alg/trig

4,424 results, page 14
  1. Trig/PreCalc

    Factor the Polynomial completely: 10x^4y-20x^2y^2
  2. trig

    simplify the expression. (sin^2x+cos^2x) - (csc^2x-cot^2x)
  3. Math

    Find the exact value of the trig function below. cos2Ø if sinØ = 2/5
  4. trig

    establish the identity: cot(A-B)= cotAcotB+1/cotB-cotA thanks for any help at all
  5. trig

    solve this equation: 4x^3-4x^2+13x-6=0 note: that's suppose to be 4x to the third and 4x squared
  6. trig

    write an algebraic equation equivalent to csc(arctanx)
  7. trig help

    simplify cosec40(sin40+sin80+cos120) help step
  8. trig

    prove cosx+cotx/secx+tanx =cosxcotx
  9. Precalc/Trig

    Find the smallest positive number t such that e^sin(t)=1/2
  10. trig

    Solve without using a calculator or tables cos(5pi/6 + pi/4) Thank you Reiny!:)
  11. Trig

    Prove (cos^2t+4cos^2+4)/(cost+2)=2sect+1)/sect
  12. trig

    eliminate the parameter t from the following x = 4 sin t y= 7 cos t sketch the graph
  13. Trig

    What are the focus and directrix of the parabola represented by the equation:8(y-6)=(x+2)squared?
  14. trig

    Solve for the unknown. Assume that all of the angles are acute. 1. U = 69 A = 75 AN = 56 NU = ______ is this right NU= 92.05
  15. Trig

    Prove cos^2t+4cost+4/cost+2=2sect+1/sect
  16. trig help

    simplify cosec40(sin40+sin80+cos120) help step
  17. Trig

    Find sin2theta, cos2theta if csctheta=13/12 and lies in quadrant II. Thank you!
  18. Trig

    Prove cos^2t+4cost+4/cost+2=2sect+1/sect
  19. trig

    Solve the given triginometric equation analytically 2 sinx = tanx
  20. trig

    Expan each of the following using the compound-angle formulae:sin(x + 20degree)
  21. Trig

    find all solutions of 2sinx=1-2cosx in the interval from 0 to 360
  22. algebra 2 trig

    if log3=a then log300 can be expressed as? 1) 100a 2)a+2 3)100+a 4)3a
  23. trig

    Solve the equation on the interval [0,360) cos^2t+2cos(t)+1=0
  24. Math [Trig]

    how do you find a full cycle of a trigonemtric function?
  25. Trig

    How do i find the exact value of sin 15 using the half angle formula
  26. Trig

    verify the following identity: cos(A-B)/cosAsinB=tanA+cotB
  27. Trig

    verify the following identity: tanx+cotx/cscx=secx
  28. Trig

    verify the following identity: 2sinxcos^3x+2sin^3cosx=sin(2x)
  29. Trig

    2+1/3tan(theta)=2 I know that tan=0 0,180 But i don't know how to figure it out. Please help.
  30. trig

    How king i find theta if the formula is cot(2theta) = 7/24?
  31. Trig/PreCalc

    Find a parametrization for the line segment with endpoints (5,2) and (-2, -4).
  32. Trig

    Find the value of tangent of angle A, given cos2A = 4/5, and A terminates in quadrant 2
  33. Trig/PreCalc

    Find the interior angles of the triangle with vertices (-4,1), (1,-6), and (5,-1)
  34. Trig

    establish identity sec 0/1 + sec0 = 1 - cos0/sin^2 0
  35. trig

    Find the following values for each function a. f(0) b. f(-1) c. f(-x) d. f(x+1) f(x)=2x^2+3x-4 I you plug in the value for each x, I just want to check my answers. Thanks.
  36. trig

    Give the phase shift in radians (along x) of f (x) = sin (x - 3pi/5
  37. TRIG HELP

    find the exact solutions over the interval tanx = 1 all real x
  38. Trig

    Use the half-angle formula to simplify (sin4theta)/(1+cos4theta)
  39. Trig

    Prove cos^2t+4cost+4/cost+2=2sect+1/sect
  40. Trig

    True or False: For a trignometric function, y = f(x), then x = f^-1(y). Explain your answer. Thanks.
  41. Math: Solving Trig Equation

    9tan (x) - 9 sec^2 (x)/ tan (x)
  42. Calc

    How do you do the derivative of an inverse trig function? arcsin (sqrt2/2)??
  43. trig

    Find another angle theta between 0 and 2pi that has the same cosine as 3pi/14
  44. Trig

    Give the exact value of the trigonometric function: arctan(√3)
  45. Pre-Calc/Trig...

