Chem

Do Ozone gas decomposite naturally under IR rays?

  1. 👍 0
  2. 👎 0
  3. 👁 143

Respond to this Question

First Name

Your Response

Similar Questions

  1. Science

    A model shows rays of sunlight moving straight from the sun perpendicular to the surface of the earth. What are these rays called?

  2. College Algebra

    Ozone occurs at all levels of Earth's atmosphere. The density of ozone varies both seasonally and latitudinally. At a given city, the density D(h) of ozone (in 10^−3cm/km) for altitudes h between 20 kilometers and 35 kilometers

  3. Earth Science

    Which of the following statements about ozone are true? Select the two correct answers. a. Most ground level ozone is released by vehicles. b. Ozone is helpful for reducing smog levels.*** c. Ozone at ground level is harmful to

  4. physics

    In a dentist's office, an X-ray of a tooth is taken using X-rays that have a frequency of 7.01 1018 Hz. What is the wavelength in vacuum of these X-rays?

  1. Physics

    A pion has rest energy 135MeV. It decays into two gamma rays that travel at the speed of light. A pion moving through the lab frame at v=0.98c decays into two gamma rays of equal energies, making equal angles θ with the direction

  2. physics

    Two non-parallel light rays initially converge to a single point on a screen. A rectangular block of glass is now placed somewhere in front of the screen, in the path of the light rays, so that the glass surface is parallel to the

  3. Math

    Ozone occurs at all levels of Earth's atmosphere. The density of ozone varies both seasonally and latitudinally. At a given city, the density D(h) of ozone (in 10^−3cm/km) for altitudes h between 20 kilometers and 35 kilometers

  4. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

  1. Earth Science

    I need help, please! Only two questions, I don't know the first one. 1. Suppose that a report shows that, for a given year, the levelized cost of energy (LCOE) of new construction projects is expected to be $0.0545 per kWh for

  2. Chemistry

    If the pressure exerted by ozone, O3, in the stratosphere is 3.0 x 10^-3 atm and the temperature is 250K, how many ozone molecules are in a liter? Please help me.

  3. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and

  4. science

    what do all materials have in common? A. they all are naturally occurring and they are formed by inorganic pieces B. they do not naturally occur but they are formed by an inorganic process C. They are naturally formed and are

You can view more similar questions or ask a new question.