write a balanced chemical equation for the following reaction including states not complete; no question.

111,593 results
  1. chemistry

    Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  2. chemistry

    Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  3. chemistry

    Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  4. Chemistry

    Write a balanced chemical equation for the reaction of propylamine with water. Is propylamine --> CH3CH2CH2NH2? Is the equation CH3CH2CH2NH2 + H2O --> CH3CH2CH2NH3+ + OH- right? Isn't this balanced?

  5. Chemistry

    Hydrogen peroxide can act as either an oxidizing agent or a reducing agent, depending on the species present in solution. Write balanced half-reaction equations for each of the following: (a) H2O2(aq) acting as an oxidizing agent in an acidic solution.

  6. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

  7. Chemistry

    When a mixture of 13.0 g of acetylene (C2H2) and 13.0 g of oxygen (O2) is ignited, the resultant combustion reaction produces CO2 and H2O. A)Write the balanced chemical equation for this reaction. B)Which is the limiting reactant? Express in chemical

  8. chemistry

    Write a balanced chemical reaction to show the dissociation of solid magnesium chloride (MgCl2) in water, indicate states of the reactants and products

  9. chemistry

    Complete and balance the molecular equation, including phases, for the reaction of aqueous ammonium bromide, NH4Br, and aqueous lead(II) acetate, Pb(C2H3O2). Enter the balanced net ionic equation, including phases, for this reaction.

  10. chemistry

    Write a balanced chemical equation for the reaction that occurs when the hydrocarbon styrene, {\rm C}_{8}{\rm H}_{8}(l), is combusted in air.

  11. Chemistry

    Answer the following question: In a space shuttle, the CO2 that the crew exhales is removed from the air by a reaction within canisters of lithium hydroxide. Let's assume that one astronaut exhales about 537. L of CO2 daily. What mass of water will be

  12. Chemistry

    When iron metal reacts with oxygen, the reaction can form Fe2o3 (numbers are subscripts). Write a balanced chemical equation for this reaction and find the number of moles of oxygen that are needed to form 6 mol of Fe2o3. Show your work. I am really stuck

  13. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on the oxidation states for

  14. Chemistry1

    The questions asks to write a word equation and a balanced chemical equation for a reaction between aqueous copper (ii) sulfate and solid iron. Assume that iron forms the Fe2+ ion.) Include proper states of matter after each substance (s, l, g, aq). Here

  15. Chem

    Separate the following balanced chemical equation into its total ionic equation. AgNO3​(aq)+NaCl(aq) --> NaNO3​(aq)+AgCl(s) (List the ions in order of the above equation.) Write the net ionic equation for the reaction above. (Make sure the cation is

  16. Chemistry

    Complete and balance the molecular equation, including phases, for the reaction of aqueous iron(III) nitrate, Fe(NO3)3 and aqueous lithium hydroxide, LiOH Enter the balanced net ionic equation, including phases, for this reaction.

  17. Chemistry

    When 13.0 g of acetylene, C2H2, undergoes complete combustion, 65.5 kJ of heat are released. a) How much energy is released when one mole of acetylene is burned? b) Write a balanced chemical equation for the reaction and include the heat value in the

  18. Chemistry

    1a). If you react 16 mol A with 15 mol B in the reaction 4A + 3B → 2C, what is the limiting reactant? 1b). What is the theoretical yield of product C in mol? 3a.) If Pb(NO3)2 were the limiting reactant in this reaction: Pb(NO3)2(aq) + 2KI(aq) → PbI2(s)

  19. Chemistry

    Hydrogen gas is used for many purposes, including the hydrogenation of vegetable oils to make margarine. The most common industrial process for producing hydrogen is "steam reforming," in which methane gas, CH4, from natural gas reacts with water vapor to

  20. chemistry

    calcium nitrate + sulfuric acid =caso4+? write a balanced chemical equation for this reaction including states. Ca(NO3)2 + H2SO4 ==> CaSO4 + 2HNO3 You don't have enough information to provide states. CaSO4 will be a solid so you write CaSO4(s). H2SO4 will

  21. chemistry

    Consider the following reagents: zinc, copper, mercury (density: 13.6 g/mL), silver nitrate solution, nitric acid solution. a. Given a 500-mL Erlenmeyer flask and a balloon can you combine two or more of the foregoing reagents to initiate a chemical

  22. chemistry

    Based on the following chemical equation, answer the questions below. Show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide is as follows: H2S(g)+I2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced

  23. Chemistry

    Write balanced chemical equations for all transferals of the compounds from organic to aqueous phases and for all precipitation reactions. **Note: If a compound does not move from one layer to another, no reaction has occurred, and no equation can be

  24. Chemistry

    Hi! I kind of need help to get started with these four problems. There are more problems like the ones below. It would be great if I had an example of each of the four problems. Thanks! FeSO4(aq)+ KCL(aq) (for problem 1 and 2) 1)When the following

