chem

What is the [OH-] for a solution at 25°C that has [H3O+] = 8.23 × 10-2 M?

  1. 👍 0
  2. 👎 0
  3. 👁 273

Respond to this Question

First Name

Your Response

Similar Questions

  1. ap chemistry

    Which of the following statements about the pH scale is not true? A. In a pH expression, the hydronium ions, H3O+, can be abbreviated simply as H+. B. A solution with a pH of 4 has twice the [H+] of a solution with a pH of 2. C.

  2. Chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O -->

  3. Chemistry 2 Lab

    Calculate the degree of ionization of acetic acid in solution 1 through 3? All I am giving is the pH... pH of solution 1= 3 pH of solution 2= 3.5 pH of solution 3= 5 Then, I did this... HC2H3O2 (aq) + H2O (l) equals H3O+ (aq) +

  4. Chemistry

    1.The pH of a 0.10 mol/L aqueous solution of Fe(NO3)3 is not 7.00. The equation that best accounts for this observation is: a. Fe3+(aq) + 3H2O(l)Fe(OH)3(aq) + 3H+(aq) b. NO3-(aq) + H2O(l) HNO3(aq) + OH-(aq) c. Fe(H2O)63+(aq) +

  1. Chemistry

    Calculate [H3O+] in the following aqueous solution at 25 ∘C: [OH−]= 1.9×10−9M Calculate [H3O+] in the following aqueous solution at 25 ∘C: [OH−]= 2.1×10−2M Calculate [H3O+] in the following aqueous solution at 25

  2. Chemistry(Please respond, thank you)

    What is the [H3O+] for a neutral solution at 50 degrees celsius? I know that kw=[H3O+][OH-] but I am not sure what to do to get the H3O. The value I have for kw=5.76e-14 and I have the pH 6.62 but I do not know what the OH would

  3. chemistry

    oxalic acid, h2c2o4, is a weak acid capable of providing two H3O+ ions. ka=.059 k2=6.4E-5 the [h3o]+ in a .38 M solution of h2c2o4 is .12M and can be calculated by the first ionization step only. what is the equilibrium

  4. science ap chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.

  1. Chemistry

    How do you find the Ka1 and Ka2 of oxalic acid when it is in a solution that is 1.05 M H2C2O4 and has a pH of 0.67. [C2O4^2-] = 5.3x10^-5 M. I have tried using an ICE table for both reactions, as oxalic acid is a diprotic acid,

  2. Chemistry

    Oxalic acid, found in the leaves of rhubarb and other plants, is a diprotic acid. H2C2O4 + H2O ↔ H3O+ + HC2O4- Ka1= ? HC2O4- + H2O ↔ H3O+ + C2O42- Ka2 = ? An aqueous solution that is 1.05 M H2C2O4 has pH = 0.67. The free

  3. Chemistry

    Calculate the pH of a solution in which a. [H3O+] = 7.8 x 10-7 M pH = b. [H3O+] = 5.1 x 10-6 M pH = c. [H3O+] = 6.1 x 10-5 M pH = d. [H3O+] = 9.3 x 10-4 M pH = I get 8.1 9.5 9.1 6.7 but its wrong please someone help!

  4. chemistry

    1. Find the pH of a solution whose [H3O+] is 9.5 X 10^ -8 M. 2. What is the [H3O+] concentration of a solution with a pH of 5.45? 3. What is the pOH of a solution with a [OH -] concentration of 2.97 X 10^ -10 M?

You can view more similar questions or ask a new question.