1. General Chemistry

    When a solution of nickel (II) chloride is mixed with a stoichiometric amount of colorless sodium hydroxide solution, a green, gelatinous precipitate forms. (a) Write the balanced molecular equation and the net-ionic equation for this reaction. molecular:
  2. Chemistry

    Which of the following are true about the use of aluminum chloride in the Friedel-Crafts acylation reaction? Note that there may be more than one correct answer. Aluminum chloride removes chloride from acetyl chloride to generate a nucleophile that can
  3. Chemistry - Answer Check

    The two common chlorides of Phosphorus, PCl3 and PCl5, both important in the production of other phosphorous compounds, coexist in equilibrium as shown in the balanced chemical reaction below: PCl3 (g) + Cl2 (g) <-----> PCl5 (g) At 250 C, an
  4. chem

    Kw = KaKb. With this equation you can convert any Ka to Kb and the reverse. Codeine (Cod), a powerful and addictive painkiller, is a weak base. a) Write a reaction to show its basic nature in water. Represent the codeine molecule with Cod. b) The Ka for
  5. health

    How are the data elements contained in the HIPAA 837 claim form similar to the CMS-1500, and how does each form relate to the claims process? In your opinion, do the similarities between HIPAA 837 and CMS-1500 complicate or simplify the claims process?
  6. math

    find the exponential function of the form y=ab^x whose graph passes through the points (4,6) and (7,10) i got a=3.04 and b= 1.185 so my equation is y=3.04(1.185)^4 is this correct? one more problem. find a power function of the form y=ax^b whose graph
  7. Chemistry

    Which of the following pairs of atoms would you expect to combine chemically to form an ionic compound? A.Li and S B.O and S C.Al and O d.F and Cl e.I and K F.H and N Which of the following pairs of elements will not form ionic compound. a.sulfur and
  8. English

    1. My hobby is watching a musical. 2. My hobby is watching musicals. 3. My hobby is watching a baseball game. 4. My hobby is watching baseball games. --------------------------------- Which ones are commonly used? Do we have to use the singular form or the
  9. Chem -Bob Pursley Please Help!

    Chlorine dioxide decomposes to chlorine and oxygen according to the following mechanism: ClO 2 → ClO + O (fast) ClO 2 + O → ClO 3 (fast) ClO 3 + ClO → Cl 2 + 2 O 2 (slow) (a) What is the overall reaction? (b) What is the molecularity of each step?
  10. AP CHEM

    19. Burning coal and oil in a power plant produces pollutants such as sulfur dioxide, SO2. The sulfur-containing compound can be removed from other waste gases, however, by the following reaction: 2 SO2(g) + 2 CaCO3(s) + O2(g)  2 CaSO4(s) + 2
  11. Chemistry

    Determine the type of chemical reaction, find the limiting reagent, determine the amount of product in grams, and the amount of grams of excess reagent. Chromium metal is heated with oxygen to give chromium (III) oxide. Start with 38.5 moles chromium metal
  12. Physics

    A motorist traveling at 15m/s encounters a deer in the road 38m ahead. If the maximum acceleration the vehicle's brakes are capable of is -7m/s/s, what is the maximum reaction time of the motorist that will allow him or her to avoid hitting the deer?
  13. Science please help :)?

    Which of the following happens when a low-mass star runs out of fuel? Choose all that apply. A. Its core becomes a white dwarf B. Its outer layers form a nebula, or vast cloud of gas and dust C. its outer layers expand, and the star becomes a red giant D.
  14. Science

    Which of the following happens when a low-mass star runs out of fuel? Choose all that apply. A. Its core becomes a white dwarf B. Its outer layers form a nebula, or vast cloud of gas and dust C. its outer layers expand, and the star becomes a red giant D.
  15. Math

