chemistry

posted by .

Which of the following rate laws suggests that the reaction probably occurs in a single step?

why is this problem cant be answer a since it has order of 1

a)(CH3)3CBr + OH- →(CH3)3COH + Br- rate = k[(CH3)3CBr]

b)NO(g) + O2(g) → NO2(g) + O(g) rate = k[NO][O2]

c)H2O2 + 3 I- + 2 H+→ I3- +2H2O
rate= kl[H2O2][I-]+K2[H2O2][I-][H+]

d)H2(g) + Br2(g) → 2 HBr(g)
rate = k[H2][Br2]1/2

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    Which of the following rate laws suggests that the reaction probably occurs in a single step?
  2. Chemistry

    Ignore the dots, just put them in to line things up. 1. What is the asymmetric carbon 5...4...3..2..1 CH3-CH2-CH-CH-CH3 ........|..| CH3.CH3 2. which of the following compounds have an asymmetric carbon?
  3. Chemistry

    It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3 …
  4. Chemistry

    I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank you.
  5. CHEMISTRY

    8) The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 …
  6. chemistry

    The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 …
  7. Chemistry

    Okay, this is a question in several parts that really stumps me: Given the following reaction determine the rate of expression (CH3)3CBr + OH -----> (CH3)3COH + r [(CH3)3CBr] OH Initial reaction rate (mol L-1 sec-1) .10 .10 1.0 …
  8. Chemistry

    Which of the following rate laws suggests that the reaction probably occurs in a single step?
  9. Chemistry

    Select the most likely rate law for the following: (CH3)3C-Br + OH- > (CH3)3C-OH + Br- a. Rate=k[(CH3)3C-Br] b. Rate=k[(CH3)3C-Br][OH-] c. Rate=k[(CH3)3C-Br][OH-]2 d. Rate=k[(CH3)3C-Br]2[OH-]2 e. Rate=k[(CH3)3C-Br]2[OH-] The correct …
  10. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …

More Similar Questions