Jessie

Newest questions posted by Jessie
  1. Math

    From a point A, the angle of elevation to the top of a building is 50°. From point B which is 11 m closer to the building the angle of elevation to the top is 63°. How far is point B from the top of the building? How tall is the building?
  2. Chemistry

    If the amount of gas is decreased and the temperature and pressure stay constant, what will be the effect on its volume? The volume will increase. The volume will decrease. The volume will remain the same. The volume will be reduced to zero.
  3. Algebra

    As cars passed a checkpoint, the following speeds were clocked and recorded. Speed (mph): 55 62 61 54 68 72 59 61 70 what's the range? , 1st quartile and 3rd quartile? please.
  4. College Prep

    What is the main function of an official transcript in high school? a. to reflect high school graduation credits and requirements b.to monitor attendance and behavior c. to chart standardized test scores and class grades d. to secure state and federal
  5. Math

    15 less than the product of two and r
  6. math

    A ball is dropped from a height of 18 m.On each rebound it rises 2/3 of the height from which it last fell. What distance has it travelled at the instant it strikes the ground for the 5th time?
  7. Math

    Find the least and greatest possible original numbers: ROUNDED PLACE is Ten Thousands, ROUNDED NUMBER is 190,000. What is the Least number and the Greatest number?
  8. Math 3

    Find the least and greatest possible original numbers: ROUNDED PLACE is Thousands, ROUNDED NUMBER is 1,800. What is the Least number and the Greatest number?
  9. accounting

    Please help me to get the answers for these questions in order to help my niece for their assignment answers correctly. thanks Answers as called for show computations and analyses 1.An office machine costing p 20,000 has been used for three of its eight
  10. english

    Please could you check my grammar. thanks 1.Other Color Print Price, depending on the image’s size
  11. English

    Please help correct my answers for potential interview. what are your strenghts and weaknesses? my greatest strengths is i always completed a multi tasks a head the deadline. my weaknesses is being a perfectionist on myself i always make sure that every
  12. english

    Pleaese correct my answers on the potential interview for telll me about yourself. i'm 48 years old, previously i have been working abroad in k.d.s as photolab operator since 1993-2003. i completed a training course in caregiver may 2003. from 2006-2015 i
  13. english

    please help me to correct my anserw below: 1. Shhhh! Be quiet! John (sleep) _____. He might hear us from the other room. 1.sleeps 2.will sleep 3.is sleeping 4.have been sleeping ans.3 2. You look great! (you, exercise) _____ at the fitness center? 1. Are
  14. Math

    126 is the product of 7 and Victor's savings. Use the variable v to represent Victor's savings.
  15. english

    please kindly help if my answers below are coorect.thank you . Teacher: So you want to learn _____ English? 1. To Talk 2.Talking 3.Speaking 4.To Speak ans. 3 2. Student: Yes, I want to be able to speak _____. 1.Good 2.Goodly 3.Proper 4.Well ans. 4 3.
  16. english

    Please help me to correct my answers below.let me know the correct answers. thank you 1. Justin (write) _____ his speech for the presentation now. I hope he finishes it before we meet. 1. is writing 2.will write 3.writes 4.has been writing ans.3 2. The
  17. english

    Please help me to correct my anserw below.thank you Petroleum, or crude oil, is one of the world's (1) _____ natural resources. Plastics, synthetic fibres, and (2) _____ chemicals are produced from petroleum. It is also used to make lubricants and waxes.
  18. english

    Please help if my answers are correct and let me know the correct answers below. thank you. Can we see (1) _____ the earth is a globe? Yes, we can. When we watch a ship that sails out to sea, we can see that the ship begins (2) _____. The bottom of the
  19. english

    Please help me to correct my answers below.let me know the correct answers. thank you 1. Justin (write) _____ his speech for the presentation now. I hope he finishes it before we meet. 1. is writing 2.will write 3.writes 4.has been writing ans.2 2. The
  20. english

    please kindly help if my answers below are coorect.thank you . Teacher: So you want to learn _____ English? 1. To Talk 2.Talking 3.Speaking 4.To Speak ans. 2 2. Student: Yes, I want to be able to speak _____. 1.Good 2.Goodly 3.Proper 4.Well ans. 1 3.
  21. Math

    what is the recursive rule for the sequence -7.4, -21.2, -35, -48.8, -62.6 an=an-1+13.8 an=an+1+13.8 an=an+1-13.8
  22. Physics

    an 1100 kg car accelerates from rest at 3.4 m/s2. if the horizontal force exerted on the wheels by the road is 5600 N, what force must be resisting the motion of the car? use a free body diagram to illustrate your answer.
  23. Help: biology