    1.Divide.Write your answer in simplest form. (1 point) 2/3 divided by 1/4 a.2 1/2 b.2 2/3 c.2 3/8 d.2 2.Find the product. (1 point) 1/2*3/7 a.4/14 b.3/14 c.7/6 d.2/7 3.Divide.Write the quotient in simplest form. (1 point) 3/5 divided by 2/10 a.6/10 b.3/5
  16. Chemistry

    Calculate the average C—C bond strength in cyclopropane (in kJ/mol). Its combustion and the experimental enthalpy of reaction are: C3H6(g) + 4.5O2(g) → 3CO2(g) + 3H2O(g) ΔHºrxn = -1,957.7 kJ/mol Since all reactants and products are in the
  17. Chemistry

    On the semi - reactions below is correct to say: Li + + 1℮- => Li. Eº = -3,04V. Au 3+ + 3℮- => Au. Eº = + 1,50V. Pb 2+ + 2℮- => Pb . Eº = - 0,13V. Ag + + 1℮- => Ag. Eº = + 0,80V. a) In the semi reaction Ag, the
  18. gr8language

    Write four sentances with a different form of lie, then write four sentances with a different form of lay. 1.a) I would never lie to my friends. b)THe baby is lying in her crib. c)I have lain to my parents. d) (lay) 2.a) I like to lay on the ground and
  19. Chemistry

    2. Solid ammonium iodide decomposes to yield ammonia gas(NH3) and hydrogen iodide gas at 400oF. The equilibrium constant for this reaction is 0.215. Ten grams of ammonium iodide are sealed in a 10.0 L flask at equilibrium. Complete the following: a. Write
  20. Chemistry

    The oxidation of phosphine (PH3) to phosphorus pentoxide (P2O5) is given by the chemical equation: _PH3+O2-->_P2O5+H2O A.balance the chemical equation B.how many grams of O2 will react completely with 35.0grams of PH3? C.how many of P2O5 and H2O will be
  21. chemistry

    The thermite reaction is a very exothermic reaction; it has been used to produce liquid iron for welding. A mixture of 2 mol of powdered aluminum metal and 1 mol of iron(III) oxide yields liquid iron and solid aluminum oxide. How many grams of the mixture
  22. Chemistry

    The standard free energy of activation of one reaction is 94.3 kj/mol^-1 (22.54 kcal/mol^-1). The standard free energy of activation for another reaction is 76.4 kJ/mol^-1 (18.26 kcal/mol^-1). Assume temp of 298K and 1 M conc. By what factor is one faster
  23. college chemistry

    Copper(II) sulfide reacts with oxygen to produce copper (II) oxide plus sulfur dioxide. Suppose you start this reaction with 50.0 grams of copper(II) sulfide and 50.0 grams of oxygen and you actually produce 33.5 grams of copper(II) oxide. Calculate the
  24. Chem

    given the reaction: agcl(s) +2nh3 (aq) <--> ag (nh3)2 +(aq) + cl^- (aq). if more ammonia, nh3 is added to the system at equilibrium the a) amount of agcl increases b) system cannot achieve equilibrium c) rate of the forward reaction decreases d)
  25. chemistry

    A mixture of 0.100 mol NO, 0.200 mol H2 and 0.0800 mol N2 were placed in a 2.00L reaction vessel, heated, and allowed to come to equilibrium conditions. At equilibrium, the molar concentration of N2 was 0.0500 mol/L. Calculate Kc for this reaction. 2NO +
  26. equilibrium constant (Kp)

    What is the equilibrium constant "Kp" at 200 C for the reaction below: P4(s) + 6 Cl2(g) --><-- 4 PCL3(l) Given the following at 200 C P4(s)+ 10 Cl2(g) --><-- 4 PCl5(s) Kc=8.12 PCl3(l)+ Cl2(g) --><-- PCl5(s) Kc=0.771 Answer: 6.7*[10^(-9)]
  27. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing
  28. Chemistry

