Chemistry

posted by .

Is the equation of the chemical reaction that occurs when you blow your breath through boiling water?
CO2 + H2O -> H + HCO3

  • Chemistry -

    I've always written it as
    CO2 + H2O ==> H2CO3 but I wouldn't count yours wrong.
    Then the two ionizations are
    H2CO3 --> H^+ + HCO3^- and
    HCO3^- ==> H^+ + CO3^2-
    Here is a great article about CO2 which includes how it dissolves in water. Most of it is simply dissolved CO2.
    http://en.wikipedia.org/wiki/Carbon_dioxide

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    It's hydrogen carbonate, which is HCO3- Should the reactant be H2CO3?
  2. Chem

    I was given a problem that my book did not explain how to do, so I attempted to figure it out myself. Let me know if my conclusion is fallacious. Given the reactions H2O(g) + CO(g) <--> H2(g) + CO2(g), K= 1.6 FeO(s) + CO(g) <--> …
  3. Chemistry

    Does the reaction between CO2(g) + Mg(OH)2(aq) produce MgCO3(s) + H2O(l) or Mg(HCO3)2 ?
  4. Chemistry

    Write out the Ka and Kb for the biocarbonate ion with chemical equation: Would this be correct: HCO3^-(aq) <--> H+(aq) + CO3^-2(aq) Ka = [H+][CO3-2]/[HCO3- H2O + CO3-2(aq) <--> HCO3-(aq) + OH-(aq) Kb = [HCO3-][OH-]/[CO3-2] …
  5. Microbiology- Biology 205

    Can someone please help me with this question.... When you blow bubbles into a glass of water, the following reactions take place: H2O + CO2 --a--> H2CO3 --b--> H+ + HCO3- 1. What type of reaction is a?
  6. Chemistry.

    Ca(HCO3)2(s) decomposes at elevated temperatures according to the stoichiometric equation Ca(HCO3)2(s)-> CaCO3(s) + H2O(g) + CO2(g) a.) If pure Ca(HCO3)2(s) is put into a sealed vessel, the air is pumped out, and the vessel and …
  7. chemistry

    The reaction of calcium bicarbonate, Ca(HCO3)2 with hydrochloric acid, HCl, produces a solution of CaCl2, gaseous carbon dioxide, CO2, and water, H2O. Write a balanced chemical equation for this reaction and determine the volume of …
  8. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  9. chemistry

    carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= …
  10. Chemistry

    carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= …

More Similar Questions