Chemistry

posted by .

Estimate the enthalpy change for the following reaction

OH(g)+CH4(g)==>CH3(g)+H2O(g)

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Calculate the work involved if a reaction with an enthalpy change of -2418 kJ is carried out in a vessel with a mobile, frictionless piston. Other details: the reaction is H2(g) + 1/2Oxygen2(g) yields H2O(g) with enthalpy change of …
  2. chemistry

    Consider the following reaction. CH4(g) + 2 O2(g) CO2(g) + 2 H2O(l) ÄH = -891 kJ Calculate the enthalpy change for each of the following cases. (a) 5.00 g methane is burned in excess oxygen.
  3. College Chemistry

    Estimate the enthalpy change for the following reaction OH(g)+CH4(g)==>CH3(g)+H2O(g)
  4. Chemistry

    Consider the following reaction. CH4(g) + 2 O2(g) CO2(g) + 2 H2O(l) ÄH = -891 kJ Calculate the enthalpy change for each of the following cases. 1.00 103 L methane gas at 719 torr and 26°C is burned in excess oxygen.
  5. Chemistry

    Reposted: Use Hess's law to calculate the enthalpy change for the reaction: 3C(s) + 3H2(g) yield C3H6(g) Given the following thermochemical equations: 2C3H6(g) + 9O2(g) yield 6CO2(g) + 6H2O(l) enthalpy change= -4116.0 kJ/mol C(s) + …
  6. chemistry

    A scientist measures the standard enthalpy change for the following reaction to be -53.4 kJ : Ca(OH)2(aq) + 2 HCl(aq) CaCl2(s) + 2 H2O(l) Based on this value and the standard enthalpies of formation for the other substances, the standard …
  7. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  8. Chemistry

    Find the enthalpy change of the following reactions 2C+2H2O---> CO2+CH4 Using the following reactions with their change in H values. C+H2O---->CO+H2 H=+131.1kjmol-1 Co+H2O---->CO2+H2. H=-41.2kjmol-1 CH4+H2O--->CO+3H2 H=15.3
  9. Chemistry

    Find the enthalpy change of the following reactions 2C+2H2O---> CO2+CH4 Using the following reactions with their change in H values. C+H2O---->CO+H2 H=+131.1kjmol-1 Co+H2O---->CO2+H2. H=-41.2kjmol-1 CH4+H2O--->CO+3H2 H=15.3
  10. chemistry

    estimate the enthalpy change for the following reaction: OF2 + H2O = O2 + 2HF

More Similar Questions