    Given a diprotic acid, H2A, with two ionization constants of Ka1 = 4.5× 10–2 and Ka2 = 5.2× 10–7. Calculate the pH and molar concentration of each protonated form for a 0.133 M solution of NaHA. Calculate the pH and molar concentration of each
  29. English

    1. If you are stressed, you feel tense and anxious because of difficulties in your life. 2. If someone is stressed out, they are very tense and anxious because of difficulties in their lives. ============================== The above are form Collins
  30. English

    1. We made side dishes with the ingredients we had. 2. We cooked side dishes with the ingredients we had. (Are both OK?) 3. What is the difference between 'bonfire' and 'campfire'? 4. We did the clean-up activity at the Han River. 5. We did the clean-up
  31. algebra (check plz)

    write an equation in slope-intercept form of the line that passes through the given points. a. (-6,1), (3,-7) b. (-2/3,4), (6, -1/3) write an equation in point-slope form of the line that passes through the given poitns. c. (-2,5), (4,-3) d. (1/2,-1),
  32. Algebra

    Write the equation of a line that contains (-8,4) and the midpoint of the segment connecting (-10,5) and (-5,0) in standard form. I'm not sure what I'm doing wrong. I found the midpoint (-7.5, -3.5), found the slope, and put the equation in standard form.
  33. English

    1. She asked me to hold the line. 2. She asked me to hold on. ----------------- Are both the same? Do you have some other similar expressions? 3. He handed me the document without comment. 4. She handed me the document without comments. (Are both OK? Do we
  34. Chemistry

    Suppose that a stable element with atomic number 119, symbol Wr, has been discovered. (a) Write the ground-state electron configuration for Wr, showing only the valence-shell electrons. (b) Would Wr be a metal or a nonmetal? Explain in terms of electron
  35. chem

    An automobile burns 65 grams of gasoline over 20 minutes. The gasoline combines with 100 grams of oxygen in this reaction, to form carbon dioxide and 47 grams of water. How much carbon dioxide is formed? do I use the heat capacity equation? How much oxyen
  36. Chemical Reactions

    How can i get the step by step procedure for a chemical reaction? For example: the step by step procedure for the synthesis reaction of ammonia
  37. science

    2. which of the following happens when a low - mass star runs out of fuel ? choose all that apply . ( 3points ) A ITS CORE BECOMES A WHITE DWARF B ITS OUTER LAYERS FORM a nebula , or vast cloud of gas and dust c its outer layers expand , and the star
  38. help riemann sums

    the expression 1/50 (1/50 +2/50+ 3/50+ .....50/50)is a Reimann sum approximation for (everything in the parantheses is square root except the 1/50 outside the paratheses) the answer has to me the integral form so from looking at the formula in my book i
  39. SCIENCE

    2. which of the following happens when a low - mass star runs out of fuel ? choose all that apply . ( 3points ) A ITS CORE BECOMES A WHITE DWARF B ITS OUTER LAYERS FORM a nebula , or vast cloud of gas and dust c its outer layers expand , and the star
  40. math - standard form

    please could you check the first 2 then explain the method on the other 2 1)5.2x10^6 + 3x10^5 5200000+300000=5500000 5.5x10^6 2)4.2x10^5 + 1.28x10^6 420000+1280000=1700000 1.7x10^6 method please 3)6.5x10^-3 - 3.5x10^-9 0.065-0.000000035=0.064999965 how do
  41. Spanish

    I always thought Ustedes meant "they." I've also heard it as "you all (plural)". So when a question being given has the Uds. conjugation of the infinitive, are we suppose to answer back in the Uds. form or nosotros form? For example: A que hora van a salir
  42. geography

    Compare and contrast folded mountains to volcanic mountains. How they are alike? How they are different? i got some of it.. Similarities: Both were probably formed from convergent plate boundaries. Difference: Volcanic Mountains - are mountains that form
  43. chemistry HELP