    1. You have in front of you three vials containing a clear liquid. You are told that each vial contains one of the following carbohydrates: Fructose, Sucrose, Amylose. What experiments could you carry out to determine the composition of each vial. What
  24. Molecular bio

    Which of these sugar(s) would contain amylose? (*I looked it up but there wasn't a clear answer* ) Glucose Fructose Sucrose Lactose Starch -This one is amylose because it's a long chain. What about the other four?
  25. chemistry

    You measure out 3.00 mL of 0.100 M Co(NO3)2, place it in a test tube and add 7.00 mL of water. What is the concentration of the diluted solution in the test tube?
  26. chemistry

    In an experiment designed to determine the concentration of Cu+2 ions in an unknown solution, you need to prepare 100 mL of 0.10 M CuSO4 as your stock solution. How many grams of CuSO4(s) should you use?
  27. math

    A hotel gives every customer who makes a reservation a confirmation code. How many different confirmation codes can be created if each code has 4 letters followed by 2 numbers?
  28. Geometry

    A diagonal of a square has the same length as a diagonal of a rectangle. The area of the rectangle is 60% of the area of the square. What is the ratio of the shorter side to the longer side of the rectangle? Write your answer as a common fraction (or an
  29. chemistry

    The reaction 2 NO(g) + O2(g) --> 2 NO2(g) is important in forming smog. Under certain conditions, the rate law for a the reaction is rate = 4.0 x 10-3 1/M2*s * [NO]2* [O2] What is the rate when [NO]=0.020 M and [O2]=0.035 M? a. 5.6 x 10-2 M/s b. 9.8 x 10-5
  30. chemistry

    Calculate the concentration of KIO3(aq) present at the beginning of a reaction when 2.00 mL of 0.020 M KIO3(aq) is mixed with 8.00 mL of other solutions so the initial volume for the reacting mixture is 10.00 mL.
  31. chemistry

    Consider the reaction: N2(g) + 3 H2(g) --> 2 NH3(g). At a particular time, the nitrogen is being consumed at a rate of 0.60 moles/sec. At this same time, what is the rate at which ammonia is being formed? a. 3.0 mol/s b. 0.12 mol/s c. 0.30 mol/s d. 2.0
  32. chemistry

    The rate of a reaction A + 2B --> products is determined. When the concentration of A is 1.0 M, the rate of the reaction is 0.50 M/s. When the concentration of A is 0.50 M, the rate is 0.25 M/s. From this data, you can determine: a. that the reaction is
  33. chemistry

    In a reaction, a chemist is observing the absorbance of CoCl2(aq) as a function of time to determine the rate at which it is being consumed in a reaction. At time t=10 s, the chemist determines that the concentration of CoCl2(aq) is 0.12 M. At time t=20 s,
  34. Math

    Whuch of the following expressions is equivalent to the expression below? 4[5x+2-x]
  35. stat

    In an extensive study involving thousands of British children, Arden and Plomin (2006) found significantly higher variance in the intelligence scores for males than for females. Following are hypothetical data, similar to the results obtained in the study.
  36. Social Studies

    what did hatshepsut do as pharaoh of Egypt?
  37. math

    2 1/8 divided by 3 1/4= a.68/104 b.221/32 c.17/26 d.6 29/32
  38. Spanish

    Instructions: Modifique el párrafo por cambiar las palabras entre comillas al tiempo FUTURO. Modelo: Mi familia ‘va a visitar’ a nuestros abuelos este verano. Mi familia visitará a nuestros abuelos este verano. 1. Este año ‘vamos a hacer’ una
  39. Pre Cal help please!!

    given f(x) = { 2x^2 + 5 x < or equal to 2 3 - x^2 x > 2 find lim f(x) x -> 2^+ lim f(x) x -> 2^- lim f(x) x -> 2
  40. Chemistry AP

    The equilibrium constant for the formation of phosphorus pentachloride is 1.9. If the partial pressure of each gas is 0.5 atm, will the reaction (as written) proceed forward or backward to reach equilibrium? PCl3(g) + Cl2(g) PCl5(g) A. Forward, because K
  41. ap chemistry

