 4.04 g CO2 and 1.24 g H2O Draw a plausible structural formula for the hydrocarbon molecule. I think I understand how to get it to an empirical

  2. AP Chemistry

    The structural formula for acetic acid is CH3CO2H. What is its empirical formula; what is its molecular formula?

  3. Chemistry

    Nonane has a density of 0.79 g/mL. and boils at 151 Celcius. a. What is the condensed structural formula of nonane b. Is it a solid, liquid, or gas at room temperature c. Is it soluable in water d. Will it float on water or sink

  4. chemistry

    convert the condensed formula to a complete and skeletal structure of the following formula (ch3)2chch2ch3

  1. A-Level Chemistry

    How many alcohols (including both structural isomers and stereoisomers) can have the molecular formula C4H10O I know what structural and stereoisomers are but i want to know that whats the method to find the total number of

  2. Chemistry

    1. Which of the following compounds is an unsaturated hydrocarbon? methane *propyne nonane methyl 2. The general name for hydrocarbons with at least one triple covalent bond is ____. alkenes alkyls alkanes *alkynes 3. What is the

  3. Biochemistry

    What is the condensed structural formula of cyclopropane?

  4. Chemistry

    Draw the condensed structural formula for the products of the acid hydrolysis of the following amide with HCl: CH3-CH2-C(=O)-NH2 + H2O + HCl ---> I'm afraid I don't even know where to begin with this one, help!

  1. Organic Chemistry

    An expanded structural formula shows all the atoms of the molecule and all the bonds between the atoms in the molecule. Draw the expanded structural formula for 1,3-dichlorocyclopentane. Draw the structure by placing atoms on the

  2. Chemistry: Please check answers

    1. Which of the following compounds is an unsaturated hydrocarbon? methane *propyne nonane methyl 2. The general name for hydrocarbons with at least one triple covalent bond is ____. alkenes alkyls alkanes *alkynes 3. What is the

  3. chemistry

    Write the condensed structural formulas for the following alcohols."" Correct the incorrect names."" 4-methyl-1-pentanol 2-methyl-2-butanol 3-ethyl-1-butanol 2, 2-diethyl-4-pentanol 3-ethyl -2-hexanol IS THERE ANY WRONG NAMES??

  4. chemistry

    What is the condensed formula for 6-chloro-2-methyl-3-heptyne?

You can view more similar questions or ask a new question.