science

posted by .

Represent this reaction with balanced chemical equation. Disilane gas (Si2H6) undergoes combustion to form solid silicon dioxide and water.

  • science -

    2Si2H6 + 7O2 = 4SiO2 + 6H2O

  • science:Chemistry -

    I was setisfy with this anser as I search in.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Convert the following into a balanced equation: Liquid disilicon hexachloride reacts with water to form solid silicon dioxide, hydrogen chloride gas, and hydrogen gas.
  2. Chemistry

    Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an …
  3. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  4. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  5. Chemistry

    1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of …
  6. Science (chemistry)

    Write a balanced chemical equation and state the reaction type for each of the following reactions: a.) nitrogen gas reacts with hydrogen gas forming ammonia (NH3) b.) carbonic acid breaks down to form carbon dioxide gas and water …
  7. science

    Octane (C8H18) is a liquid that combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing …
  8. chemistry

    Disilane gas undergoes combustion to form solid silicon dioxide and water
  9. Science

    What chemical equation would represent methane (CH4) burning in the presence of oxygen gas (O2) to form water and carbon dioxide?
  10. Chemistry

    The combustion of methanol (CH3OH) forms carbon dioxide and water vapor. A combustion reaction refers to a reaction of a substance with oxygen gas. What is the balanced equation?

More Similar Questions