Biology

In the following chemical reaction, what is carbon dioxide (CO2)?

12 H20 + 6 CO2 -> 1 glucose molecule + 6 O2

  1. 👍 0
  2. 👎 0
  3. 👁 225
  1. I searched Google under the key words "carbon dioxide" to get these possible sources:

    http://en.wikipedia.org/wiki/Carbon_dioxide
    http://www.lenntech.com/carbon-dioxide.htm

    In the future, you can find the information you desire more quickly, if you use appropriate key words to do your own search. Also see http://hanlib.sou.edu/searchtools/.

    I hope this helps. Thanks for asking.

    1. 👍 0
    2. 👎 0
    posted by PsyDAG

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

    asked by Susan on March 12, 2012
  2. Chemistry

    Ok, Need some more help... This is what I have so far. 4. Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. molar mass:NH3=17

    asked by Jennie on February 26, 2015
  3. Chemistry

    Ok, Need some more help... This is what I have so far. 4. Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. molar mass:NH3=17

    asked by Jennie on February 26, 2015
  4. help

    Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction? A. CH4 + O → H2O + CO2 B. CH4 + 4O → 2H2O + CO2 C. CH4 + O2 → H2O + CO2 D. CH4 + 2O2 →

    asked by sidney on October 9, 2015
  5. chemistry

    initially 1 mol each of gaseous carbon dioxide, co2(g) and hydrogen h2(g) is inhected into a 10.0L reaction chamber at 986 degrees. What is the predicted concentration of each entity at equilibrium? the equation is as follows:

    asked by sarah on May 22, 2014
  6. chemistry

    Equillibrium, an example given by my textbook confused me. First it shows a reaction inside a soft drink: co2(g)-->

    asked by kevin on August 6, 2009
  7. Physical Science

    Hi! Thanks for checking my question out! ____ 1. Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction? (1 point) a) CH4 + O --> H2O + CO2 b) CH4 + 4O

    asked by Da Fash on November 14, 2017
  8. chemistry

    Carbon disulfide (CS2) undergoes a single displacement reaction with O2 to form CO2. If 100 grams of CS2 reacts with 38 grams of O2, what will the limiting reagent be? CS2 + O2 CO2 + 2S carbon disulfide (CS2) carbon dioxide (CO2)

    asked by calista on June 7, 2018
  9. chemistry

    How many moles of water will produced at equilibrium be if there is 1.0 mole of carbon dioxide formed at equilibrium? 2 C2 H6(g) + 7 O2(g) 4 CO2(g) + 6 H2 O(g) ... [CO2]^4[H20]^6/[C2 H6]^2[O2]^7

    asked by Anonymous on July 27, 2010
  10. Chemistry

    carbon dioxide (CO2) is the gas mainly responsible for global warming (the greenhouse effect). the burning of fossil fuels is a major cause of the increased concentration of CO2 in the atmosphere. carbon dioxide is also the end

    asked by Lauren on June 13, 2011

More Similar Questions