Chemistry 1

Does anyone know what websites are good to use for Chemical Reactions and balancing equation. I have a test tomorrow, and i need to really practice those.

Thanks

  1. 👍 0
  2. 👎 0
  3. 👁 239
  1. How do i balance this equation out?

    Na2S2O2 + I2 ---> NaI+ Na2S4O6

    thank you soo much! =D

    1. 👍 0
    2. 👎 0
  2. (Broken Link Removed)

    http://chemistry2.csudh.edu/newlechelp/rxnbalancing.html

    http://misterguch.brinkster.net/eqnbalance.html

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In

  2. Chemistry

    A compound containg 3 atoms of carbon and 8 atoms of hydrogen is combined in a reaction with oxygen molecules. The two end products of this equation are carbon dioxide (CO2) and water. What element should you look at first in

  3. Chemistry

    There are about 1 x 10^5 chemical reactions per second in each of the 10 billion nerve cells in the brain. How many chemical reactions take place in a day in a single nerve cell?

  4. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on

  1. Chemistry

    Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of

  2. Chemistry

    Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In

  3. Chemistry

    Which of the following is a correct statement about collision theory? A. All collisions lead to chemical reactions. B. Most collisions lead to chemical reactions. C. Very few reactions involve particle collisions. D. Effective

  4. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

  1. science

    Octane (C8H18) is a liquid that combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the

  2. Chemistry

    Question 1. (SEE QUESTION 2 ) A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You

  3. Chemistry

    A compound containg 3 atoms of carbon and 8 atoms of hydrogen is combined in a reaction with oxygen molecules. The two end products of this equation are carbon dioxide (CO2) and water. What element should you look at first in

  4. chemistry

    a compound containing 3 atoms of carbon and 8 atoms ofhydrgen is combined in a reaction with oxegyn molecules the two end products of this equation are carbon dioxide co 2 and water what elemement should i look at first in

You can view more similar questions or ask a new question.