    Use the following information to identify element A and compound B, then answer questions a and b. An empty glass container has a mass of 658.572 g. It has a mass of 659.452 g after it has been filled with nitrogen gas at a pressure of 790. torr and a
  44. Molecular Bio

    You are planning to digest human genomic DNA with the EcoRI restriction enzyme but realize you do not have any 10X buffer available to add to the reaction. The components of the 10X buffer are: 50 mM NaCl, 100 mM Tris, 10 mM MgCl2, and 0.025 % TritonX-100.
  45. Chemistry

    According to the following reaction, how many moles of hydrogen iodide will be formed upon the complete reaction of 30.0 grams of hydrogen gas with excess iodine? hydrogen (g) + iodine (s) hydrogen iodide (g) moles hydrogen iodide
  46. Informal Logic 103

    Write two arguments in English, one in the form of modus ponens and one in the form of modus tollens. Then, write the arguments in symbols using sentence letters and truth-functional connectives. (If your computer does not have all the symbols needed, use
  47. chemistry

    The following reaction is at equilibrium at a pressure of 1 atm, in a closed container. NaOH(s) + CO2(g) NaHCO3(s); ΔH°rxn < 0 Which, if any, of the following actions will decrease the concentration of CO2 gas present at equilibrium? A. lowering
  48. MATH

    How do I write one equations in slope-intercept form, and three other lines in slope-intercept form that are perpendicular to the first line ?? for ex. If I pick the equation y=2/3x+4 for the first equation. and for the second line , the slope -2/3x +4 ,
  49. chemistry

    A 20.9 g sample of nitrogen gas combines completely with 4.5 g of hydrogen gas to form ammonia. What is the mass of ammonia formed? A 12.7 g sample of X combines with a 24.4 g sample of Y to form the compound XY2. What is the mass of the reactants?
  50. Red House Primary School

    Sally is thinking of a ratio.the simplest form of the ratio is 2:3.if she subtracts 1 from the first number in her ratio and adds 2 to the second number of her ratio,the simples form of new ratio is 1:2.Find the ratio that Sally is thinking of
  51. chemistry

    The reaction between sodium hydroxide and hydrobromic acid is represented in the equation below: OH- + H+ -> H2O A 62.5 mL sample of 1.86 M NaOH at 22.5 deg Celsius was mixed with 62.5 mL sample of 1.86 M of HBr at 22.5 deg Celsius in a coffee cup
  52. Algebra

    I'm trying this again, I'd like the quadratic form, so i can then work the intercepts myself. SO: what's the quadratic form of 1/4(x+3)^2-4 I need it to find the intercepts of the parabola it describes. Check: I think the parabola is 1/4 scaled, moved 3 to
  53. Biochemistry

    Urea is heated in a test tube. A condensation reaction occurs. Which one? What is the formula for this reaction? Then cupper sulphate and sodium hydroxide is added to the tube. This is compared to a tube in which cupper sulphate, sodium hydroxide and a
  54. biology

    1. Some photosynthetic bacteria are able to harvest 900-nanometer light (4 points). A. What is the energy in kilocalories of a mole (an einstein) of 900-nanometer light? B. What is the minimum number of 900 nanometer photons needed to form one molecule of
  55. hum 176

    Choose a form of popular media that you are passionate about. The media may be music, a book, or a movie. · Write a thesis sentence stating how and why it is more than just a piece of entertainment. The thesis must include why it is a legitimate form of
  56. Chemistry

    Acetic acid is a polar molecule and can form hydrogen bonds with molecules. Therefore, it has a high soulubility in water. Yet acetic acid is also soluble in benzene (C6H6), a nonpolar solvent that lacks the ability to form hydrogen bonds. A solution of
  57. chemistry

    if my reaction is 2Na + 2H2O -> 2NaOH +H2, and i have been given 1 gram of sodium, how would i measure the theoretical change in heat of the reaction, assuming the reactants are at room temperature? Look in your text, probably in the appendix, for delta
  58. science 8th grade

    ok, i don't have answer to these questions! #8: The interaction of air, water, and _________ causes weather. #9: Violent storms generally form where? #10:clouds form as warm air rises, expands, cools, and becomes saturated, and then _______________
  59. chemistry

    how do you solve this? The candy indistry converts sucrose (C11H22O11,table sugar),a crystalline material, to invert sugar, a hydrolzyed [rpdict tjat os 50:50 frutose and glucose. The hydrolysis occurs in water, quite slowly, at an elevated temperature of
  60. Combustion

