Chemistry

Two compounds that contain Cu and Cl have the following masses:
Cpd A: 32.10 g Cu and 17.90 g Cl
Cpd B: 23.64 g Cu and 26.37 g Cl
Are the compounds the same? If not, what is the lowest whole-number mass ratio of Cu that combines with a given mass of Cl?

  1. 👍 0
  2. 👎 0
  3. 👁 155
  1. Cu/Cl =
    32.10/17.90 = 1.79
    but
    23.64/26.37 = .896

    so no way the same compound

    well .896/1 = 896/1000 = 448/500 = 224/250 = 112/125

    1. 👍 1
    2. 👎 0
  2. Thank you so much!!

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    Explain why this reaction is not feasible:CH3CHO^-Na^+ + CH3C(CH3)2Cl=CH3CH2O(CH3)2OCH3. ;->Becos of ion charge of Oxygen and Na in the cpd reacting with non ionic cpd

    asked by Destiny on June 5, 2014
  2. science

    Which of the following is NOT true about compounds? A) compounds join in specific ratios according to their masses B) the mass ratio of a specific compound is always the same C) compounds are random combinations of elements D)

    asked by Katherine on November 13, 2009
  3. CHEMistry

    A mixture of two compounds, A and B, was separated by extraction. After the compounds were dried, their masses were found to be: 117 mg of compound A and 91 mg of compound B. Both compounds were recrystallized and weighed again.

    asked by Jen on August 12, 2012
  4. Chemistry

    Samples of three different compounds were analyzed and the masses of each element were determined. Compound Mass Mass N(g) O(g) A 5.6 3.2 B 3.5 8.0 C 1.4 4.0 If you were John Dalton and had never heard of a mole, which of the

    asked by Davis on August 29, 2011
  5. chemistry

    What is a special group of compounds that produce H+ ions when dissolved in water? A. Acids B. Ionic compounds C. Molecular compounds D. Polyatomic compounds I think A

    asked by Keri on November 10, 2012
  1. Science

    Which is greater, the mass of the compounds before a chemical reaction or the mass of the compounds after a chemical reaction? The mass of the compounds before is greater. The mass of the compounds after is greater. The masses

    asked by T on March 16, 2018
  2. science

    what are the molecular or formula masses of each of the following compounds,al[oh]3,hno3,pcl3,cuco3,feso4

    asked by Anonymous on January 29, 2012
  3. chemistry help!!! (clueless)

    how do i find the mass number of chemicals I would think that you would add up the components masses (molecular masses [from periodic table) that make up the chemical... like...HCl (H= 1.008g/mol, Cl= 35.45g/mol) added=

    asked by tessa on July 10, 2007
  4. Chemistry

    Use the periodic table to answer this question. A student dissolves 24.2 g of NaCl in 500 mL of water. Another student dissolved 24.2 g of KI in 500 mL of water. Why do the two solutions have different molarities? The volumes of

    asked by Noah Love on June 24, 2016
  5. Chemistry-Paramagnetic or Diamagnetic

    I did a lab where I was supposed to make "estimates" on transition compounds based on their electron configuration of how the compounds will react positively or negatively and then to experiment the compounds in conjunction with

    asked by Jessie on January 10, 2015

More Similar Questions