Questions LLC
Login
or
Sign Up
Ask a New Question
Science
Chemistry
What is the name of 12H2O and 10 H2O?
1 answer
12 is dodecahydrate and 10 is decahydrate
You can
ask a new question
or
answer this question
.
Related Questions
If 1.0 g samples of each compound were
dehydrated, which sample would lose the greatest mass of water? Molar Masses: LiCl* H2O=
Determine pH of each solution:
0.20 M KI i don't know how you know if you use.. K+H2O->KOH + H or... I- +H2O--> HIO +H Im
is KAl(SO4)2 12H2O hygroscopic, deliquescent, or efflorescent?
Which of the following chemical reactions represents a neutralization reaction?
A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl
The thermal decomposition of 1.6608 g of MgSO4 * H2O produces 1.4446 g of a
product in a well-behaved reaction. There are two
In a solution prepared by mixing CH3OH with H2O the major species pesent are
1. a. CH3+, OH, and H2O 2. b. CH3O, H+, and H2O 3.
Which of the following processes is endothermic?
a) H2O (g) --> H2O (l) b) 3O2 (g) + 2CH3OH(g) --> 2CO2(g) + 2H2O(g) c) H2O (s)
Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
Carbon dioxide (CO2) reacts with water (H2O) to form carbonic acid (H2CO3).
Which equation demonstrates the law of conservation
Thermochemistry
determine the final temperature if 45.67 kJ of heat energy is removed from 18.5 g of H2O (g) at 122 degrees