    Which of the following statements about the pH scale is not true? A. In a pH expression, the hydronium ions, H3O+, can be abbreviated simply as H+. B. A solution with a pH of 4 has twice the [H+] of a solution with a pH of 2. C. The pH scale is based on a
  42. ap chemistry

    When are more products of a reaction available initially than at equilibrium? A. K = 0 B. Q < K C. Q = K D. Q > K
  43. chemistry

    When are more products of a reaction available initially than at equilibrium? A. K = 0 B. Q < K C. Q = K D. Q > K
  44. chemistry

    Given the following solubility constants, which list arranges the solutes in order of increasing solubility? CaCO3: Ksp = 2.8 × 10-9 Ca(OH)2: Ksp = 5.5 × 10-6 CaSO4: Ksp = 9.1 × 10-6 CaF2: Ksp = 5.3 × 10-9 A. CaSO4 < Ca(OH)2 < CaCO3 < CaF2 B. CaSO4 <
  45. chemistry

    Given the equilibrium concentrations in the table, what is the equilibrium constant for the synthesis of ammonia at this temperature? 3H2(g) + N2 2NH3(g) A. 0.0035 B. 0.014 C. 0.066 D. 0.017
  46. chemistry

    What change do you expect if the value of the reaction quotient is greater than the value of the equilibrium constant? A. The rate of the forward reaction is greater than the rate of the reverse reaction. More reactant forms. B. The rate of the forward
  47. chemistry

    Which of the following is true about the results of a neutralization reaction? A. An acid and a base form water and salt. B. Water reacts with a base to form the hydroxide ion. C. Water reacts with an acid to form the hydronium ion. D. An acid and a base
  48. chemistry

    What does a buffer do? A. It resists a change in pH when H+ or OH- is added to a solution. B. It prevents an acid-base reaction from happening. C. It prevents an acid or base from being neutralized. D. It prevents a salt from forming in solution.
  49. chemistry

    Why is HCl required in the stomach? A. To transport proteins into the small intestines B. To help absorb other acids in the stomach C. To catalyze the digestion of carbohydrates D. To aid in the digestion of proteins
  50. chemistry

    The [OH-] ion concentration of a sample is 1 × 10-10 M. What is the concentration of [H+] in the sample at 25°C? A. 1 × 10-14 M B. 1 × 10-4 M C. 1 × 10-10 M D. 1 × 10-6 M
  51. chemistry

    Which of the following chemical reactions represents a neutralization reaction? A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl C. NH3 + H2O NH4++ OH- D. CH3COOH + H2O CH3COO- + H3O+
  52. chemistry

    Which of the following is true about the results of a neutralization reaction? A. An acid and a base form water and salt. B. Water reacts with a base to form the hydroxide ion. C. Water reacts with an acid to form the hydronium ion. D. An acid and a base
  53. chemistry

    What is the general form for the simplest type of acid-base reaction? A. acid + base salt + water B. acid + base base + acid C. acid + base H+ + OH- D. acid + base solid + water
  54. chemistry

    A, B, C, and D are 4 salts whose Ksp values are 9.21 × 10-8, 7.44 × 10-11, 1.07 × 10-21, and 38.65, respectively. What is the correct arrangement of their solubilities in decreasing order? A. D, A, B, C B. C, B, A, D C. A, B, D, C D. C, B, D, A
  55. chemistry

    Acetic acid is known to be a weak acid. What will happen to the acidity of the solution when sodium acetate is added to acetic acid? A. The solution will become more acidic. B. The pH will remain the same. C. The solution will become less acidic. D. The
  56. chemistry

    Which of the following bases could you write an equilibrium expression for? A. Ba(OH)2 B. KOH C. NaOH D. NH3
  57. chemistry

    During a chemical reaction, if Q = K, what can be said about the reaction? A. The reaction still proceeds in both directions, but the net result is that the reactant and product concentrations do not change. B. The amount of product is always equal to the
  58. chemistry

    Which of the following is true of the solubility product constant? A. It is the product of the initial concentrations of the ions in a solution. B. It is an equilibrium constant. C. It is an equilibrium position. D. Its value changes in the presence of a
  59. chemistry

