Ask questions and get helpful responses.

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the molecular

84,262 results
  1. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing
  2. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing
  3. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O
  4. chemistry

    Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
  5. Chemistry - please help

    1. Write the balanced chemical equation for the single displacement reaction of magnesium and sodium thiosulfate. Is this right? 6Mg + (S*2*O*3)*2 -> 6MgO + 2S*2 2. Write the balanced chemical equation for the double displacement reaction of hydrogen
  6. Science

    When sodiun is placed in water,it reacts violent to produce hydrogen gas and form sodium hydroxide solution. write a balanced chemical equation for this reaction
  7. Chem 3A

    please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?
  8. Chemistry

    1a). If you react 16 mol A with 15 mol B in the reaction 4A + 3B → 2C, what is the limiting reactant? 1b). What is the theoretical yield of product C in mol? 3a.) If Pb(NO3)2 were the limiting reactant in this reaction: Pb(NO3)2(aq) + 2KI(aq) → PbI2(s)
  9. chemistry

    Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
  10. chemistry

    What is the difference between biochemical, pharmaceutical, and diagnostic chemical reactions in healthcare? What is a specific example that exists for each of these chemical reaction types above and why might it be of importance to healthcare
  11. chemistry

    sodium metal reacts with hydrogen gas to yield solid sodium hydride ( NaH ). A reaction mixture contains 10.00 g sodium metal and 0.235 g of hydrogen gas. write a balanced chemical equation for this reaction? what is your limiting reactant? what is your
  12. Chemistry

    In the reaction of 2.75 g of magnesium metal with excess hydrochloric acid, what volume of hydrogen gas will be produced by the reaction if the lab occurs at 25.0oC and 765 torr? (Hint: write a balanced chemical reaction first and do stoichiometry, then
  13. Chemistry

    What type of reaction may be occurring when a person's skin develops a green stain beneath a 14 K gold bracelet? Using HA as the chemical formula for acid in skin, write a balanced chemical equation to represent the reaction.
  14. chem help

    i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation for: sodium sulfate
  15. Chemistry

    Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical equation. Identify all
  16. chemistry

    Based on the following chemical equation, answer the questions below. Show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide is as follows: H2S(g)+I2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced
  17. Chemistry

    Based on the following chemical equation answer the question below show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide h2s(g)+i2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams
  18. Chem Help!

    I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide forms from hydrogen and
  19. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to ΔHf° [NH3(g)]
  20. chemistry

    Consider the following reagents: zinc, copper, mercury (density: 13.6 g/mL), silver nitrate solution, nitric acid solution. a. Given a 500-mL Erlenmeyer flask and a balloon can you combine two or more of the foregoing reagents to initiate a chemical
  21. chemistry

    Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
  22. chemistry

    Hydrogen cyanide (HCN) is a poisonous chemical that is used in the extraction of gold. It is produced by the reaction of ammonia (NH3) and methane (CH4), and hydrogen gas is a by-product of the reaction. Write the balanced equation for this reaction, and
  23. Chemisry

    Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical equation. Identify all
  24. Chemistry

    A student claims that the reaction of hydrogen and oxygen to form water is evidence supporting the claim that mass is conserved in a chemical reaction. The chemical equation the student uses for the reaction is H2 + O2 --> H2O. Does this evidence support
  25. chemistry

    A student claims that the reaction of hydrogen and oxygen to form water is evidence supporting the claim that mass is conserved in a chemical reaction. The chemical equation the student uses for the reaction is H2 + O2 --> H2O. Does this evidence support
  26. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to and defined by the quantity dHformation [NH3(g)] N2(g) + 3H2(g) --> 2NH3(g) Is that all the question is asking for?
  27. Chemistry

    When iron metal reacts with oxygen, the reaction can form Fe2o3 (numbers are subscripts). Write a balanced chemical equation for this reaction and find the number of moles of oxygen that are needed to form 6 mol of Fe2o3. Show your work. I am really stuck
  28. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this happen? Thanks. Oh and what is
  29. Chemistry

    Hello, I really don't understand how to find the grams of moles in some of these reactions. If someone could help I would appreciate it. 1) Balance the following chemical reaction and determine the number of moles of HI produced when 2.33 moles of H2(g)
  30. chemistry

    In a sealed vessel xenon tetrafluoride, XeF4, reacts with hydrogen gas to give xenon gas and hydrogen fluoride gas. What is a balanced chemical equation, including state symbols, for this reaction. thankyou.
  31. Chemistry

    Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the
  32. Chemistry

    Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide
  33. chemistry

    Question: When a pink aqueous solution of potassium permanganate, faintly acidified with dilute sulfuric acid was treated with 10% aq. hydrogen peroxide, the reaction took place with the evolution of gas bubbles, and the pink solution was turned colorless.
  34. Cemistry

    Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the
  35. URGENT AP CHEM HELP!!

