
posted by .

1) Write a balanced chemical equation for the reaction between Cu(NO3)2 * 3 H2O and NaOH. Underline the formula for the precipitate produced by this reaction. (The water of hydration in Cu(NO3)2 * 3 H2O appears as liquid water on the right side of the equation)

2) Calculate the molar masses of copper(II) nitrate trihydrate and of the precipitate formed by this reaction.

3)Calculate the number of moles of NaOh in 5.00 mL of a 1.00 M solution of NaOH.

*Please help with all questions!*

  • Chemistry -

    1. Cu(NO3)2.3H2O(aq) + NaOH(aq) --> Cu(OH)2(s) + H2O + NaNO3(aq)

    We can't underline but (s) means a solid ppt. You will need to balance it.

    2. This is a stoichiometry problem. You have worked many like it.

    3. moles = M x L.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Can someone just check this one for me? The neutralization reaction between Al(OH)3 and HNO3 produces a salt with the formula Al(NO3)3 + H2O Yes and no. It DOES produce a salt and that salt is Al(NO3)3 with the formula you have. However,
  2. chemistry

    Why is a solution of KNO3 neutral and not acidic?
  3. Chemistry, reactions w/ water

    Write the equation for the reaction of each of the following with water. a) HCl b) CH3COOH c) NaOH d) NH3 Are these correct?
  4. chemistry

    In the following half equation, which is the oxidizing agent?
  5. Chemistry

    Using the balanced reaction, enter the formula, charge(if any), and state of the species (exclude H2O) in solution if Ba(NO3)2(aq) reactant is present in stoichiometric excess. Separate your answers by comma. NaCl(aq) + Ba(NO3)2(aq) …
  6. Chemistry

    1) Write a balanced chemical equation for the reaction between Cu(NO3)2 * 3 H2O and NaOH. Underline the formula for the precipitate produced by this reaction. (The water of hydration in Cu(NO3)2 * 3 H2O appears as liquid water on the …
  7. chemistry

    Write the balanced formula equation, complete ionic equation, and net ionic equation. If no precipitate forms, write "No reaction" a) Hg2(NO3)2 (aq) + CuSO4 (aq) b) Ni(NO3)2 (aq) + CaCl2 (aq) c) K2CO3 (aq) + MgI2 (aq) d) Na2CrO4 (aq) …
  8. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …

    1. Balance the reaction below, then use it to answer the following questions. C2H2(g)+O2(g)-->CO2(g)+H2O(l) a) How many grams of oxygen are needed to make 4.84 moles of water?

    1. Consider the following reaction: Pb(NO3)2+KI--> Pbl2 +KNO3 in theis experiment, 12.0g of Kl is reacted with 20.5g of Pb(NO3)2. a) write a balanced equation for this reaction. b)identify the limiting reaction. c)calculate the …

More Similar Questions