    In a combustion reaction, do the products or the reactants store more energy? It is the products right? As heat energy goes into the products. Potential energy is greater in the reactants. Heat is lost in the reaction, so the products have lower energy.
  61. chemistery

    What is the equilibrium constant for the reaction taking place at room temperature (T = 25◦C) in the battery Zn(s)| Zn2+(aq)|| Ce4+(aq)| Ce3+(aq) ? Assume that the number of electrons transferred in the reaction is n = 2. Zn2+ + 2 e − →
  62. Results for a coffee cup calorimetry Lab

    Hello there, I am a little confused with the results I got after doing this coffee cup calorimetry experiment. If you could please review my formulas to see if I am doing everything properly I would be most appreciative. For a reaction between baking soda
  63. math

    The graph of an equation in the form y=mx + b is a straight line. Can the equation of every straight line be written in the form y=mx + b (Hint: What is the equation of a vertical line?)
  64. Chemistry

    If 26.4 grams of nitrogen and 30.1 grams of oxygen combine to form nitrogen monoxide, how many grams of nitrogen monoxide must form? I am confused on how to do the math.
  65. Science-Chemistry

    Methyl amine is a weak base with a pKb=3.35. Consider the titration of 30.0mL of .030M of Methyl amine with 0.025M HCl. a) Write the appropriate equation for the reaction. b) Calculate K for the reaction in part (a). c) Calculate pH of the initial methyl
  66. chemistry

    The decomposition of hydrogen peroxide in solution and in the presence of iodide ion was studied in laboratory, and the following mechanism proposed based on the experimental data. H2O2 + I - = H2O + IO - (slow) H2O2 + IO - = H2O + O2 + I - (fast) Which
  67. Physical Science ?

    1. Cooking requires continuous addition of energy to the chemical reactions that are taking place. The chemical reactions involved in cooking can be described as _____. 2. Measuring how quickly a reactant disappears is one way to measure the _____ of the
  68. chemistry

    In Part I the reaction you observed was Mg(OH)2 (s)  Mg2+ (aq) + 2 OH- (aq). Compare the colors you observed in the experiment and answer these questions: A. Which way should the equilibrium shift when HCl is added? How do your results support your
  69. chemistry

    The decomposition of hydrogen peroxide in solution and in the presence of iodide ion was studied in laboratory, and the following mechanism proposed based on the experimental data. H2O2 + I - = H2O + IO - (slow) H2O2 + IO - = H2O + O2 + I - (fast) Which
  70. English

    1. He built a house with straw. 2. He built a house with straws. 3. He built a house with wood. 4. He built a house with woods. 5. He built a house with brick. 6. He built a house with bricks. (Which one is right? Do I have to use a singular form or plural
  71. Math-Algebra

    Bracy would like to form a right triangle our of her wooden sticks. She cut the first stick of the length 6 inches and the second stick of the length 4 inches. What should be the length of the third stick to make sure she will be able to form a right
  72. Essential Algebra Readiness

    1. Write the following ratio in simplest form: 32 minutes: 36 minutes A. 8:9 B. 8:36 C. 32:9 D. 128:144 I chose: A 2. In a sports equipment locker, there are 81 balls and 45 baseball mitts. Write the ratio of balls to mitts in simplest form. A. 9:5 B.
  73. math, correction

