science ap chemistry

posted by jessie

What is the equilibrium expression for the following acid dissociation reaction?
CH3COOH + H2O CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]

Respond to this Question

First Name

Your Answer

Similar Questions

  1. chemistry

    A student prepared a .10M solution of acidic acid. Acidic acid has a Ka of 1.75 x 10-3. What are the hydronium ion concentration and the PH of the solution?
  2. Chem

    Write the equation for dissocation of acetic acid in water: My Answer: CH2COOH + H2O <=> H3O+ + CH3COO- Equation for hydrolysis of acetate anion in water: My Answer: CH3COO- + H2O <=> CH3COOH + OH- Now, using the above …
  3. Chemistry

    The question says write a reaction for the ionization of the following compound in water. Identify the acid, the base, the conjugate acid, and the conjugate base in each of them. 1. H2SO4 2. KOH 3. CH3COOH 4. NH3 5. HNO3 My guesses …
  4. Chemistry 102

    For a question like “calculate the pH of an aq.solution that is 1.0 M CH3COOH and 1.0 M CH3COONa, how do you know to write the equation like this: CH3COOH + H2O => H3O+ + CH3COO- and not like H3O+ + CH3COO- => CH3COOH + H2O …
  5. Chemistry

    25.0 mL of 0.100 M acetic acid (Ka= 1.8 x 10^-5) is titrated with 0.100 M NaOH. Calculate the pH after the addtion of 27.00 mL of 0.100M NaOH. my work CH3COOH + H2O <-> H3O^+ + CH3COO^- 25mL x 0.100 mmol/ml = 2.5mmol CH3COOH …
  6. chemistry

    What is the value of [OH-] in a 0.015 M CH3COOH solution?
  7. chemistry

    What is the equilibrium expression for the following acid dissociation reaction?
  8. Chemistry

    In the equilibrium system CH3COOH(aq) + H2O(l) —> — H3O+ CH3COO-(aq) .<— Which species is present in the highest concentrations at equilibrium?
  9. Chem

    CH3COOH(aq) + H2O(l) ⇌ H3O^+(aq) + CH3COO^–(aq) [H3O^+] = 4.0 × 10^–3 M [CH3COOH] = 0.90 M What is the Ka value for the reaction?
  10. Chemistry

    6. Which of the following chemical reactions is most likely to have the largest equilibrium constant K?

More Similar Questions