    Which equation would describe the following equilibrium constant? Kc = [Bi3+]2[S2-]3 A. Bi2S3(s) + 6HCl(aq) 2BiCl3(aq) + 3H2S(aq) B. Bi2S3(s) 3Bi2+(aq) + 2S3-(aq) C. BiS(s) Bi3+(aq) + S2-(aq) D. Bi2S3(s) 2Bi3+(aq) + 3S2-(aq)
  60. chemistry

    What happens to the following reaction at equilibrium if the pressure is decreased? 2H2(g) + O2(g) 2H2O(g) A. The equilibrium shifts left because Q < K. B. The equilibrium shifts right because Q < K. C. The equilibrium shifts right because Q > K. D. The
  61. chemistry

    What is the equilibrium expression for the change when iron(II) chloride dissolves? FeCl2(s) Fe2+(aq) + 2Cl-(aq)
  62. science ap chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]
  63. math homework

    use the limit process to find the slope of the graph of 'square root' x+8 at (8,4) a. 4 b. 1/4 c. the slope is undefined at this point d. 1/8 e. infinity
  64. math

    solve the system of equations for x and y { x^2 - 11x -y =-24 x^2 - 11x + y = -24
  65. maths

    evaluate the expression (94) (93) a. 94 b. 93 c. 1 d. 88 e. -5
  66. maths

    find the area of the parallelogram that has the vectors as adjacent sides u = -2i + j + 5k v = 4i - 3j - 3k a. 11 b. squareroot 26 c. 86 d. 2 squareroot 86 e. 1
  67. math homework help please?!!

    determine lim f(x) x -> 1 where f(x) = { 13 - x^2, x < or equal to 1 11 - x, x > 1 a. 11 b. limit does not exist c. 13 d. 10 e. 12
  68. Rainy can you help me with this question?!

    find the values of x and y that will make the matrix equal [x y] 1 9 = [3 5] 1 9 the answer options are a. x=-3 y=-5 b. x=5 y=3 c. x=-3 y=5 d. x=3 y=5 e. no solution
  69. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]
  70. chemistry

    A reaction has an equilibrium constant very much less than 1. Will the reaction proceed spontaneously? A. Yes, because products are favored and deltaG° < 0. B. Yes, because reactants are favored and deltaG° > 0. C. No, because reactants are favored and
  71. chemistry

    If the equilibrium constant is much less than 1, how can you tell where the equilibrium lies? A. Reactants are in the numerator of the equilibrium expression, so equilibrium lies toward the reactants. B. Products are in the numerator of the equilibrium
  72. chemistry

    What information does an equilibrium constant give about a reaction? A. It tells how long it takes the reaction to reach equilibrium. B. It tells how much energy is required for the reaction to happen. C. It tells what the rate constant of the reaction is
  73. chem

    Under constant pressure, a system of gases is sealed in a cylinder and then allowed to expand. What can you conclude about the work associated with this change? A. Work is negative and is done to the system. B. Work is negative and is done by the system.
  74. chem

    Knowing what information would allow you to order gas molecules according to their velocity? A. Pressure and temperature B. Volume and molecular mass C. Pressure and volume D. Temperature and molecular mass
  75. science

    Which of the following terms are present in the rate law? A. The rate constant, the concentration of the reactants, and the order of the reactants B. The rate constant and the concentration of the reactants C. The rate constant and the temperature of the
  76. please help with this trigonometric identity!

    verify this trigonometric identity cos 'a' - cos 'b' / sin 'a' + sin 'b' + sin 'a' - sin 'b' / cos 'a' + cos 'b' = 0 please help me with this! i don't know how to do it!
  77. Chem

    Knowing what information would allow you to order gas molecules according to their velocity? A. Pressure and temperature B. Volume and molecular mass C. Pressure and volume D. Temperature and molecular mass
  78. chemistry help?!

    Which properties result from minimal interactions between molecules in a gas? A. A characteristic geometric shape and limited particle motion B. A random shape, limited particle motion, and inability to be compressed C. A random shape, significant particle
  79. chemistry help

    How do forces determine the shape of a protein? A. The covalent bonds in the protein determine the shape of the protein. B. The protein folds into complex shapes through intermolecular forces. C. Polar parts of a protein are repelled by water. D.
  80. them

    How do intermolecular forces determine the vapor pressure of a liquid? A. A nonpolar compound has a low vapor pressure because of London dispersion forces. B. A compound that can form hydrogen bonds has a low vapor pressure. C. A polar compound has a high
  81. Chem

    Which of the following statements is (or are) true? I Hydrogen bonds occur between two hydrogen atoms. II Hydrogen bonding occurs between a hydrogen atom and an oxygen atom within a molecule. III Hydrogen bonding requires a molecule containing a large
  82. chemistry help?!