    Add or subtract as indicated. Express your result in simplest form. (5)/(4cd) Plus (11)/(4cd) My answer: (4)/(cd) --------------------------------------- Add or subtract as indicated. Express your result in simplest form. (x^2)/(x-3) Subtracted by
  74. Chemistry

    A 0.1mol/dm^3 aqueous solution of phosphoric (V) acid, H3PO4, is mixed with a 0.1 mol/dm^3 of aqueous solution of sodium hydroxide. Which mixture will form the salt Na3PO4? a) 10cm^3 of H3PO4 with 30cm^3 of NaOH b) 10cm^3 of H3PO4 with 10cm^3 of NaOH c)
  75. Chemistry

    According to the following reaction, how many grams of nitrogen gas will be formed upon the complete reaction of 22.2 grams of hydrogen gas with excess nitrogen monoxide? nitrogen monoxide (g) + hydrogen (g) nitrogen (g) + water (l)
  76. Chemistry

    1.What hydrocarbons generally will undergo an immediate reaction with Br? 2.What hydrocarbons generally will undergo an immediate reaction with KMnO4 Choices for both are Alcohols,Alkanes, Alkenes, Aromatics I think for 1. is at least Alkenes and maybe
  77. Chemistry

    1.What hydrocarbons generally will undergo an immediate reaction with Br? 2.What hydrocarbons generally will undergo an immediate reaction with KMnO4 Choices for both are Alcohols,Alkanes, Alkenes, Aromatics I think for 1. is at least Alkenes and maybe
  78. chemistry

    According to the following reaction, how many grams of sulfur trioxide will be formed upon the complete reaction of 21.2 grams of oxygen gas with excess sulfur dioxide? sulfur dioxide (g) + oxygen (g) sulfur trioxide (g)
  79. french (Checking answers)

    I'm not sure if I'm correct but I tried answering, THANKS Ms.Sue for helping. What is the correct form of lequel to replace the follow noun: le balcon - Lesquels - Lequel <--- - Lesquelles - Laquelle What is the correct form of lequel to replace the
  80. Chemistry

    Methyl amine is a weak base with a pKb=3.35. Consider the titration of 30.0mL of .030M of Methyl amine with 0.025M HCl. a) Write the appropriate equation for the reaction. b) Calculate K for the reaction in part (a). c) Calculate pH of the initial methyl
  81. chemistry

    Copper(II) sulfide reacts with oxygen to produce copper (II) oxide plus sulfur dioxide. Suppose you start this reaction with 50.0 grams of copper(II) sulfide and 50.0 grams of oxygen and you actually produce 33.5 grams of copper(II) oxide. Calculate the
  82. PHI 103 Informal Logic

    Write two arguments in English, one in the form of modus ponens and one in the form of modus tollens. Then, write the arguments in symbols using sentence letters and truth-functional connectives. (If your computer does not have all the symbols needed, use
  83. Electrochemistry

    In lab, we did an experiment with electrochemical cells with solutions of ZnSO4, CuSO4, Al2(SO4)3 and MgSO4 and their respective metal electrodes. There are a couple of post-lab questions that I'm not sure about: (1) Summarize Part A with a data table
  84. chemistry

    Consider the reaction shown: 452 kcal + 4 PCl5 (s) ¨ P4 (s) + 10 Cl2(g) This reaction is ________ because the sign of ƒ¢H is ________. A) exothermic; neither positive nor negative B) endothermic; positive C) endothermic; negative D) exothermic;
  85. Chem

    Consider the reaction shown: 452 kcal + 4 PCl5 (s) ¨ P4 (s) + 10 Cl2(g) This reaction is ________ because the sign of ƒ¢H is ________. A) exothermic; neither positive nor negative B) endothermic; positive C) endothermic; negative D) exothermic;
  86. Ratios of Similar Figures

    1. Write the following ratio in simplest form: 32 min : 36 min a. 8 : 9 b. 8 : 36 c. 32 :9 d. 128 : 144 2. In a sports equipment locker, there are 81 balls and 45 baseball mitts. Write the ratio of balls to baseball mitts in simplest form. a. 9 : 5 b. 10 :
  87. chemistry

    Under standard conditions, the Gibbs free energy of the reactants G,std(reactants) in a reaction in the gas phase is 232.94 kJ and the Gibbs free energy of the products G,std(products) is 211.56 kJ. Calculate the value of the equilibrium constant for this
  88. Spanish!!!!!! Can Anyone Help Please!!