  25. chemistry

    Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation. Identify all of the phases

  26. chemistry

    Using the balanced chemical equation and the initial mass of magnesium calculate the mass of hydrogen gas that should be produced when the reaction is complete Balanced Chemical equation: Mg(s)+2HCI(aq)=MgCl_2+H_2Mg(s)+2HCI(aq)=MgCl2 +H2 ​Mass of

  27. chem 101

    a.write a balanced chemical equation for the complete combustion of sucrose. --- this part of the question i got help on, and thank you b. if combustion is complete, a brown liquid caramel might form, followed by a brown/black solid. what would be the

  28. chem 101

    write a balanced chemical equation for the complete combustion of sucrose.

  29. chemistry

    A 31.5 ml aliquot of H2SO4 of an unknown concentration was titration with 0.0134 M NaOH. write the balanced chemical reaction with the correct states of matter.

  30. chemsitry

    1)Balance the following gas-phase reaction and 2) write its reaction quotient, Qc: CH4(g)+F2(g)......>>.....

  31. Chemistry

    Based on the following chemical equation answer the question below show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide h2s(g)+i2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams

  32. chemistry

    write the balanced chemical equation for the reaction that would occur ewhen a base is added to a solution containing H2PO4-/HPO4^2- buffer system can you please help we write this balanced equation. thank you

  33. Chemistry

    What is the balanced equation for the reaction including states? Does it form a precipitate? Cu(NO3)2 + KI

  34. Chemistry

    What type of reaction may be occurring when a person's skin develops a green stain beneath a 14 K gold bracelet? Using HA as the chemical formula for acid in skin, write a balanced chemical equation to represent the reaction.

  35. Chemistry!!

    1) Write balanced chemical equation for the oxidation of Fe^2+(aq) by S2O6^2-(aq)? 2)Write balanced chemical equation for the oxidation of Fe^2+ by N2O 3)Write balanced chemical equation for the oxidation of Fe^2+ by VO2+

  36. chemistry

    testing bronsted lowry reaction predictions...... im super stuck can someone help me steo by step how to figure this out assuming i use the 5 step process? write a balanced chemical equation for ch3coona and hcl reaction position of equilibrium. I know

  37. Chemistry

    Write a balanced chemical equation for each single replacement reaction. A) Au(s) + KNO3(aq) ==> ??? B) Al(s) + H2SO4(aq) ==> ???

  38. Chemistry, HELP!!

    Write out a balanced equation for reaction of solid zinc with hydrochloric acid (HCl(aq)). Indicate all states of matter in your equation.

  39. Chemistry

    Write the balanced half reaction for the reduction and oxidation reactions for the redox reaction: 2 Mg (s) + O2 (g) -> 2 MgO (s) Notice: for this question you do not have to include a charge of zero and you do not have to include the states. Below is an

  40. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to and defined by the quantity dHformation [NH3(g)] N2(g) + 3H2(g) --> 2NH3(g) Is that all the question is asking for?

  41. Chemistry - please help

    1. Write the balanced chemical equation for the single displacement reaction of magnesium and sodium thiosulfate. Is this right? 6Mg + (S*2*O*3)*2 -> 6MgO + 2S*2 2. Write the balanced chemical equation for the double displacement reaction of hydrogen

  42. Chem 3A

    please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?

  43. satp conditions

    Calcium hydride reacts with a vast excess of water to form calcium hydroxide and hydrogen gas. (See the periodic table.) (a) Write a balanced chemical equation for the reaction. (Use the lowest possible coefficients. Include states-of-matter under SATP

  44. Chemistry

    Write the balanced chemical equation for each of the following. (Use the lowest possible coefficients. Include states-of-matter at 1 atm and 25unknown_prefixC in your answer.) (b) the reaction of magnesium metal and hydrobromic acid

  45. chemistry

    write a balanced chemical equation for the reaction of aluminium selenide with water (to include physical states of reactants and products)to include brief decription of the strategy used and the sequence of partially balanced equations needed to reach

  46. Organic Chemistry

    1. Benzene is often produced as a side product during Grignard reactions where phenylmagnesium bromide is used as the Grignard reagent. How can its formation be explained? Please include a balanced chemical equation that describes its formation. 2. Why,

  47. Chem

    Please tell me if these are right. How many grams are needed to obtain 1.5 moles of magnesium oxide? I got 60grams is this right? Write a balanced equation for the reaction of the magnesium and the oxygen including their physical states. I got 2Mg=Mg2+O2?