    Which statement correctly pairs the order of a reaction with the units for the rate constant? A. third order; s/M B. zero order; 1/(M2) C. second order; 1/(M•s) D. first order; 1/M
  83. chemistry help?!

    Which of the following terms are present in the rate law? A. The rate constant, the concentration of the reactants, and the order of the reactants B. The rate constant and the concentration of the reactants C. The rate constant and the temperature of the
  84. Steve help please?!?!

    How many moles of oxygen are produced from the decomposition of 36.7 g of dinitrogen pentoxide? 2N2O5 4NO2 + O2 A. 3.19 mol B. 0.340 mol C. 0.170 mol D. 5.44 mol Hi Steve, I posted this question the other day but really don't know how to answer it. Can you
  85. chemistry

    Which of the following terms are present in the rate law? A. The rate constant, the concentration of the reactants, and the order of the reactants B. The rate constant and the concentration of the reactants C. The rate constant and the temperature of the
  86. Science - Chemistry

    If the rate law of a chemical reaction is k[NH4+]2[NO2–], what is the order of the reaction? 1. The order of the reaction cannot be determined. 2. 3 3. 1 4. 2
  87. Chem

    During which stroke of a four-stroke internal combustion engine is the system's temperature raised because work is done to the gases? A. Compression stroke B. Power stroke C. Exhaust stroke D. Intake stroke
  88. Chem

    _____________ are a type of intermolecular force that _____________ . A. London forces; occur between permanent dipoles B. London forces; are the attractive forces between all molecules due to instantaneous dipoles C. Hydrogen bonds; are weaker than
  89. Them

    How many moles of oxygen are produced from the decomposition of 36.7 g of dinitrogen pentoxide? 2N2O5 4NO2 + O2
  90. Calculus

    What are the zeroes of the polynomial equation, 𝑦 = 𝑥3 + 3𝑥2
  91. Chemistry

    An antifreeze solution is prepared containing 40.0 g of ethylene glycol (molar mass = 62.0 g/mol) in 60.0 g of water. Calculate the freezing point of this solutions A.-20.1°C B.0.518°C C.20.1°C D.120.1°C
  92. math

    what is 875 multiplied by 3/2?
  93. World History

    Winning which World War II battle allowed the Allied forces to protect strategic locations for trade and resources in the Mediterranean region? Battle of El Alamein**** Battle of Stalingrad Battle of Britain Battle of Midway
  94. Chemistry

    How many grams of sodium sulfate na2so4 must be added to make 500ml of a 12.5 M sodium sulfate solution
  95. English II

    From the three windows, through the cracks of the old wooden shutters, came only a few scattered sunbeams which, in the midst of the obscurity, made a soft brightness that bathed surrounding objects in a diffused and tender light. Which word, if
  96. English II

    Standing before the press which faced the windows, Dr. Pascal was looking for a paper that he had come in search of. With doors wide open, this immense press of carved oak, adorned with strong and handsome mountings of metal, dating from the last century,
  97. English II

    Marc Antony's Speech from Shakespeare's Julius Caesar Friends, Romans, countrymen, lend me your ears; I come to bury Caesar, not to praise him. The evil that men do lives after them; The good is oft interred with their bones; So let it be with Caesar. The
  98. English II

    Friends, Romans, countrymen, lend me your ears; I come to bury Caesar, not to praise him. The evil that men do lives after them; The good is oft interred with their bones; So let it be with Caesar. The noble Brutus Hath told you Caesar was ambitious: If it
  99. English II

    Read the following passage and answer the questions that follow: Doctor Pascal by Emile Zola In the heat of the glowing July afternoon, the room, with blinds carefully closed, was full of a great calm. From the three windows, through the cracks of the old
  100. English II

    from "The Lady of Shalott" by Alfred, Lord Tennyson In the stormy east-wind straining, The pale-yellow woods were waning, The broad stream in his banks complaining, Heavily the low sky raining Over tower'd Camelot; Down she came and found a boat Beneath a

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6