Chemistry

posted by .

What kind of reaction is the following equation?

Ca + H20 -> Ca(OH)2 + H2 (g)

  • Chemistry -

    A single replacement.
    The single element (Ca) replaced the H in H2O.

  • Chemistry -

    Thanks!

  • Chemistry -

    IRON+SULPHUR-IRON 2 IN ROMAN NUMERALS SULPHIDE

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    Calculate the delta H for the reaction N2H4(l)+ O2(g) --> N2(g) + 2H20(l) Given the following data: 2NH3(g) + 3N20(g) --> 4N2(g) + 3H20(l) N20(g) + 3H2(g) --> N2H4(l) + H20(l) 2NH3(g) + 1/2O2(g) --> N2H4(l) + H20(l) H2(g) …
  2. college chemistry - answer check ASAP!

    The corrosion of iron can be thought of as an electrochemical cell reaction. Calculate the voltage difference between two points of corroding iron differing only in their partial pressures of oxygen: 0.20 atm of oxygen at one point …
  3. Chemistry2

    WO3 (s) + 3 H2 (g) -> W (s) + 3 H20 (g) Tungsten is obtained commercially by the reduction of WO3 with hydrogen according to the equation above. The following data related to this reaction are available. DeltaH(kilojoules/mole) …
  4. chemistry

    at standard pressure, which has the highest average kinetic energy?
  5. chemistry

    Balance the following redox reaction using the half reaction method: NaIO3+KI==> I2+H20+Na(+1)+K(+1)
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  7. AP Chemistry

    Calculate delta H fro the following equation: H20(l, 50.0 C) yields H20(s, -10.0 C)
  8. Chemistry

    use the bronsted-lowry model to label the acid-base pairs in the following equation for the ionization of water: H20(L) + H20(L) <--> H30+(AQ) + OH-(AQ). EXAPLAIN
  9. Chemistry

    AgNO3 + NaCl -> AgCl + NaNO3 Which statement about this reaction is FALSE?
  10. Chemistry

    Which statement about this reaction is FALSE?

More Similar Questions