Chemistry

The thermochemical equation which is associated with ∆H°f, the standard enthalpy of formation, for urea, CO(NH2)2 (s), is:

CO (g) + 2NH3 (g) --> CO(NH2)2 (s) + H2 (g)
CO (g) + 2H2 (g) + N2 (g) --> CO(NH2)2 (s)
C (s) + O (g) + N2 (g) + 2H2 (g) --> CO(NH2)2 (s)
C (s) + 1/2O2 (g) + N2 (g) + 2H2 (g) --> CO(NH2)2 (s)
C (s) + 1/2O2 (g) + 2NH2 (g) --> CO(NH2)2 (s)

Please help

  1. 👍 0
  2. 👎 0
  3. 👁 371
  1. You say equation but you have four equations listed. I don't see a question.

    1. 👍 0
    2. 👎 0
  2. WHAT ANS

    1. 👍 0
    2. 👎 0
  3. Answer to what?

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemsitry

    c. Use the enthalpy diagram provided above and apply Hess’s Law to determine the standard enthalpy of formation for C12O36H20N12 (s) using the results from part (a) and the following values: The standard enthalpy of formation of

    asked by Nora on October 23, 2010
  2. Laxmibai Jr clg

    Calculate the change in entropy. enthalpy and Gibbs energy under standard conditions for the reaction of the formation of glycine CH3 (NH2)COOH1>CH2(NH2)CONHCH2COOH1+H2O1.298 k glycine

    asked by Mrunalini on November 9, 2015
  3. Chemistry

    Consider the isomerization equlibria of an alkene (C4H8) that co-exists as three isomers. (These 3 are in an equlibrium triangle) Reaction 1: cis-2-butene ⇔ trans-2-butene Reaction 2: cis-2-butene ⇔ 2-methylpropene Reaction 3:

    asked by Gleb on March 3, 2013
  4. chemistry

    A scientist measures the standard enthalpy change for the following reaction to be -172.4 kJ : 2SO2(g) + O2(g) 2SO3(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of

    asked by jojo on March 7, 2015
  5. chemistry

    A scientist measures the standard enthalpy change for the following reaction to be -2923.0 kJ : 2C2H6(g) + 7 O2(g) 4CO2(g) + 6 H2O(g) Based on this value and the standard enthalpies of formation for the other substances, the

    asked by Anonymous on October 24, 2012
  6. gen Chem

    I've attempted this problem but not sure if i'm on the right track. Use the enthalpy diagram provided above and apply Hess’s Law to determine the standard enthalpy of formation for C12O36H20N12 (s) using the results from part

    asked by Vince on October 26, 2010
  7. Chemistry

    If calcium carbide has a standard enthalpy of formation of -59.8 kJ/mol and acetylene has a standard enthalpy of formation of 226.73 kJ/mol, what is the standard enthalpy change for the reaction?

    asked by Kelly on February 20, 2013
  8. chemistry

    A scientist measures the standard enthalpy change for the following reaction to be -53.4 kJ : Ca(OH)2(aq) + 2 HCl(aq) CaCl2(s) + 2 H2O(l) Based on this value and the standard enthalpies of formation for the other substances, the

    asked by Austin on March 18, 2012
  9. chemistry

    A scientist measures the standard enthalpy change for the following reaction to be -53.4 kJ : Ca(OH)2(aq) + 2 HCl(aq) CaCl2(s) + 2 H2O(l) Based on this value and the standard enthalpies of formation for the other substances, the

    asked by Austin on March 18, 2012
  10. Chemistry

    Caluclate the delta H for this reaction using standard enthalpies of formation. (The standard enthalpy of formation of liquid pentane is -146.8kJ/mol. Balanced equation balanced equation: C5H12(l)+8O2(g)-->5CO2+6H2O(g) CO2=393.5

    asked by Ashley on December 4, 2010

More Similar Questions