chemistry

posted by .

the acid-dissociation constanstant for acetic acid
CH3COOH(aq)<->H+(aq)+CH3COO-(aq) is known to be 1.8X10^-5 at 25C

Caclulate G0f forCH3COO-(aq).
G0f=-396.56KJ/mol for CH3COOH (aq), 0 Kj/mol for H+
explain your answer

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    A student prepared a .10M solution of acidic acid. Acidic acid has a Ka of 1.75 x 10-3. What are the hydronium ion concentration and the PH of the solution?
  2. Chem

    Write the equation for dissocation of acetic acid in water: My Answer: CH2COOH + H2O <=> H3O+ + CH3COO- Equation for hydrolysis of acetate anion in water: My Answer: CH3COO- + H2O <=> CH3COOH + OH- Now, using the above …
  3. Chemistry

    Commercial vinegar was titrated with NaOH solution to determine the content of acetic acid, HC2H3O2. For 20.0 milliliters of the vinegar 26.7 milliliters of 0.600-molar NaOH solution was required. What was the concentration of acetic …
  4. chemistry

    Which of the following values corresponds to the equilibrium constant K for the dissociation of acetic acid?
  5. Chemistry

    25.0 mL of 0.100 M acetic acid (Ka= 1.8 x 10^-5) is titrated with 0.100 M NaOH. Calculate the pH after the addtion of 27.00 mL of 0.100M NaOH. my work CH3COOH + H2O <-> H3O^+ + CH3COO^- 25mL x 0.100 mmol/ml = 2.5mmol CH3COOH …
  6. chemistry

    Calculate te calue of Ksp for Ca(NO3)2 using the data below. Ba(aq) delta G0f= -561 kJ/mol NO3 (aq) delta G0f= -109 kJ/mol BaNO3 (s) delta G0f= -797 kJ/mol
  7. CHEMISTRY LAB urgent assistance

    1 (A) This relation gives the dissociation constant of acetic acid (CH3COOH) Ka = [H3O+][CH3COO-]\[CH3COOH] Starting from this relationship show that pH = pKa + log [base]\[acid] urgently need assistance
  8. Chemistry

    A solution of acetic acid, 1.0 mol L–1 CH3COOH, contains sodium acetate, NaCH3COO. The percent ionization of the above solution is 0.25%. The Ka for acetic acid is 1.8 x 10–5. Which of the following is the concentration of NaCH3COO …
  9. chemistry

    What is the equilibrium expression for the following acid dissociation reaction?
  10. science ap chemistry

    What is the equilibrium expression for the following acid dissociation reaction?

More Similar Questions