    Which one would be correct: La semana pasada ellos me DIERON dinero. Or La semana pasada ellos me DI dinero. There's me so i don't know if it should be dar in the yo form or the they form for ellos.
  89. chemistry

    when heated in the presence of air, 80 grms. of copper completely react to form 100 grms. of copper oxide what is the mass of oxygen that has combined with the copper? how much copper must be heated to form 300 grms. of copper oxide?
  90. chemistry

    The decomposition of hydrogen peroxide in solution and in the presence of iodide ion was studied in laboratory, and the following mechanism proposed based on the experimental data. H2O2 + I - = H2O + IO - (slow) H2O2 + IO - = H2O + O2 + I - (fast) Which
  91. Chemistry

    What occurs in the process of ionization? A. Acids dissociate to produce hydroxide ions, as their only negative ions. B. Strong bases ionize almost completely yielding a maximum quantity of hydrogen ions. C. Stationary solid ions are produced. D. Ions are
  92. chem - precipitation problems

    When hydroge sulfide gas is passed through a solution of lead (II) nitrate, lead (II) sulfide precipitates out. Write a balanced equation for this reaction and calculate an average rate, in mol/s for the reaction from this data: 1) at 0 seconds, mass of
  93. Chemistry

    Which of the following reactions are spontaneous (favorable)? A] 2Mg(s) + O2(g) -> 2MgO(s) Delta G = -1137 kJ/mol .. B] NH3(g) + HCl(g) -> NH4Cl(s) Delta G = -91.1 kJ/mol ... C] AgCl(s) -> Ag+(aq) + Cl-(aq) Delta G = 55.6 kJ/mol .. D] 2H2(g) +
  94. Medical information management and office practice

    please check my answers. penn foster exercise 6 questions cms-1500 1.title in heading section? designated insurance co 2.location of title? right hand side top of blocks 3. cms-1500 form number? 4. location of cms-1500 top left side 5. spacing type of
  95. chemistry

    1. Chemical reactions may occur when two different molecules collide. The frequency and energy of the collisions determine how many reactions occur. How would you expect that frequency of collisions in a gas to change if the temperature changes from 293 K
  96. science(chem)

    I synthesized Nylon in my lab for organic chem. I need help figuring out the theoretical yield so I can compare it to my product that I synthesized. I looked up the reaction online on Google by typing in "Synthesis of adipoyl chloride and nylon 6.6." I
  97. Chemistry

    ok.. im confused: Ammonia and oxygen react in the equation: 4NH³+5O²--> 4NO+6H²O. When 2.4 mol of NH³ are present, the reaction yields ____ mol of O². i have no clue how ot do this! Look at your problem to make sure it is posted correctly. NH3
  98. PRACTICAL EXERCISE LOCAL STANDARDS AND REGULATIONS

    2. Mrs. Carroll and Ms. Howard decide to divide all profits and share all losses using a fixed ratio. If the ratio agreed upon is in proportion to their original investment, what would be Ms. Howard’s share of a $60,000 end-of-year profit? (Hint: The
  99. science

    With action-reaction forces, _____. A. the action force is created first B. the reaction force is created first C. the forces are created at the same time D. both forces already existed I think it is D..?
  100. History

    What was the purpose of using culture to spread the message of the Russian Revolution? a.The Nationalists sought to brainwash the Russian people into accepting their authoritarian rule. b.The Stalinists needed to prove that their form of socialism was a