Biology

posted by .

In the following chemical reaction, what is carbon dioxide (CO2)?

12 H20 + 6 CO2 -> 1 glucose molecule + 6 O2

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    mass-mass conversions and mass-mole conversions: what is the difference and how do you do each?
  2. bio

    5. What is meant by the term “carbon fixation”?
  3. chemistry

    Equillibrium, an example given by my textbook confused me. First it shows a reaction inside a soft drink: co2(g)--><--co2(aq) but than it says the reaction inside a soft drink would involve solubility equillibrium because it …
  4. chemistry

    How many moles of water will produced at equilibrium be if there is 1.0 mole of carbon dioxide formed at equilibrium?
  5. Chemistry

    carbon dioxide (CO2) is the gas mainly responsible for global warming (the greenhouse effect). the burning of fossil fuels is a major cause of the increased concentration of CO2 in the atmosphere. carbon dioxide is also the end product …
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  7. chemistry

    initially 1 mol each of gaseous carbon dioxide, co2(g) and hydrogen h2(g) is inhected into a 10.0L reaction chamber at 986 degrees. What is the predicted concentration of each entity at equilibrium?
  8. Chemistry

    Ok, Need some more help... This is what I have so far. 4. Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. molar mass:NH3=17 CO2=44 …
  9. Chemistry

    Ok, Need some more help... This is what I have so far. 4. Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. molar mass:NH3=17 CO2=44 …
  10. help

    Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction?

More Similar Questions