calculus

If x=sit t nad y=cos 2t prove that d^2y/dx^2+4=0

  1. 👍 0
  2. 👎 0
  3. 👁 169

Respond to this Question

First Name

Your Response

Similar Questions

  1. trig

    prove that cos 52 + cos 68 + cos172 = 0

  2. Trigonometry

    Prove that cos(A+B) + sin(A-B) = 2sin(45°+A)cos(45°+B)

  3. math

    if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that cos(B-C)=cos(C-A)=cos(A-B)=-1/2

  4. Math - Trig - Double Angles

    Prove: cos4x = 8cos^4x - 8cos^2x + 1 My Attempt: RS: = 4cos^2x (2cos^2x - 1) + 1 = 4 cos^2x (cos2x) + 1 LS: = cos2(2x) = 2cos^2(2x) - 1 = (cos^2(2)) - cos^2(2x)) - 1 ----- Prove: 8cos^4x = cos4x + 4cos2x + 3 My Attempt: RS: =

  1. math (trigonometry)

    if tan A/2 =cosecA-sin A then prove cos^2 A/2=cos 36 degree

  2. Trigonometry

    Prove that cos(A+B)cosC - cos(B+C)cosA = sinBsin(C-A)

  3. Maths

    Cos^4(θ)/cos^2(α) + sin^4(θ)/ sin^2(α)=1 Prove that cos^4 alpha/cos^ thetha + sin^4alpha/ sin^2thetha= 1

  4. Biology

    Which of the following statements about NAD or NADH is FALSE? a) NAD is converted to NADH during both glycolysis and the Krebs cycle b) NAD possesses more chemical energy than NADH c) NAD picks up hydrogen ion (H+) and electrons

  1. precalculus

    Sin(x+y)cos(x-y)= 1/2sin2x+ 1/2 sin2y Help please I have no idea how to do this because my math class never did it but while making the final review for the chapter I was assigned, I put this one in it. They are going to all ask

  2. Pre-calculus

    Prove the following identities. 1. 1+cosx/1-cosx = secx + 1/secx -1 2. (tanx + cotx)^2=sec^2x csc^2x 3. cos(x+y) cos(x-y)= cos^2x - sin^2y

  3. MathS triG

    1 .If tanA=1/3 and tanB=1/7 (both A and B are acute),calculate 50sin(2A +B) 2.1Prove that sin2A+2cosA-2cos^3A/1+sinA =sin2A 2.2 for which values of A in the interval[-360;360] is the identity in 2.1 undefined? 3.If tanB=3/4 , 0

  4. maths Pls help trig

    1 .If tanA=1/3 and tanB=1/7 (both A and B are acute),calculate 50sin(2A +B) 2.1Prove that sin2A+2cosA-2cos^3A/1+sinA =sin2A 2.2 for which values of A in the interval[-360;360] is the identity in 2.1 undefined? 3.If tanB=3/4 , 0

You can view more similar questions or ask a new question.