chemistry

The reaction
CH3- N≡C → CH3- C≡N

is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially,
C]

[CH3-N ≡ C] is __________ after 1.000 x 10^3 s.

A) 5.33 x 10^-4

B) 1.00 x 10^-6

C) 4.27 x 10^-3

D) 2.34 x 10^-4

E) 1.88 x 10^-3

I asked this question before and tried to solve it on my own but im confused on how to set it up. i know the answer is A. but i just don't know how to get there.

  1. 👍
  2. 👎
  3. 👁
  1. is this right?

    For first order kinetics:
    ln[A) = -kt + ln[Ao]
    ln[A) = - (6.29 x 10^-4 1/s)(1000. s) + ln (0.00100)
    ln[A) = -0.629 - 6.91 = -7.54
    [A) = e^-7.54 = 5.33 x 10^-4

    1. 👍
    2. 👎
  2. Jes, I worked this problem for you yesterday. You don't go back and look at your posts? Here is how I did it (and Jack's looks ok, too).
    ln(No/N) = kt
    ln(1 x 10^-3/N) = 6.29 x 10^-4*1 x 10^3
    Solve for N. I get 5.33 x 10^-4

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  2. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  3. Chemistry - - Hydrocarbons

    Name the following hydrocarbons. A) CH3-CH2-CH-CH2-CH2-CH3 | CH3 I don't know if this will show up correctly after I post. But the CH3 at the bottom is supposed to be under the CH. I don`t get how to name. I counted up all the

  4. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8.

  1. organic chemistry!

    Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural

  2. Chemistry

    A solution of hexane in the solvent (CH3)2CO has a mole fraction of CH3(CH2)4CH3 of 0.114. What mass (g) of the solution must be taken if 1690 g of hexane is needed? Molar Mass (g/mol) CH3(CH2)4CH3 100.21 (CH3)2CO 58.05 Density

  3. Chemistry

    Ethane, C2H6, forms ·CH3 radicals at 700.°C in a first-order reaction, for which k = 1.98 h-1. (a) What is the half-life for the reaction? (b) Calculate the time needed for the amount of ethane to fall from 1.00 10-3 mol to 2.48

  4. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

  1. Chemistry

    Please heellppppppppp!!!! How do you expect the following series of compounds to compare in behavior in the two tests?(Sn1/Sn2 reaction) CH3-CH=CH-CH2-Br CH3-C=CH-CH3 ! Br CH3-CH2-CH2-CH2-Br Please help me answer this question, I

  2. chemistry

    CH3 CH3-C-CH3 CH3CH2CH2-C-CH2CH2CH2CH3 CH3 give the IUPAc name for this compound? is it 4-methyl-4-tert-methyloctane?

  3. chemistry

    Compound C does not bind to the receptor as effectively as acetylcholine . Explain briefly why this might be the case. (Two or three sentences)(again if the post does not show right, two of the CH3 should be above and below the

  4. Chemistry

    (CH3)2CHCH2CH(CH2CH2CH2CH3)CH2CH(CH3)CH((CH3)2) Looking for skeletal diagram and name of formula.

You can view more similar questions or ask a new question.