Trigonometric Identities and Equations

Welcome to the "Trigonometric Identities and Equations" category on Questions LLC! This category is specifically designed to help you navigate the complex world of trigonometric identities and equations. Whether you are studying for a trigonometry exam, looking to enhance your understanding of trigonometric functions, or simply curious about the fascinating world of trigonometry, you've come to the right place. Here, you will find a wide range of questions and answers that cover various aspects of trigonometric identities and equations. So, if you're ready to unravel the mysteries of sine, cosine, tangent, and more, dive in and explore the wealth of knowledge awaiting you in this category!

Questions (48)

Given that sin(a) = 2/3 and cos(b) = −1/5, with a and b both in the interval [𝜋/2, 𝜋), find the exact values of sin(a +
1. 4 answers
2. asked by Calie
3. 1,636 views
express 10*sin*w.t in the form A*sin*w.t + B*sin*w.tIt is already in the form you want. Just set A = 10 and B = 0.
1. 1 answer
2. asked by Pablo
3. 364 views
tanx = 5/12 and sinx<0Find sin2x and cos2x How to get the answers of sin2x = 120/169 and cos 2x = 119/169?
1. 4 answers
2. asked by Amandeep
3. 1,430 views
Differentiate sin²x
1. 2 answers
2. asked by Psy
3. 72 views
Multiple Choice (theta) means the symbol 0 with the dash in it.1.)Which expression is equivalent to
1. 3 answers
2. asked by HotMath
3. 1,305 views
How do you know when to add k(2pi) or k(pi)? What's the difference?Also, for this problem, why are you supposed to use k(2pi/5)
1. 4 answers
2. asked by Anonymous
3. 1,431 views
Trigonometry Questions1. Using a compound angle formula, demonstrate that sin2π/3 is equivalent to sin π/3 2. The expression
1. 3 answers
2. asked by john
3. 1,195 views
1. Which expression is equivalent to cos 2theta for all values of theta ?cos^2 theta – sin^2 theta ~ cos^2 theta – 1 1 – 2
1. 3 answers
2. asked by Kelsey
3. 1,246 views
Find the exact value of tan 5pi/12 using the half-angle identity.
1. 3 answers
2. asked by Cynthia
3. 4,306 views
Find the value of tan2x, (pi/2)<x<pi, given secx=-5/4.So cosx=-4/5? I've no clue what to do next.
1. 4 answers
2. asked by sh
3. 562 views
Give exact answersSin(11pi/8) so this is sin(pi/4+pi/3) sin(pi/4)*cos(pi/3)+cos(pi/3)*sin(pi/4) rad2/2*1/2+1/2*rad2/2 which
1. 3 answers
2. asked by Natash
3. 1,931 views
how does sin(x)cos(3pi/2)+cos(x)sin(3pi/2) become -cos(x)?
1. 2 answers
2. asked anonymously
3. 23 views
Tan theta / 1- tan theta -cot theta /1-cot theta =cos theta + sin theta/cos theta -sin theta
1. 3 answers
2. asked by Tanya
3. 670 views
1. (2cosx-2secx)(3cosx^2+3secx^2+β)2. (16tanxsecx-4secx)/(8tanxsecx+4secx) 3.sinxcosx^3+cosx^4 (hint: GCF) 4. (cosβ+sinβ)^2
1. 4 answers
2. asked by Anna
3. 568 views
If cos A=1/3 and tan A<0,determine the value of 2sin A+tan A without the use of a calculator
1. 2 answers
2. asked by charlotte
3. 502 views
sec8A-1/sec4A-1=tan8A/tan2A
1. 3 answers
2. asked by Anonymous
3. 943 views
Given cos x=2/3 and 3pi/2<x<2pi, find the exact value of cos2x?
1. 4 answers
2. asked by Yadira
3. 1,635 views
express 3 cos x -2 sin x in th eform R cos (x + a) and hence write down the maximum and minimum values of 3 cos x - 2 sin x.
1. 2 answers
2. asked by lindsay
3. 835 views
prove:cot^2(x)=cos(x)/(sinx)(tanx)
1. 3 answers
2. asked by Help
3. 356 views
If cosx=4/5, cosy=12/13 in Quad. IV, find sin(x+y)
1. 1 answer
2. asked by Kevin
3. 346 views
cos^4 15-sin^4 15 with out using calculator
1. 1 answer
2. asked by mohamed sedeeq
3. 356 views
How can the right equation be converted into the answer on the left?(sec^4x)(tan^2x)=(tan^2x + tan^4x)sec^2x
1. 1 answer
2. asked by Misty
3. 443 views