  48. Chemistry

    If you could me solve ths is anyway, it would be much appreciated. A solution containing 3.50g of sodium carbonate is mixed with one that contains 5.00g of silver nitrate. a. Write the complete chemical equation and the net ionic equation for the reaction

  49. chemistry

    1-Butene (CH2=CHCH2CH3) burns in the presence of O2 to produce CO2 and H2O. Write the balanced chemical equation for this reaction (omit physical states and use condensed molecular formulas). CH2CHCH2CH3+6O2=4CO2+4H2O

  50. chemistry

    Complete and balance the chemical equation using compound formulas. Include the states. If there is no reaction, enter NR. Pb(NO3)2(aq) + NaI(aq) → sine Pb is not reactive, the reaction is NR. Am i correct?

  51. Chem

    With which of the following will the weak acid HCHO2 react? If a reaction occurs, write the balanced molecular equation. If no reaction occurs write the left half of the reaction and use "NR". Do not include physical states in your answers. KOH: NH3:

  52. Chemistry

    in a neutralization reaction, dilute tetraoxosulphate (vi) acid completely reacted with sodium hydroxide solution.write a balanced chemical equation for the reaction

  53. AP Chemistry

    Hydrogen gas is blown over hot iron (ii) oxide. a. Write the balanced reduction half reaction that occurs. b. Write the balanced oxidation half reaction that occurs. c. Write the balanced net ionic equation for this reaction.

  54. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing

  55. chemistry

    A 31.5 ml aliquot of H2SO4 of an unknown concentration was titration with 0.0134 M NaOH. write the balanced chemical reaction with the correct states of matter.

  56. Chemistry

    Consider the neutralization reaction that takes place when hydrochloric acid reacts with aqueous calcium hydroxide Write a complete balanced equation for this reaction

  57. college chem

    Two questions where I have to write a balanced net ionic equation. 1. Write a balanced net ionic equation for the reaction that occurs when aqueous solutions of sodium chromate and silver nitrate are mixed 2. Write a balanced net ionic equaion reaction for

  58. chemistry BOB

    is this the answer to B ) CH3CH2OH + 3O2 → 2CO2 + 3H2O In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion

  59. chemistry

    write a balanced chemical equation for the following reaction including states not complete; no question.

  60. Science

    For each reaction in a lab I have to write: 1. the balanced molecular equation including states of matter 2. the balanced complete ionic equation, crossing out spectator ions, including states of matter 3. the balanced net ionic equation, including states

  61. Cemistry

    Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the

  62. chemistry 20

    A student mixed a solution of aqueous calcium chloride with an aqueous solution of magnesium sulphate. A precipitate formed. 1) Write the balance chemical equation for the reaction including states of matter. Ensure you write the reactants as a dissociated

  63. Chemistry

    1. Write a balanced molecular equation for the reaction of solid AgNO3 with aqueous NaCl. Be sure to include the correct number of coefficients and the state of the species (aq, s, l or g). 2. Write the total ionic equation for this reaction, including all

  64. chem help

    i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation for: sodium sulfate

  65. Chemical Equations

    Starting with nitrogen and hydrogen, millions of kilograms of ammonia are produced every year for use as a fertilizer. Use this info to answer the next 3 questions. Communicate the balanced chemical equation using molecular models. Communicate the balanced

  66. chemistry

    hydrogen selenide can be prepaired by reacting aluminium selinide with water the other product being solid aluminium hydoxide AL(OH)3,write a balanced chemical equasion for the reaction of aluminium selenide with water including the phisical states of the

  67. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to ΔHf° [NH3(g)]

  68. chemistry

    Need Help Finishing: Purpose: • To observe a chemical reaction. Materials: • Vinegar (acetic acid, CH3COOH) • Baking soda (NaHCO3) • Measuring cups and spoons • Cup Procedure: 1. Place ½ cup of vinegar in the cup. 2. Add 1 tablespoon on baking

  69. Chemistry Pleasee Help

    Can you please help me with these problems, I followed the textbook but i am still not getting the write balanced equations.I am not sure if it is the phases or my balancing, or if i got the right answers and not submitting it correctly Please I really

  70. Chemistry

    Potassium is a reactive element. Bromine is a reactive element. Write the complete balanced chemical equation using appropriate chemical symbols for the reaction when potassium reacts with bromine to make a solid product showing correct symbols and states

  71. chemistry

    Upon complete combustion, the indicated substances eveolve the given quantities of heat. Write a balanced equation for the combustion of 1.00 mol of each substance, including the enthalpy change, ÄH, for the reaction. a) 0.548g of propane, C3H8(g), yields

  72. Chemistry (reposts#6)

    !A 100.0 mL aliquot of 0.200 M aqueous calcium hydroxide is mixed with ! 100.0 mL of 0.200 M aqueous aluminum nitrate. a.)! Write a complete molecular equation for this reaction, including phases b.)! Write a net ionic equation for this reaction, including

  73. chemistry

    Answer the following questions based on the following electrochemical reaction: Al(s) + Cu 2+(aq) Cu(s) + Al3+ (aq) Write the balanced chemical equation for this cell. I'm confused.. how would this be balanced?

