chemistry

posted by .

What is the value of [OH-] in a 0.015 M CH3COOH solution? Ka = 1.8 x 10-5

I started by writing the equation:

CH3COOH + H2O <---> H3O+ + CH3COO-

Ka= [H3O+][CH3COO-]/[CH3COOH]= 1.8 E-5


... Now what? I don't understand where OH relates to this ...

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    A student prepared a .10M solution of acidic acid. Acidic acid has a Ka of 1.75 x 10-3. What are the hydronium ion concentration and the PH of the solution?
  2. Chem

    Write the equation for dissocation of acetic acid in water: My Answer: CH2COOH + H2O <=> H3O+ + CH3COO- Equation for hydrolysis of acetate anion in water: My Answer: CH3COO- + H2O <=> CH3COOH + OH- Now, using the above …
  3. Chemistry

    When asked to name all of the ions and molecules present in a 0.1 mol L-1 solution of CH3COOH, why are there OH- ions present if the equation is CH3COOH(aq) + H2O(l) --> CH3COO-(aq) + H3O+(aq) ?
  4. Chemistry, reactions w/ water

    Write the equation for the reaction of each of the following with water. a) HCl b) CH3COOH c) NaOH d) NH3 Are these correct?
  5. Chemistry

    The question says write a reaction for the ionization of the following compound in water. Identify the acid, the base, the conjugate acid, and the conjugate base in each of them. 1. H2SO4 2. KOH 3. CH3COOH 4. NH3 5. HNO3 My guesses …
  6. Chemistry 102

    For a question like “calculate the pH of an aq.solution that is 1.0 M CH3COOH and 1.0 M CH3COONa, how do you know to write the equation like this: CH3COOH + H2O => H3O+ + CH3COO- and not like H3O+ + CH3COO- => CH3COOH + H2O …
  7. Chemistry

    25.0 mL of 0.100 M acetic acid (Ka= 1.8 x 10^-5) is titrated with 0.100 M NaOH. Calculate the pH after the addtion of 27.00 mL of 0.100M NaOH. my work CH3COOH + H2O <-> H3O^+ + CH3COO^- 25mL x 0.100 mmol/ml = 2.5mmol CH3COOH …
  8. Chemistry

    At equilibrium, it was found that [CH3COOH] = 0.8537 M, [CH3COO-] = 0.0040 M, and [H3O+] = 0.0040 M. Calculate the acidity constant of CH3COOH and the pH value of the solution. - Please show how you solve the problem.
  9. chemistry

    What is the equilibrium expression for the following acid dissociation reaction?
  10. science ap chemistry

    What is the equilibrium expression for the following acid dissociation reaction?

More Similar Questions