    Write 2-3 sentences describing and identifying the type of chemical reaction that occurs when Fe2+ reacts with potassium permanganate (KMnO4) and specifying the type of solution required for the reaction to occur. b. using standard reduction potential
  36. Calculus

    A chemical reaction proceeds in such a way that after the first second, the amount of a certain chemical involved in the reaction changes at a rate that’s inversely proportional to the product of the mass of the chemical present (in grams) and the time
  37. Chemistry

    I've worked through this problem so many times and I keep getting the same thing yet when I submit it, it says its wrong.. Am I missing something? Q:Calcium hydride (solid) reacts with water to form calcium hydroxide (aqueous) and hydrogen gas. Write a
  38. chemistry

    decomposition of water to form elemental Hydrogen and Oxygen gas. What will be the balanced chemical equation, type of reaction and the driving force of the reaction?
  39. Calculus Please Help

    A chemical reaction proceeds in such a way that after the first second, the amount of a certain chemical involved in the reaction changes at a rate that’s inversely proportional to the product of the mass of the chemical present (in grams) and the time
  40. Chemistry

    A student claims that the reaction of hydrogen and oxygen to form hydrogen peroxide is evidence supporting the claim that mass is conserved in a chemical reaction. The chemical equation the student uses for the reaction is H2 + O2 --> H2O2. Does this
  41. physical science

    When iron metal reacts with oxygen, the reaction can form Fe2O3. Write a balanced chemical equation for this reaction, and find the number of moles of oxygen that are needed to form 6 mol of Fe2O3. Show your work.
  42. chemistry unit 7 oxidation

    1). Match each picture or equation with the correct type of reaction. Each type of reaction will be used 2 times. Column A Column b 2).Which phrase best describes a redox reaction? a). a chemical reaction involving the transfer of electrons from one
  43. Calculus

    A chemical reaction proceeds in such a way that after the first second, the amount of a certain chemical involved in the reaction changes at a rate that’s inversely proportional to the product of the mass of the chemical present (in grams) and the time
  44. AP Chem

    Redox Titrations: a. write 2-3 sentences describing and identifying the type of chemical reaction that occurs when Fe2+ reacts with potassium permanganate (KMnO4) and specifying the type of solution for the reaction to occur. b. using a standard reduction
  45. satp conditions

    Calcium hydride reacts with a vast excess of water to form calcium hydroxide and hydrogen gas. (See the periodic table.) (a) Write a balanced chemical equation for the reaction. (Use the lowest possible coefficients. Include states-of-matter under SATP
  46. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on the oxidation states for
  47. Chemistry

    When a mixture of 13.0 g of acetylene (C2H2) and 13.0 g of oxygen (O2) is ignited, the resultant combustion reaction produces CO2 and H2O. A)Write the balanced chemical equation for this reaction. B)Which is the limiting reactant? Express in chemical
  48. Chemistry (Stoichiometry)

    Magnesium powder reacts with steam to form magnesium hydroxide and hydrogen gas. a) Write a balanced chemical equation for this reaction. b) What is the percentage yield if 10.1g Mg reacts with an excess of water and 21.0g Mg(OH)2 is recovered? c) If 24g
  49. Chemistry

    Write balanced chemical equations for all transferals of the compounds from organic to aqueous phases and for all precipitation reactions. **Note: If a compound does not move from one layer to another, no reaction has occurred, and no equation can be
  50. Chemistry

    In a reaction chamber, 3.0mol of aluminum is mixed with 5.3mol Cl2 and reacts. The reaction is described by the following balanced chemical equation. 2Al + 3Cl2 ==> 2AlCl3 a)Identify the limiting reagent for the reaction. b)Calculate the number of moles or
  51. Chemistry (Help)

    For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each
  52. Chemistry

    in a neutralization reaction, dilute tetraoxosulphate (vi) acid completely reacted with sodium hydroxide solution.write a balanced chemical equation for the reaction
  53. Science (chemistry)

    Write a balanced chemical equation and state the reaction type for each of the following reactions: a.) nitrogen gas reacts with hydrogen gas forming ammonia (NH3) b.) carbonic acid breaks down to form carbon dioxide gas and water c.) aluminum foil reacts
  54. Chemistry

    Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it
  55. Chemistry

    1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it
  56. science

    Hydrogen Cyanide (boiling temperature 26 degrees Celsius) is an important chemical for the production of nylon and various transparent plastics. It is produced on an industrial scale by the oxidation of methane in the presence of ammonia. The equation
  57. Chemistry

    A sample of magnesium metal reacts with hydrochloric acid solution to produce magnsesium chloride solution and hydrogen gas. a)write a balanced chemical equation for this reaction and include phase designations. The phase designations would be s for solid,
  58. Chemistry

    A sample of magnesium metal reacts with hydrochloric acid solution to produce magnsesium chloride solution and hydrogen gas. a)write a balanced chemical equation for this reaction and include phase designations. The phase designations would be s for solid,
  59. Chemistry

    Nitric acid is a component of acid rain that forms when gaseous nitrogen dioxide pollutant reacts with gaseous oxygen and liquid water to form aqueous nitric acid. Write a balanced chemical equation for this reaction. Express your answer as a chemical
  60. chemistry

    Need Help Finishing: Purpose: • To observe a chemical reaction. Materials: • Vinegar (acetic acid, CH3COOH) • Baking soda (NaHCO3) • Measuring cups and spoons • Cup Procedure: 1. Place ½ cup of vinegar in the cup. 2. Add 1 tablespoon on baking
  61. Chemistry

    Identify the following chemical equations by type. 1. If an electric discharge produces 800 cm3 of ozone (O3), how many cm3 of oxygen (O2) are required? 3O2(g) ---> 2O3(g) 2. When 75.0 dm3 of O2 react with an excess of glucose (C6H12O2), according to the
  62. chemistry

    write the balanced chemical equation for the reaction that would occur ewhen a base is added to a solution containing H2PO4-/HPO4^2- buffer system can you please help we write this balanced equation. thank you
  63. Chemistry

    how do you write a chemical equation with this reaction? can u help me solve these 1.Liquid carbon disulfide reacts with oxygen gas, producing carbon dioxide gas and sulfur dioxdie gas. 2. Solid zinc and aqueous hydrogen sulfate reacts to produce hydrogen
  64. chemistry

    What is the balanced chemical equation of Shampoo? And what is the chemical reaction of it? Please i need a help ASAP! Thank you!
  65. chemistry

    Using the balanced chemical equation and the initial mass of magnesium calculate the mass of hydrogen gas that should be produced when the reaction is complete Balanced Chemical equation: Mg(s)+2HCI(aq)=MgCl_2+H_2Mg(s)+2HCI(aq)=MgCl2 +H2 ​Mass of
  66. chemistry 20

    A student mixed a solution of aqueous calcium chloride with an aqueous solution of magnesium sulphate. A precipitate formed. 1) Write the balance chemical equation for the reaction including states of matter. Ensure you write the reactants as a dissociated
  67. chemistry

    Reacting Mg with acid solution to form Mg salt and Hydrogen gas. What are the: 1.general reaction type 2. Chemical equation include phase 3. complete ionic equation include phase 4. chemical equation for the reaction between magnesium with water
  68. Chemistry

    The electrolysis (decomposition) of water produces hydrogen gas at the rate of 30.0 mL/min. A) Write a balanced chemical equation for this reaction and include phase designations. 2H2O(aq)---> 4H2(g)O2(g) Is whatever I've done above correct? B) What volume
  69. Chemistry

    I'm about to do the second part of a Limiting Reagent laboratory tomorrow. There are a few questions that are giving me trouble on the pre-lab assignment. In the first lab period, we measured the amount of H2 gas produced in a reaction of Mg and 10 mL of
  70. Chemistry (just need someone to check my answer)

    When iron metal reacts with oxygen, the reaction can form Fe2O3. Write a balanced chemical equation for this reaction, and find the number of moles of oxygen that are needed to form 6 mol of Fe2O3. My answer: 9 moles of oxygen
  71. chemistry

    Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated.
  72. chemistry

    Answer the following questions based on the following electrochemical reaction: Al(s) + Cu 2+(aq) Cu(s) + Al3+ (aq) Write the balanced chemical equation for this cell. I'm confused.. how would this be balanced?
  73. Chemistry

    Liquid vitamin C, (ascorbic acid) C6H8O6 , readily reacts with atmospheric oxygen, O2, to form liquid dehydroascorbic acid, C6H6O6 and water. Explain why this is a chemical reaction. Write a balanced equation for this reaction. How many mole of oxygen gas
  74. Chemistry

    Write a balanced chemical equation for nitrogen gas reacts with oxygen gas to produce nitrogen dioxide gas
  75. chem

