Draw the structural formula and give the IUPAC names of the following hydrocarbon.a)CH3CHBrCHBrCH(CH3)CH3
This forum does not allow us to write structural formulas. I TRIED to make it come up on Google but failed.
I'm NOT an organic chemist but I would name it
2,3-dibromo-4-methylpentane
To draw the structural formula for CH3CHBrCHBrCH(CH3)CH3, follow these steps:
1. Start with the carbon chain. The first carbon atom has three hydrogen atoms attached to it, so draw a straight line with three small lines coming out from it, representing the hydrogen atoms.
CH3-
2. The second carbon atom is bonded to the first carbon atom and a bromine atom. Draw a line connecting the second carbon to the first carbon, and another line coming out from the second carbon, representing the bromine atom.
CH3-CHBr
3. The third carbon atom is bonded to the second carbon atom and a bromine atom. Draw a line connecting the third carbon to the second carbon, and another line coming out from the third carbon, representing the bromine atom.
CH3-CHBr-CHBr
4. The fourth carbon atom is bonded to the third carbon atom and a methyl group (CH3). Draw a line connecting the fourth carbon to the third carbon, and a line branching off from the fourth carbon, representing the methyl group (CH3).
CH3-CHBr-CHBr-CH(CH3)
5. The fifth carbon atom is bonded to the fourth carbon atom and three hydrogen atoms. Draw a line connecting the fifth carbon to the fourth carbon, and three small lines coming out from the fifth carbon, representing the three hydrogen atoms.
CH3-CHBr-CHBr-CH(CH3)-CH3
The IUPAC name for this hydrocarbon is 2-bromo-3-(bromomethyl)pentane.
To draw the structural formula and name the given hydrocarbon (CH3CHBrCHBrCH(CH3)CH3), you can follow the steps below:
Step 1: Identify the main carbon chain:
Start by identifying the longest continuous chain of carbon atoms. In this case, we can see that there are six carbon atoms forming a chain: H3C - CH - Br - CH - Br - CH3.
Step 2: Number the carbon atoms:
Assign a number to each carbon atom in the chain to indicate its position. In this case, we can start numbering from either end; let's number it from left to right. The carbon atoms from left to right will be numbered 1, 2, 3, 4, 5, and 6.
Step 3: Add the substituents:
Now, take a look at the molecule again and identify any substituents that are attached to the main chain. In this case, we have two methyl groups (CH3) attached to the fourth carbon atom (C4).
Step 4: Draw the structural formula:
Using the information from the previous steps, draw the structural formula of the hydrocarbon. The structural formula for CH3CHBrCHBrCH(CH3)CH3 will look like this:
H H
| |
H3C - C - Br - C - Br - CH3
| |
CH3 CH3
Step 5: Name the hydrocarbon:
Now, let's determine the IUPAC name of the hydrocarbon.
The longest continuous chain of carbon atoms contains six carbons, which gives it the prefix "hex-."
The presence of two bromine atoms is indicated by the prefix "di-bromo."
The presence of two methyl groups attached to the fourth carbon, we use "4,4-di" prefix.
Combining these prefixes, the IUPAC name for CH3CHBrCHBrCH(CH3)CH3 is
4,4-dibromo-2,2-dimethylhexane.
So, the structural formula of the given hydrocarbon is drawn as shown above, and the IUPAC name is 4,4-dibromo-2,2-dimethylhexane.