ochem

posted by .

list from strongest acid to weakest acid

HC(triple bond)CCH3
H2C=CH2
H3CNH2
CH4
H2O

i thought the order went
HC(triple)CCH3
H3CNH2
H2O
H2C=CH2
CH4

but it comes out as wrong and i don't know why >

  • ochem -

    H2O >HC(triple)CCH3 >H3CNH2 >H2C=CH2 >CH4
    I'm not sure why H2O is 1st but this is the answer i got in my sapling

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. alkanes!

    What is meant when we say that alkanes are saturated?
  2. ap chemistry

    what does H2 + CH2 form? (what product?) What is CH2?
  3. Chemistry

    Using the bond entalpies ∆H: C---C: 348kJ C=C: 612 kJ C—C (triple bond) : 960 kJ C---H: 412 kJ H---H: 436 kJ Calculate the calculate the value of ∆H of reaction for H2C=CH2(g) + H2(g) → CH3—CH3(g)
  4. Chemistry

    Im not sure where to factor in the two longer compounds for this problem. "Rank the given compounds based ontheir relative acidities" HF H2C--CH2 NH3 CH4 HC---CCH3 This is the order i thought it was, but this isnt right apparently... …
  5. chem

    rank strongest acid to weakest acid? rank strongest acid to weakest acid H3CNH2 CH3C (triple bond) CH CH2=CHCH3 H20 CH4 i tried to rank them using the Pka values but I couldn't find the pKa value of the alkyne and I thought the H3CNH2
  6. Relative Acidities

    Rank the given compounds on their relative acidity. Here was the order I thought it was but it turned out to be wrong. (i based it based off of sp being most acidic and sp3 being least acidic) STRONGEST HC(triple bond)C-CH3 H2C=CH2 …
  7. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3 …
  8. organic chemistry

    which of the following represents the best strategy for synthesizing 2-butanol, CH3CH2CH(OH)CH3 a) CH3CH=CHCH3 + [H30]+ b) CH3CH2C (triple bond) CH + [H3O]+ c) CH3CH=CH2+ [CH3OH2]+ d) CH3C (triple bond)CCH3 + [H3O]+
  9. CHEMISTRY PLEASE HELP

    Write an isomer of structure for a), b) and c) and name them. *(N.B- ! rep. a bond) a) CH3 ! CH3-CH2-C-CH2-CH3 ! CH3 CH3 ! b) CH3-CH2-CH-CH-C(TRIPLE BOND)CH ! CH2 ! CH3 c) 3,3,4-trimethyl-1-pentene
  10. chemistry

    I'm having trouble naming this organic chemistry compound. (I'm not sure how to include a picture in this, so I'll try my best to explain it in words and attempt to type it out) The full formula is C9H16. It's an alkyne and the longest …

More Similar Questions