I have to factor the expression and use fundamental identities:sins^2xcscx^2-sin^2x sec^4x-tan^4x
1. 3 answers
2. asked by Help pleaseee
3. 711 views
Given sin theta = -3/5 and 0 is in quad 2, find Cos theta and tan theta
1. 2 answers
2. asked by Betty
3. 967 views
1. if sin 2A = Psin2B,prove that tan(A+B)/tan(A-B)=P+1/P-1.
1. 1 answer
2. asked by seema
3. 429 views
Find the exact value of the expression.sin(arccos sqrt(5)/5)
1. 2 answers
2. asked by Jackie
3. 825 views
I posted this question before at 7:14I think the answer to it is 0. cot(40) - ((sin(50))/(sin(40)) = ? these are also degrees
1. 3 answers
2. asked by Amy
3. 458 views
1 + tan^2 (5) - csc^2 (85) = ?Would this equal 0 could someone explain this to me and the correct answer?
1. 2 answers
2. asked by Amy
3. 815 views
Could someone please show me how1 / ( 4 tan (x/2) + 2 ) is converted to: (- sin (x/2) /( 2 sin (x/2) + cos (x/2)) TIA Carol
1. 3 answers
2. asked by Carol
3. 373 views
find the exact value of cos 3.14/8
1. 3 answers
2. asked by ashely
3. 1,001 views
PLEASEE HELPPMEEE!!!!cot2x+sec2x=tan2x+csc2x and 1+2sinxcosx/sinx+cosx=sinx + cosx
1. 2 answers
2. asked by Sabrina
3. 657 views
I've asked about this same question before, and someone gave me the way to finish, which I understand to some extent. I need
1. 4 answers
2. asked by anonymous
3. 1,212 views
find the exact value given that cosA=(1/3) in quad I, sin B=(-1/2) in quad 4, and sin C=(1/4) in quad 2tan(B+C) ? At the end of
1. 1 answer
2. asked by stacey graham
3. 404 views
How do you find cos(sin ^-1 1.414/2)?
1. 1 answer
2. asked by Shanie
3. 314 views
Find the exact value of sec 60°tan135°-cot60°sin60°
1. 2 answers
2. asked by Jack
3. 756 views
sin^4 x (cos^2 x)=(1/16)(1-cos 2x)(1-cos4x)work one 1 side only!
1. 1 answer
2. asked by Hayden
3. 289 views
1. Give exact value of tan(theta) if cos(theta)=-2/7 and pi/2<theta<pi.2. Find the domain, range, period, and phase shift of
1. 2 answers
2. asked by Ryan
3. 580 views
If cos theta = 0.8 and 270<theta<360, find the exact value of sin 2thetaa) -0.96 b) -0.6 c) 0.96 d) 0.28 Answer: b 2) If csc
1. 6 answers
2. asked by Lucy
3. 3,339 views
We have to solve for the problem below to make sure that it is equivalent to 2csc(x). However, I keep getting 2/2sin(x) and not
1. 2 answers
2. asked by Sharon
3. 945 views
Angles A and B are located in the first quadrant. If sin a =5/13 and cos b= 3/5 , determine the exact value of cos (a+b) .
1. 4 answers
2. asked by Hyde
3. 1,275 views
find the exact value of [sec(-30 degrees)- cot 120 degrees]/1-cosec^2(45 degrees)Find the exact value of [sin^2(355 degrees) +
1. 2 answers
2. asked by lindsay
3. 667 views
A=5 sec(A)/1-4sinA.sinA +cosecA/4cosA.cosA-1 find value
1. 2 answers
2. asked by Rakesh
3. 484 views
n angle theta satisfies the relation (CSC theta)(cos theta)=-1 Give an example of information needed to determine a unique value
1. 2 answers
2. asked by ibsa
3. 512 views
Sin theta equals 5/12 in quadrant, find the exact value of cos 2theta.I'm not sure how to solve this question, I need some help.
1. 3 answers
2. asked by alyssa
3. 479 views
Sin(2x)=2sin(x)cos(x) find the exact value in radians with 2sin^2(x)+sin^2(x)=0, i really do not get this question or even how
1. 2 answers
2. asked by john
3. 474 views
If sin(x) = /45 and cos(y) = 5/13 with both x and y terminating in quadrant 1 find the exact value of cos(x-y)cos(4/5 - 5/13) Is
1. 4 answers
2. asked by Bryan
3. 454 views
If sin a + sinb + sinc = 4cosa/2cosb/2cosc/2Then sin 2a + sin2b + sin 2c = 4cosacosbcosc
1. 1 answer
2. asked by Anonymous
3. 449 views
Sin(2x)=2sin(x)cos(x) find the exact value in radians with 2sin^2(x)+sin^2(x)=0, i really do not get this question or even how
1. 1 answer
2. asked by john
3. 447 views