chemistry

1. Would Ch3-OH or CH3-CH2-CH2-CH2-CH2-OH have a higher boiling point? Fully explain ypur answer.
2. Explain why a tertiary alcohol will not undergo an oxidation reaction. Give an example.
3. Compare and contyrast similarities/differences of condensation and substitution reactions. Provide examples(s) to illustrate their differences.
4. A student is given a contianer with a pure organic compound. OUtline a procedure that the student could perform to explore the type of a functional group on the prganic compound.
5. HOW WOULD YOU DRAW 2-METHYL-2-AMINOBUTANE and
2-AMINOPENTANE ....TO DRAW THE STRUCTURAL DIAGRAM

  1. 👍
  2. 👎
  3. 👁
  1. 1. I would expect n-pentanol to have a higher boiling point because it has a much higher molar mass as well as some hydrogen bonding (although not nearly as much as with CH3OH).
    2. Here is a site where you can read about the oxidiation of primary, secondary, and tertiary alcohols.

    http://www.chemguide.co.uk/organicprops/alcohols/oxidation.html
    I think you can find the others in your text or your notes.

    1. 👍
    2. 👎
  2. Determine All the products of the acid -catalyzed deghydration of 2-pentanol. Show the mechanism for one product.

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  2. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8.

  3. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  4. chem

    drawing Lewis structure 1. NH2 || CH3-CH2-CH2-CH-CH2-CH3 2. O || CH3-CH2_C-CH2-CH2-OCH2-CH circle around the hydrophilic regions in each structure that

  1. Chemistry

    CH3−CH2−CH2−O−CH2−CH2−CH2−CH2−CH3 Spell out the full name of the compound

  2. chemistry

    please name this compound CH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3

  3. Chemistry

    Identify the major intermolecular forces between each of the following atoms or molecules: a. He b. HBr c. SnH4 d. CH3-CH2-CH2-OH

  4. Chem

    whats the name of the compound H3C-CH2-CH2-CH3

  1. Chemistry, Science, Intermolecular Forces

    Identify the major intermolecular forces between each of the following atoms or molecules: a. He b. HBr c. SnH4 d. CH3¬CH2¬CH2¬OH I think b and c are hydrogen bonds. D is dipole-dipole attractions?

  2. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2-dimethylpentane? Wouldn't it look like this: CH3-C-CH2-CH2-CH3 with a CH3 on the top and bottom of the C, which would be the 2nd carbon...

  3. chemistry

    CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound

  4. Chemistry

    Does anyone know the condensed structured formula in the following reaction: a.CH3--CH2--CH=CH2+HOH-->H+ Thank you.

You can view more similar questions or ask a new question.