    Use the discriminant to determine the nature of the roots. 1. 2x^2+5x-3=0 2. -x^2+x+1=0
  46. Pre-calc/Trig...

    which of the following are quadratic functions? check all that apply 1. y=2x^2-3x+7 2. y=3x-4 3. y=(5x-3x^2)/4+1 4. y=x-x^3
  47. trig

    find sin if cos(2è)=(4)/(5) and theta terminates in quadrant 1
  48. trig

    what is the hietgh difference between 2 walls 6 metres apart to get a 17.5 degree pitch
  49. alg2/trig

    Which expression is defined for all real numbers? a) x + 3/x^2 b) 5/(x + 2)^2 c)4/(x − 2)^2 d)7/x^2 + 3
  50. trig

    All solutions in interval [0,2pi) of cosine theta plus one equals zero
  51. trig

    All solutions in interval [0,2pi) of cosine theta plus one equals zero
  52. Trig

    In ΔABC, a = 19, c = 10, and m∠A = 111. Which statement can be used to find the value of C?
  53. trig

    Hi,how do I find both solutions of the equation cos0 = 0.35 between degrees 0 and 360? Many thanks
  54. Trig

    Find all real numbers that satisfy the equation. 2 cos x + 1 = 0
  55. trig

    find all soultions of the equation sec^s x-1=0 in the interval{0,2pi}
  56. Math

    What is the inverse trig function cotangent of square root of 3/3? What is the value?
  57. trig

    Use a half-angle formula to find the exact value of cos 5ð/12
  58. Trig

    verify following trigonometric identities. 1/sec0tan0 = csc0 = sin0
  59. Pre-Calc/Trig

    What are the polynomial names for these functions. 1.) m(x)=x+x^2-1 2.) d(x)=x+ 3.14 3.) 2-6x^2+11x^3
  60. Trig

    If 180<A<270 and sinA= -radical(5)/3, find tan(1/2)A.
  61. trig

    find all the values of x that satisfy the equation: 2sin^2(x) + 1 = 3sin(x).
  62. Trig

    prove that tanA divided by the sinA equals the secA
  63. trig

    Find all angles è between 0° and 180° satisfying the given equation. cos è = 1/9
  64. Pre-Calc/Trig...

    Write the equation y = bx in logarithmic form.
  65. trig

    Find exact value of the expression. sin( 27pi/4 + 17pi/6)
  66. TRIG

    THE SIN COS SEC TAN COT CSC 5X+Y=0
  67. Trig

    Solve exactly over 0 ≤ θ < 2π secx + tanx = 1
  68. trig

    how do i find the corresponding function formula and check the symmetry algebraically
  69. trig

    solve exactly over the indicated interval: cot(theta)=0, all real numbers
  70. trig

    Solve exactly over the indicated interval: 2sinx+cscx=3, 0<theta<360
  71. TRIG

    in an arithmetic sequence a1=4 and d=8 which term is 428 Show your work
  72. Trig

    Evaluate (if possible) the sine,cosine, and tangent of the angle 10pi/3
  73. TRIG

    determine the sum of the first 100 even integers SHOW YOUR WORK
  74. Trig

    Use sum and difference identitites to find the exact value of co 15 degrees
  75. Trig

    (2-2i)^5 find the given power write answer in rectangular form
  76. trig

    find the primary solutions. 4cos^2x-3=0 and tanx-tan^2x=0.
  77. trig

    (2-2i)^5 find the given power write answer in rectangular form
  78. Trig

    If sec A =5/4 and A is an angle in Quadrant IV, find the value of cos A. A. -4/5 B.4/5 C.-5/4 Is it choice A
  79. Trig.

    In right triangle ABC, C is the right angle and sinA=(radical 3/2). What is the value of csc B?
  80. Geometry

    30-60-90 triangle has a hypoteneuse of 10 use trig to find the short side
  81. Algebra 2 / Trig

    Given cos X = -0.147, find two possible values for X that are not co-terminal.
  82. Trig 2

    What is the smallest value for x where y = sin 2x reaches its maximum ...wtf that means.
  83. trig

    find the value of alpha cotalpha=1.3692847 is 0.023903 correct?
  84. Trig

    Verify that each equation is an identity. cos^2x+tan^2xcos^2x=1
  85. Trig

    evaluate exactly(without calculator): 1. sec(pi/4) 2.3sin4pi 3. tan240(degrees)
  86. trig

    how do i find the amplitude, period, phase shift of y=2 cos(-4t-(-4 pi/3))
  87. trig

    Complete the general solution to y = arcsin -. y=____±2k IM lost please help
  88. trig

    if cos(theta) equal -3/4 find sin(2theta)
  89. trig

    Given that cos A = 5/13 and A and B are both acute angles, calculate the value of Sin2A and Cos2A
  90. Maths 3u trig

    If sinA = 1/3 and cosA<0 find the exact value of tan2A
  91. Math (trigonometry)

    Find the value of each of the remaining trig functions. Cscè=-4, ð<è<3ð/2
  92. Trig

    Rewrite cos(tan^-1(v)) as an algebraic expression in v. Can someone help me with this problem? Thanks
  93. Help me trig.

    solve the equation in the interval [0,2pi) tan (t/2)-sint=0
  94. Algebra 2/trig

    How would I calculate the following function value? tan = 29degrees 36feet
  95. trig

    Find the exact values of the inverse function arcsin 1/2
  96. Math

    Required to Prove the following trig identity: (cos2x)^2 + (sin2x)^2 = 1
  97. trig

    If an equilateral triangle has a side of 10 ft what is its altitude to two significant digits
  98. Calculus

    Integration with trig functions Integral of [(1-sinx)/cos^2x] dx
  99. trig

    2 cosine squared pi over 8 minus 1 find exact value of given expression
  100. trig

    slove the equation exactly over the interval [0, 2pi) sinx=1-2sin^2x

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45