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction.
  76. Chemistry

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction. I'm not
  77. chemistry

    An explosive whose chemical formula is C3H6N6O6 produces water, carbon dioxide, and nitrogen gas when detonated in oxygen. write the chemical equation for the detonation reaction of this explosive.
  78. Chemistry

    Answer the following question: In a space shuttle, the CO2 that the crew exhales is removed from the air by a reaction within canisters of lithium hydroxide. Let's assume that one astronaut exhales about 537. L of CO2 daily. What mass of water will be
  79. chem

    Which purpose is served by an unbalanced chemical equation versus a balanced chemical equation? (1 point) An unbalanced chemical equation demonstrates a general reaction that occurs between several compounds. A balanced chemical equation demonstrates the
  80. AP Chemistry

    Hydrogen gas is blown over hot iron (ii) oxide. a. Write the balanced reduction half reaction that occurs. b. Write the balanced oxidation half reaction that occurs. c. Write the balanced net ionic equation for this reaction.
  81. chemistry

    Please help me!!! Write a balanced chemical equation for oxidation-reduction reaction of fluorene
  82. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)
  83. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)
  84. Chemistry

    Write a balanced chemical equation for single eisplacement reaction. Al+H2SO4
  85. chemistry

    Write the balanced chemical reaction for the rusting of iron? the acidic vinegar dissolved a protective coating off the steel wool, allowing the oxidation of the steel to begin. This process is called rusting. In this reaction, iron(III) is combined with
  86. Chemistry

    Potassium is a reactive element. Bromine is a reactive element. Write the complete balanced chemical equation using appropriate chemical symbols for the reaction when potassium reacts with bromine to make a solid product showing correct symbols and states
  87. Chemistry

    Identify the following chemical equations by type. 1. If an electric discharge produces 500 cm3 of ozone (O3), how many cm3 of oxygen (O2) are required? 3O2(g) ---> 2O3(g) 2. When 2.75 dm3 of O2 react with an excess of glucose (C6H12O2), according to the
  88. Chemistry

    Benzene, C6H6, reacts with nitric acid, HNO3. Two products are formed, one of which is water. The second product has a molar mass of 213 grams. The second product is composed of 33.8% carbon, 1.42% hydrogen, 19.7% nitrogen, and 45.1% oxygen. Write a
  89. science

    Magnesium can react with aqueous nitric acid, HNO3, to form hydrogen gas and magnesium nitrate. Write down the balanced chemical equation for this reaction, remembering to use the state symbols.
  90. chem

    Magnesium can react with aqueous nitric acid, HNO3, to form hydrogen gas and magnesium nitrate. Write down the balanced chemical equation for this reaction, remembering to use the state symbols.
  91. chemistry

    In the formation of acid rain, sulfur dioxide reacts with oxygen and water in the air to form sulfuric acid. Write the balanced chemical equation for the reaction. (Type your answer using the format CH4 for CH4.)
  92. science

    Octane (C8H18) is a liquid that combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to
  93. biology

    Which of the following is true about the relationship between energy and chemical reactions? Activation energy is required for a chemical reaction to occur. Activitation energy is not necessary in a chemical reaction which releases energy. Chemical bonds
  94. Ap Chem

    If in an experiment we're working with Mg, HCl acid, and H20. We stick the magnesium in the acid mixed with water and the Mg dissolves. One of the products is hydrogen gas. If the water in the tube is evaporated, the other product, a white salt remains.
  95. Chemistry

    Suppose you tired to carry out a double-replacement reaction by mixing together equal volumes if a solution that contained dissolved NaF and a solution NaCl. Would you expect a reaction, if Si write the balanced chemical equation
  96. chemistry

    write the balanced chemical equation for the reaction that occurs when BaCl2.2H2O is heated.
  97. chemistry

    write a balanced chemical equation for the following reaction including states not complete; no question.
  98. Chemistry

    Write a balanced chemical equation for each single replacement reaction. A) Au(s) + KNO3(aq) ==> ??? B) Al(s) + H2SO4(aq) ==> ???
  99. chemistry

    testing bronsted lowry reaction predictions...... im super stuck can someone help me steo by step how to figure this out assuming i use the 5 step process? write a balanced chemical equation for ch3coona and hcl reaction position of equilibrium. I know
  100. Chemistry

    Consider the following chemical equation. SO2(g) + O2(g) → SO3(g) What volume of sulfur dioxide gas reacts with 37.5 L of O2? The reaction conditions are 875°C and 1.00 atm pressure.

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20