Chemistry

Calculate [H3O+] in the following aqueous solution at 25 ∘C: [OH−]= 1.9×10−9M

Calculate [H3O+] in the following aqueous solution at 25 ∘C: [OH−]= 2.1×10−2M

Calculate [H3O+] in the following aqueous solution at 25 ∘C: [OH−]= 6.1×10−12M

  1. 👍 0
  2. 👎 0
  3. 👁 2,650
  1. (H3O^+)(OH^-) = Kw = 1E-14
    Substitute and solve.

    1. 👍 0
    2. 👎 0
  2. gng

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    Calculate the concentration of all species in a 0.145 M solution of H2CO3 (Ka1 is 4.3×10−7 and Ka2 is 5.6×10−11). Calculate the concentration of H2CO3. Calculate the concentration of HCO−3. Calculate the concentration of

  2. Chemistry

    Calculate the concentrations of H3O+ and OH- ions in a 0.25 M HClO4 solution.

  3. chemistry

    The weak acid HQ has pKa of 4.89. 1)Calculate the [H3O+] of .035 M HQ. 2)Calculate the (OH-) of 0.500 M HQ ....Am I correct? a) pKa = 4.89 => - log(Ka) = 4.89 => Ka = antilog(- 4.89) = 10-4.89 = 1.29x10-5 1. Given concentration of

  4. Chemistry

    Oxalic acid, found in the leaves of rhubarb and other plants, is a diprotic acid. H2C2O4 + H2O ↔ H3O+ + HC2O4- Ka1= ? HC2O4- + H2O ↔ H3O+ + C2O42- Ka2 = ? An aqueous solution that is 1.05 M H2C2O4 has pH = 0.67. The free

  1. chemistry

    How many moles of H3O+ or OH- must you add per liter of HA solution to adjust its pH from 9.75 to 9.01? Assume a negligible volume change. ……….x 10………Moles of ……………………..h3O+ or OH- I got 4.6001 x 10-5 M

  2. Chemistry

    The oxidation of iodide ions by arsenic acid in acidic aqueous solution occurs according to the net reaction H3AsO4 + 3I – + 2 H3O +→ H3AsO3 + I3– + H2O. The experimental rate law for this reaction is Rate = k [H3AsO4]

  3. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.

  4. Chemistry

    In an aqueous solution the [OH–] is 2.0 x 10–6 M. What is the [H3O+]? Question 17 options: 1.0 x 10–7 M 2.0 x 10–6 M 1.0 x 10–8 M 5.0 x 10–9M

  1. Chemistry(Please respond, thank you)

    What is the [H3O+] for a neutral solution at 50 degrees celsius? I know that kw=[H3O+][OH-] but I am not sure what to do to get the H3O. The value I have for kw=5.76e-14 and I have the pH 6.62 but I do not know what the OH would

  2. Chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O -->

  3. Chem

    Calculate [H3O ], [ClO4–], and [OH–] in an aqueous solution that is 0.170 M in HClO4(aq) at 25 °C.

  4. Chemistry 2 Lab

    Calculate the degree of ionization of acetic acid in solution 1 through 3? All I am giving is the pH... pH of solution 1= 3 pH of solution 2= 3.5 pH of solution 3= 5 Then, I did this... HC2H3O2 (aq) + H2O (l) equals H3O+ (aq) +

You can view more similar questions or ask a new question.