xX_Supaman_Xx

Most popular questions and responses by xX_Supaman_Xx
  1. Physics - Electricity

    Can you please check my answers. 1) What carries energy through wire? electrons 2) What happens to some of the energy when it moves through the wire? becomes lost due to the movement of energy requiring some kinetic energy 3) If a resistance is large, why

    asked on November 24, 2007
  2. French

    What is the main linguistical difference between the phrases; 1. Je m'en vais and 2. J'y vais

    asked on December 14, 2007
  3. chem

    In the formation of sulfur hexaflouride, does the reaction at constant pressure or volume proceed more spontaneously? I've done the calcs to show that at constant volume, it is slightly more spontaneous, but I can't seem to find a good reason why... it

    asked on January 28, 2008
  4. Mathematics

    Solve the following differential equation, i.e. solve for y: dy/dx - y/x = 1/x + y + 1 I have this so far, 1. dy/dx= (y + 1 + xy + x)/x 2. x dy = (y + 1 + xy + x)dx 3. Integrate both sides... xy + c = xy + x + .5x^2y + .5x^2 + k where c and k are constants

    asked on December 29, 2007
  5. Mathematics

    Solve d/dx x(ln(x)-1) I had: =d/dx xln(x) - d/dx 1 =d/dx ln(x)^x =x^(-x-1) [and this is wrong] Can someone show me the correct answer and working please?

    asked on December 5, 2007
  6. French

    Can the words "les hommes du maison" be translated to both "the men of the house" and "the men from the house" or just one of them?

    asked on January 5, 2008
  7. drwls & Damon - maths

    hey guys, i follow you up to the point of intergrating the final line. How would I intergrate [x^-2.e^-x] dx thx

    asked on December 29, 2007
  8. Maths-Logs

    when writing log b to base a, (log-a(subscript)-b), can a be less than 0?

    asked on November 23, 2007
  9. Chem

    In thermodynaics, what is the relationship between enthalpy (H) and heat (q) - [at constant pressure]?

    asked on January 27, 2008
  10. Mathematics

    Differentiate ln(x)-1 I have d/dx lnx-1 = d/dx(ln x)- d/dx1 = d/dx(ln x) = 1/x Could you tell me if this is right or not? If not, please suggest the right working out.

    asked on December 4, 2007
  11. Reposted: Maths - Trig

    I've been told that sin(c+h)=sin(c)xcos(h)+cos(c)xsin(h) but how? please explain

    asked on December 2, 2007
  12. Maths-Trig

    How does sin(c+h)=sin(c)xcos(h)+cos(c)xsin(h) please explain

    asked on December 1, 2007
  13. Physical Chemistry

    In terms of bomb calorimetry, can one assume the temperature of the water surrounding the cmopartment is equal to the temperature within the compartment? If not, how would one determine T for the reaction occuring inside the compartment?

    asked on January 26, 2008
  14. maths

    how would i solve the differential equation dx/dt=-kx^2 i.e. solve for x as a function of t. I've been told to rearrange the equation to yield dx/x^2=-k dt but what can and should I do now?

    asked on December 14, 2007
  15. Sport - Football

    In FLAG FOOTBALL, how many players are allowed on the field at one time and what are their positions' names? Please help, I'm in Australia and Football just ain't as big as it is in some other countries.

    asked on November 21, 2007
  1. Math

    d/dx x^2+3x = 2x+3

    posted on December 5, 2007
  2. CHEM

    HOCl forms from OCl- + H+ and vice versa. the anion is hypocholrite (OCl-). Given the attaching proton is positively charged and out of O and Cl, O is more nucleophilic (Cl has the highest electronegativity), the H will attach to the O atom making the

    posted on November 10, 2007
  3. math

    see my other response

    posted on November 10, 2007
  4. math

    diameter= sqr[(6^2+(-2)^2)+(4^2+0^2)] therefore, radius= (sqr[(6^2+(-2)^2)+(4^2+0^2)])/2 = ?

    posted on November 10, 2007