Chemistry-Balancing equations

posted by Anonymous

Write a single, balanced equation for the formation of ozone from the high-temperature reaction of atmospheric nitrogen and atmospheric oxygen.

  1. DrBob222

    http://www.chemistry.wustl.edu/~edudev/LabTutorials/AirQuality/Ozone.htm

Respond to this Question

First Name

Your Answer

Similar Questions

  1. chemistry

    When ammonia gas is burned in oxygen the products formed are water and nitrogen monoxide gas. Write the balanced equation showing this reaction NH4 + O2 --> H2O + NO i am stuck balancing this
  2. Help please? Chemistry

    At a certain temperature and pressure, 0.20 mol of carbon dioxide has a volume of 3.1 L. A 3.1-L sample of hydrogen at the same temperature and pressure ____. I think it's supposed to be "contains the same number of molecules" but …
  3. Chemistry

    The iodide ion can be oxidized in an acidic solution by hydrogen peroxide. One proposed mechanism for the reaction is as follows: Step 1: H2O2 (aq) + I-(aq) → H2O (l) + OI-(aq) slow Step 2: H+(aq) + OI-(aq) → HOI(aq) fast …
  4. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  5. chemistry

    A fully sealed 50m^3 room at atmospheric pressure and temperature 20C contains two ballons, one containing helium and the other containing oxygen. The balloons each have a volume of 0.5m^3 and have gauge pressure 2m of water. The balloons …
  6. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  7. Chemistry

    25cm^3 of a gas containing only nitrogen and oxygen decomposed to form 25cm^3 of nitrogen and 50cm^3 of oxygen. All the volumes were measured at the same temperature and pressure. Write an equation for the reaction.
  8. chemistry

    The pollutant NO is formed in diesel engines. The reaction fixes atmospheric nitrogen with oxygen to form NO. The reaction is: N2(g) + O2(g) = 2NO(g). If the equilibrium constant for this reaction at elevated temperatures is 5.60E-11, …
  9. Chemistry

    Liquid vitamin C, (ascorbic acid) C6H8O6 , readily reacts with atmospheric oxygen, O2, to form liquid dehydroascorbic acid, C6H6O6 and water. Explain why this is a chemical reaction. Write a balanced equation for this reaction. How …
  10. Chemistry

    NaCl [Symbol] Na + Cl2 Type of reaction: synthesis KOH + HNO3 [Symbol] HOH + KNO3 Type of reaction: double replacement Ca + S [Symbol] CaS Type of reaction: synthesis BaBr2 + Cl2 [Symbol] BaCl2 + Br2 Type of reaction: Cs2 + H2O [Symbol] …

More Similar Questions