chemistry

posted by .

draw the structure of 2,4-dimethyl-3-ethyl-2-heptanol and give the molecular formula.

  • chemistry -

    okay the molecular formula is:

    (CH3)(COHCH3)(CHCH2CH3)(CHCH3)(CH2)(CH2)(CH3)

    ...the brackets represent one of the seven parent carbon atoms (hepta- informs that there are 7 of them)

    it is difficult to illustrate the structure on this post but it is exacty like in the molecular formula but with symbols and bonds represented by lines.

  • chemistry -

    We can't draw structures on the board.

  • chemistry -

    CH3-COH(CH3)-CH(CH2CH3)-CH(CH3)-CH2-CH2-CH3

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Draw the structure of the product formed by the reaction between methyl alcohol and formic acid and give the molecular formula HCOOH + HOCH3 ==> HCOOCH3 + H2O determine this molar concentration 58g of lithium in 54-ml of water molarity …
  2. Chemistry

    Draw the structure of the product formed by the reaction between methyl alcohol and formic acid and give the molecular formula?
  3. Organic Chemistry

    How do I draw the condensed formula for: 1. 2,3-dimethyl-2-butene 2. 4-ethyl-2-hexyne 3. 3,3,6-trimathylnonane 4. 3-ethyl-4-propylheptane 5. 3-octanol
  4. Chemistry

    Hey Everyone I was wondering how I could write the condensed structural formula for the following organic chemicals: 1. 2,3-dimethyl-2-butene 2. 4-ethyl-2-hexyne 3. 3,3,6-trimethylnonane 4. 3-ethyl-4-prophylheptane 5. 3-octanol 6. …
  5. chem

    A molecular compound is composed of 58.8% Xe, 7.2% O, and 34.0% F, by mass. If the molecular weight is 223 g/mol, what is the molecular formula?
  6. Chemistry

    When secondary alcohol oxidized it produces alkanes. Draw the structure of 2,2 dimethyl 3-butanol + oxygen and give the names for it.
  7. organic chem

    Hydrolysis: Draw the products of... N-ethyl-N-phenyl-2,6, dimethyl benzamide
  8. Chemistry

    Ethyl alcohol which is prent in many beverages molecular formular C2H6O.If 9.2g of ethyl alcohol are available.Calculate number of molecular of ethyl alcohol 9.2g of ethyl alcohol.
  9. chemistry quick question

    I need help with something and can't find this anywhere online. my structure looks like this OH CH2 CH3CH2CH2CHCHCH2CH3 CH3 So that OH looks like it is on a ethyl group. I need to write the IUPAC name and I wrote 3-methyl-4-heptanol …
  10. Chemistry

    I understood this at one point and now I'm confused again! :( What's the difference between 2,2-dimethyl and 2-ethyl?

More Similar Questions