1. Questions

Chem

For each unbalanced equation below, calculate how many grams of each product would be produced by complete reaction of 12.5g of the reactant indicated. Indicate clearly the mole ratio used for the conversion.
A. TiBr4(g)+H2(g)=Ti(s)+HBr(g), Reactant is H2
B. SiH4(g)+NH3(g)=Si3N4(s)+H2(g), Reactant is SiH4
C. NO(g)+H2(g)=N2(g)+2H2O(l), Reactant is H2
D. Cu2S(s)=Cu(s)+S(g), Reactant is Cu2S

  1. 👍
  2. 👎
  3. 👁
OliviaK

  1. These are stoichiometry problems.
    1. Balance the equations.
    2. Convert 12.5 g of the reactant indicated to mols. mols = grams/molar mass.
    3. Using the coefficients in the balanced equation, convert mols of what you have to mols of what you want.
    4. Convert mols of the product to grams.
    Post your work if you get stuck. Explain fully what you don't understand.

    1. 👍
    2. 👎
    DrBob222

  2. B) = 3SiH4(g) + 4NH3(g)= SiN4(g) + 12N2
    3: 1: 12= ratio
    3= 3.125
    1= 1.042
    12= 12.5

    1. 👍
    2. 👎
    Minh

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    consider the reaction in which 410 grams of Ca(NO3)2 react with just the right amount of lithium metal in a single replacement reaction. 1-how many grams of lithium are required? 2- how many grams of each product can be produced?

  2. science

    Use the chemical equation to complete the activity. 2Cu+S→Cu2S Copper (Cu) reacts with sulfur (S) to form copper sulfide as shown in the chemical equation. A scientist adds 4 grams of Cu to 2 grams of S to start the reaction. At

  3. chemistry

    Sodium carbonate reacts with hydrochloric acid as shown below in an unbalanced chemical equation. What mass of CO2 is produced from the reaction of 2.94g Na2CO3 with excess HCL?

  4. science

    Consider the equation: CH4+O2→2H2O+CO2 Which element or elements are unbalanced in this equation? A- Both H and O are unbalanced. B- C, H, and O are all unbalanced. C- Only the O is unbalanced. D- Only the H is unbalanced.

  1. General Chemistry

    A reaction vessel contains 7.92 g of CO and 7.92 of O2. How many grams of CO2 could be produced according to the follow unbalanced reaction? CO + O2 --> CO2

  2. chemistry

    1)The reaction of methane and oxygen yields carbon dioxide gas and water. The unbalanced reaction is as follows: CH4(g) + O2(g)CO2(g) + H2O(g) A. If 0.718 grams of methane are reacted, how many grams of water vapor are produced?

  3. Chemistry

    What mass of sodium chloride is produced when chlorine gas reacts with 0.29 grams of sodium iodide? Unbalanced equation is given below: NaI + Cl2 -> NaCl + I2

  4. chemistry

    Solutions of sodium hydroxide cannot be kept for very long because they absorb carbon dioxide from the air , forming sodium carbonate. the unbalanced equation is NaOH(aq) + CO2(g) = Na2CO3(aq) + H2O(l) calculate the number of

  1. chemistry

    Examine the unbalanced equation. CH4 + O2 → CO2 + H2O What is the best classification for the unbalanced equation's reaction, and why? It is a combustion reaction because carbon dioxide (CO2) is emitted as a product. It is a

  2. CHEMISTRY

    When 10.8 g of Silver was reacted with Sulfur, 12.4 grams of product was produced (there was only one product). What is the empirical formula of the product?

  3. Chemistry

    CS2(g) + O2(g) CO2(g) + SO2(g) (a) Consider the unbalanced equation above. What is the maximum mass of SO2 that can be produced when 46.0 g of CS2 and 29.0 g O2 react? (b) Assume the reaction in part (a) goes to completion.

  4. chemistry

    Na + H2O ¨ NaOH + H2 How many moles of H2 would be formed from 30 grams of Na in the following (UNBALANCED) equation?

You can view more similar questions or ask a new question.