  74. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing

  75. Chemistry

    If you could me solve ths is anyway, it would be much appreciated. A solution containing 3.50g of sodium carbonate is mixed with one that contains 5.00g of silver nitrate. a. Write the complete chemical equation and the net ionic equation for the reaction

  76. Chemistry

    A solution is made by mixing NaOH and HNO3. Write a balanced equation for the reaction that occurs between the solutes. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  77. another A.P Chemistry Question

    A different rigid 5.00L cylinder contains 0.176mol of NO(g) at 298 k. A 0.176mol sample of 02(g) is added to the cylinder, where a reaction occurs to produce NO2(g) (d) write the balanced equation for the reaction. (e) calculate the total pressure, in atm,

  78. Chemistry

    Hydrogen gas is used for many purposes, including the hydrogenation of vegetable oils to make margarine. The most common industrial process for producing hydrogen is "steam reforming", in which methane gas, CH4, from natural gas reacts with water vapor to

  79. chemistry

    Predict the products and then write the complete balanced chemical equation with states of matter: 1. Sulfuric Acid and sodium hydroxide 2. Aluminum and copper (II) sulfate 3. Silver nitrate and iron (III) chloride 4. Magnesium heated 5. Aluminum oxide

  80. chemistry

    I want to know if someone could let me know if I have written my balanced equations correct for the following questions. Write a balanced equation for the reaction of zinc with sulfuric acid. Zn + H2SO4 >>> Zn(S04) +H2 Write a balanced equation for the

  81. Chemistry Equation(again!)

    Posted by chrissy on Saturday, January 6, 2007 at 1:23pm. In a lab expirement you add copper(II)nitrate to pure zinc. Write a balanced equation for this expirement and predict if a reaction will occur. For Further Reading Chemistry Equation - DrBob222,

  82. CHEMISTRY

    hydrogen selenide can be prepaired by reacting aluminium selinide with water the other product being solid aluminium hydoxide AL(OH)3,write a balanced chemical equasion for the reaction of aluminium selenide with water including the phisical states of the

  83. Chemistry Cell notations

    Enter the balanced chemical equation including states that describes the electrochemical cell that is represented by the cell notation as shown. Pt(s) l H2O(l) l O2(g) l H+(aq) ll H+(aq), Cr2O72-(aq), Cr3+(aq) l Pt(s)

  84. chemsitry

    home / study / questions and answers / science / chemistry / make sure to answer both parts: 1)balance the following ... Your question has been posted. We'll notify you when a Chegg Expert has answered. Post another question. . Question Edit question make

  85. chemistry

    What is the difference between biochemical, pharmaceutical, and diagnostic chemical reactions in healthcare? What is a specific example that exists for each of these chemical reaction types above and why might it be of importance to healthcare

  86. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this happen? Thanks. Oh and what is

  87. Chemistry

    Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide

  88. Chemistry - Cell Notation

    Enter the balanced chemical equation including states that describes the electrochemical cell that is represented by the cell notation as shown. Pt(s) | F-(aq) | F2(g) || Cl-(aq), AuCl4-(aq) | Au(s) I'm having trouble balancing this... I get AuCl4- + 2F-

  89. Chemistry

    Write a balanced chemical equation for single eisplacement reaction. Al+H2SO4

  90. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

  91. chemistry

    Please help me!!! Write a balanced chemical equation for oxidation-reduction reaction of fluorene

  92. Chemistry (Help)

    For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each

  93. science

    Hydrogen Cyanide (boiling temperature 26 degrees Celsius) is an important chemical for the production of nylon and various transparent plastics. It is produced on an industrial scale by the oxidation of methane in the presence of ammonia. The equation

  94. chemistry

    I have the chemical equation: CH4 + NH3 + O2 => HCN + H2O, I have to write a balanced equation using the lowest whole number coefficients, including the state of each compound -- HELP PLEASE http://www.daigger.com/equationsbalancer.jsp All are gases, even

  95. Chemistry

    The electrolysis (decomposition) of water produces hydrogen gas at the rate of 30.0 mL/min. A) Write a balanced chemical equation for this reaction and include phase designations. 2H2O(aq)---> 4H2(g)O2(g) Is whatever I've done above correct? B) What volume

  96. chemistry

    write the balanced chemical equation for the reaction that occurs when BaCl2.2H2O is heated.

  97. chemistry

    Determine whether a reaction will take place in the following and write a complete balanced equation: You must include phase labels. Use NR for no reaction. 1.) Ca(OH)2 (aq) + Al(NO3)3 (aq) → 2.) Cu(C2H3O2)2 (aq) + Na2SO4 (aq) → 3.) H2SO4 (aq) + KOH

  98. Chemistry

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction. I'm not

  99. chem

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction.

  100. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20