CHEMISTRY

C12H20(Y)--> 22CH2=O+ 2CH3C(=O)CH2C(=O)CH3

The reagents used are ozone, Zn and H20

Give condensed formula of C12H20Y

  1. 👍 0
  2. 👎 0
  3. 👁 130

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    Identify the predominant intermolecular force in each of these substances. 1. Hydrogen 2. Dipole-Dipole 3. London A)H20 B)NH3 C)CH3 C=O OCH3 D)CH4 E)CH OH-C-OH CH3 what I have so far is A) 1 B) 1 C) 2 D) 3 E) I'm not sure about E,

  2. College Algebra

    Ozone occurs at all levels of Earth's atmosphere. The density of ozone varies both seasonally and latitudinally. At a given city, the density D(h) of ozone (in 10^−3cm/km) for altitudes h between 20 kilometers and 35 kilometers

  3. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  4. organic chemistry!

    Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural

  1. chemistry

    The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 B) 1.00 x 10^-6

  2. Earth Science

    Which of the following statements about ozone are true? Select the two correct answers. a. Most ground level ozone is released by vehicles. b. Ozone is helpful for reducing smog levels.*** c. Ozone at ground level is harmful to

  3. chemistry

    convert the condensed formula to a complete and skeletal structure of the following formula (ch3)2chch2ch3

  4. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8.

  1. Chemistry

    Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?

  2. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  3. Math

    Ozone occurs at all levels of Earth's atmosphere. The density of ozone varies both seasonally and latitudinally. At a given city, the density D(h) of ozone (in 10^−3cm/km) for altitudes h between 20 kilometers and 35 kilometers

  4. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

You can view more similar questions or ask a new question.