1. Questions

Chem

For each unbalanced equation below, calculate how many grams of each product would be produced by complete reaction of 12.5g of the reactant indicated. Indicate clearly the mole ratio used for the conversion.
A. TiBr4(g)+H2(g)=Ti(s)+HBr(g), Reactant is H2
B. SiH4(g)+NH3(g)=Si3N4(s)+H2(g), Reactant is SiH4
C. NO(g)+H2(g)=N2(g)+2H2O(l), Reactant is H2
D. Cu2S(s)=Cu(s)+S(g), Reactant is Cu2S

  1. 👍
  2. 👎
  3. 👁
OliviaK

  1. These are stoichiometry problems.
    1. Balance the equations.
    2. Convert 12.5 g of the reactant indicated to mols. mols = grams/molar mass.
    3. Using the coefficients in the balanced equation, convert mols of what you have to mols of what you want.
    4. Convert mols of the product to grams.
    Post your work if you get stuck. Explain fully what you don't understand.

    1. 👍
    2. 👎
    DrBob222

  2. B) = 3SiH4(g) + 4NH3(g)= SiN4(g) + 12N2
    3: 1: 12= ratio
    3= 3.125
    1= 1.042
    12= 12.5

    1. 👍
    2. 👎
    Minh

Respond to this Question

First Name

Your Response

Similar Questions

  1. science

    Use the chemical equation to complete the activity. 2Cu+S→Cu2S Copper (Cu) reacts with sulfur (S) to form copper sulfide as shown in the chemical equation. A scientist adds 4 grams of Cu to 2 grams of S to start the reaction. At

  2. General Chemistry

    A reaction vessel contains 7.92 g of CO and 7.92 of O2. How many grams of CO2 could be produced according to the follow unbalanced reaction? CO + O2 --> CO2

  3. chemistry

    Examine the unbalanced equation. CH4 + O2 → CO2 + H2O What is the best classification for the unbalanced equation's reaction, and why? It is a combustion reaction because carbon dioxide (CO2) is emitted as a product. It is a

  4. Chemistry

    Given the unbalanced equation: (NH4)2 CO3-> NH3 + CO2 + H2O Calculate the mass of ammonia gas that is produced if 1.25g of ammonium carbonate decomposes completely.

  1. CHEM

    1. How much heat is released when 9.22 grams of glucose C6H12O6 reacts according to the following equation? C6H12O6 + 6O2 --> 6CO2 + 6H2O ∆H = -2803 kJ 2. How much heat is absorbed during photosynthesis when 9.22 grams of

  2. Chemistry

    C2H6(g) + O2(g) CO2(g) + H2O(g) (a) Consider the unbalanced equation above. What is the maximum mass of CO2 that can be produced when 21.0 g of C2H6 and 38.5 g O2 react? (b) If 24.7 g of carbon dioxide is actually produced by the

  3. science

    Consider the equation: CH4+O2→2H2O+CO2 Which element or elements are unbalanced in this equation? A- Both H and O are unbalanced. B- C, H, and O are all unbalanced. C- Only the O is unbalanced. D- Only the H is unbalanced.

  4. chemistry

    For each of the following unbalanced equations, indicate how many moles of the first product are produced if 0.625 mol of the second product forms. State clearly the mole ratio used for each conversion. CH3CH2OH(l) + O2 -->

  1. Stoichiometry

    How would I solve this...........For each of the following unbalanced equations, calculate how many grams of each product would be produced by complete reaction of 12.5 g of the reactant indicated in boldface. Indicate clearly the

  2. Chem

    f 147 grams of FeS2 is allowed to react with 88 grams of O2 according to the following unbalanced equation, how many grams of Fe2O3 are produced? FeS2 + O2 → Fe2O3 + SO2

  3. Chemistry

    CS2(g) + O2(g) CO2(g) + SO2(g) (a) Consider the unbalanced equation above. What is the maximum mass of SO2 that can be produced when 46.0 g of CS2 and 29.0 g O2 react? (b) Assume the reaction in part (a) goes to completion.

  4. science

    calculate the volume of gas at STP that is produced when 1g of silver nitrate is heated. the unbalanced reaction is: AgNO3(s)=Ag(s)+NO2(g)+O2(g)

You can view more similar questions or ask a new question.