Questions LLC
Login
or
Sign Up
Ask a New Question
Chemistry
Chemical Reactions
Balancing Equations
what is the balanced equation of H+ + [Al(OH4]-
and
[Al(H2O)6]3+ + K+ + SO4
1 answer
AL (OH)2 CI
You can
ask a new question
or
answer this question
.
Related Questions
Which one of the following is not a redox reaction?
A. H2O(l) + NH3(g) → NH4+(aq) + OH¯(aq) B. 2H2(g) + O2(g) → 2H2O(l) C.
Balance this chemical equation.
K4Fe(CN)6 + KMnO4 + H2SO4 ---> KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O
Write a balanced chemical equation for the reaction of propylamine with water.
Is propylamine --> CH3CH2CH2NH2? Is the equation
Enter the balanced complete ionic equation for HCl(aq)+K2CO3(aq)→H2O(l)+CO2(g)+KCl(aq)
Would it be: 2H+(aq) + 2Cl^-(aq) +
Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
When the equation
Fe2(SO4)3(aq) + 3Ba(OH)2(aq) ! is completed and balanced, a term in the balanced equation is 1. 2 Fe(OH)(s). 2.
Calculate the volume (in mL) of 9.0M H2SO4 that you would need to convert 0.070 moles of KAl(OH)4 to K2SO4 and Al2(SO4)3
When butane undergoes complete combustion , the products are CO2 and H2O
C4H10(g) + O2(g)-> CO2(g) + H2O(g) What is the value of
KOH + F2 ->KF+F2O+H2O
which option shows a correctly balanced chemical equation 3KOH + F2->3KF+2F2O+H20 3KPH+3F2->KF+F2O+2H2O
Write balanced complete ionic equation for HC2H3O2(aq) + K2CO3(aq)-----> H2O(l)+CO2(g)+KC2H3O2(aq)
I put